Acronym laq
Name pentacontihexapentacosiheptacontihexaexon,
Gosset polyexon 21,3,
vertex figure of naquoh,
E7 polytope (span of its roots)
Circumradius 1
Lace city
in approx. ASCII-art
 ©
         o         	--- o3o3o *b3o3o3o (pt)
                   	
o     +     -     o	--- x3o3o *b3o3o3o (hax)
                   	
   -     #     +   	--- o3o3o *b3o3x3o (rag)
                   	
o     +     -     o	--- x3o3o *b3o3o3o (hax)
                   	
         o         	--- o3o3o *b3o3o3o (pt)
                   
where:
o = o3o3o3o3o (pt)
+ = o3x3o3o3o (rix)
- = o3o3o3x3o (inv. rix)
# = x3o3o3o3x (scad)
               _+-------------- x3o3o3o3o *c3o (jak)
              /      _+-------- o3o3o3o3o *c3x (mo)
            _/      /      _+-- o3o3o3o3x *c3o (alt. jak)
           /      _/      /
                 
        o        		--- o3o3o *b3o3o3o (pt)
                 
                 
    h       H    		--- x3o3o *b3o3o3o (hax)
                 
                 
t       r       t		--- o3o3o *b3o3x3o (rag)
                 
                 
    h       H    		--- x3o3o *b3o3o3o (hax)
                 
                 
        o        		--- o3o3o *b3o3o3o (pt)
                 
where:
o = o3o3o *b3o3o (pt)
h = x3o3o *b3o3o (hin)
H = o3o3x *b3o3o (alt. hin)
t = o3o3o *b3o3x (tac)
r = o3o3o *b3x3o (rat)
             _+------ x3o3o3o3o3o (hop)
           _/ _+----- o3o3o3x3o3o (inv. bril)
         _/ _/ _+---- x3o3o3o3o3x (staf)
       _/ _/ _/ _+--- o3o3x3o3o3o (bril)
     _/ _/ _/ _/ _+-- o3o3o3o3o3x (dual hop)
             
   h  R  h   		--- x3o3o3o3o *c3o (jak)
             
o  d  s  d  o		--- o3o3o3o3o *c3x (mo)
             
   H  r  H   		--- o3o3o3o3x *c3o (alt. jak)
             
|  |  |  |  +-- o3o3o *b3o3o3o (pt)
|  |  |  +----- x3o3o *b3o3o3o (hax)
|  |  +-------- o3o3o *b3o3x3o (rag)
|  +----------- x3o3o *b3o3o3o (hax)
+-------------- o3o3o *b3o3o3o (pt)
where:
o = o3o3o3o3o (pt)
h = x3o3o3o3o (hix)
H = o3o3o3o3x (dual hix)
r = o3x3o3o3o (rix)
R = o3o3o3x3o (alt. rix)
d = o3o3x3o3o (dot)
s = x3o3o3o3x (scad)

Note: 
o, h, H, s together comprise x3o3o3o3o3o3x (suph)
r, R, d, D together comprise o3o3o3x3o3o3o (he)
Lace hyper city
in approx. ASCII-art
                    p                    
                  /|\ \                  
                /    \  \                
              /       E   \              
            /     |    \    \            
          O             \     O          
        /            _  p _     \        
      /        _ E-      |  - _   \      
    /    _  N                   N _ \    
  /_  -                             - \  
p _             |   X   |            _  p
  \ - _                        _  -   /  
    \   N _              _  N       /    
      \     - _|   _  -E          /      
        \       p               /        
          O     \             O          
            \    \    |     /            
              \   E       /              
                \  \    /                
                  \ \|/                  
                    p                    

where:
p = o3o3o *b3o (point)
N = x3o3o *b3o (hex)
E = o3o3x *b3o (gyro hex)
O = o3o3o *b3x (alt. gyro hex)
X = o3x3o *b3o (ico)

thus vertically:  o3o3o *b3o3o3o (point) || x3o3o *b3o3o3o (hax) || o3o3o *b3o3x3o (rag) || x3o3o *b3o3o3o (hax) || o3o3o *b3o3o3o (point)
or face-2-face:   x3o3o3o3o *c3o (jak) || o3o3o3o3o *c3x (mo) || o3o3o3o3x *c3o (alt. jak)
or line-2-line:   o o3o3o *c3o3x (tac) || x x3o3o *c3o3o (hinnip) || compound of u o3o3o *c3o3o (perp u-line) and o o3o3o *c3x3o (rat) || x o3o3x *c3o3o (alt. hinnip) || o o3o3o *c3o3x (tac)
Confer
uniform relative:
he   suph  
related segmentoexa:
haxpy   haxarag   hopalbril   hopastaf   brilastaf  
related orbiforms:
oxo3ooo3ooo3xoo3ooo3oxx&#xt  
general polytopal classes:
Coxeter-Elte-Gosset polytopes  
External
links
wikipedia   wikipedia  

Wrt. A7 subsymmetry laq can be thought of as a tegum sum of suph and he.
Wrt. D6 × A1 subsymmetry laq can be thought of as a tegum sum of u-line, haxip and rag.
Wrt. D4 × A1 × A1 × A1 subsymmetry (which is in turn a subsymmetry of D6 × A1 too) laq can be thought of as a tegum sum of ico, 3 fully perp. u-lines, and 3 relatively gyro-orthogonal squahexes.


Incidence matrix according to Dynkin symbol

x3o3o3o *c3o3o3o

. . . .    . . . | 126    32 |   240 |   640 |  160   480 |  60  192 | 12  32
-----------------+-----+------+-------+-------+------------+----------+-------
x . . .    . . . |   2 | 2016     15 |    60 |   20    60 |  15   30 |  6   6
-----------------+-----+------+-------+-------+------------+----------+-------
x3o . .    . . . |   3 |    3 | 10080      8 |    4    12 |   6    8 |  4   2
-----------------+-----+------+-------+-------+------------+----------+-------
x3o3o .    . . .    4 |    6 |     4 | 20160 |    1     3 |   3    3 |  3   1
-----------------+-----+------+-------+-------+------------+----------+-------
x3o3o3o    . . .    5 |   10 |    10 |     5 | 4032     * |   3    0 |  3   0
x3o3o . *c3o . .    5 |   10 |    10 |     5 |    * 12096 |   1    2 |  2   1
-----------------+-----+------+-------+-------+------------+----------+-------
x3o3o3o *c3o . .   10 |   40 |    80 |    80 |   16    16 | 756    * |  2   0
x3o3o . *c3o3o .    6 |   15 |    20 |    15 |    0     6 |   * 4032 |  1   1
-----------------+-----+------+-------+-------+------------+----------+-------
x3o3o3o *c3o3o .   27 |  216 |   720 |  1080 |  216   432 |  27   72 | 56   *
x3o3o . *c3o3o3o    7 |   21 |    35 |    35 |    0    21 |   0    7 |  * 576

oxoxo3ooooo3ooooo *b3ooooo3ooxoo3ooooo&#xt   → all heights = 1/2 = 0.5
(pt || pseudo hax || pseudo rag || pseudo hax || pt)

o....3o....3o.... *b3o....3o....3o....     & | 2  *  *  32   0   0  0   0 | 240    0    0    0   0   0   0 |  640   0   0    0    0    0    0    0   0 | 160 480   0   0   0    0    0    0    0    0   0   0   0 | 192  60  0   0   0    0   0   0   0  0 | 32 12   0  0   0
.o...3.o...3.o... *b3.o...3.o...3.o...     & | * 64  *   1  15  15  1   0 |  15   60   90   60  15   0   0 |   60  20  60  180  180   60   20   60   0 |  20  60  30  60  60  180   60   60   30   60  20   0   0 |  30  15  6  60  30   60   6  15  30  0 |  6  6  20  6   6
..o..3..o..3..o.. *b3..o..3..o..3..o..       | *  * 60   0   0  16  0  16 |   0    0   48  128   8  48   8 |    0   0   0   64  192  192   64   64  64 |   0   0   0  16  16  128   96   96  128   96  32  16  16 |   0   2  0  32  32   64  32  24  64  2 |  0  4  16  8  16
---------------------------------------------+---------+-------------------+--------------------------------+-------------------------------------------+----------------------------------------------------------+----------------------------------------+-----------------
oo...3oo...3oo... *b3oo...3oo...3oo...&#x  & | 1  1  0 | 64   *   *  *   *   15    0    0    0   0   0   0 |   60   0   0    0    0    0    0    0   0 |  20  60   0   0   0    0    0    0    0    0   0   0   0 |  30  15  0   0   0    0   0   0   0  0 |  6  6   0  0   0
.x... ..... .....    ..... ..... .....     & | 0  2  0 |  * 480   *  *   *    1    8    6    0   0   0   0 |    8   4  12   24   12    0    0    0   0 |   4  12   8  12  12   24    4    4    0    0   0   0   0 |   8   6  2  12   8    8   0   1   0  0 |  2  4   4  2   0
.oo..3.oo..3.oo.. *b3.oo..3.oo..3.oo..&#x  & | 0  1  1 |  *   * 960  *   *    0    0    6    8   1   0   0 |    0   0   0   12   24   12    4    8   0 |   0   0   0   4   4   24   12   12   12    8   4   0   0 |   0   1  0   8   8   12   2   6   8  0 |  0  2   4  4   2
.o.o.3.o.o.3.o.o. *b3.o.o.3.o.o.3.o.o.&#x    | 0  2  0 |  *   *   * 32   *    0    0    0    0  15   0   0 |    0   0   0    0    0    0    0   60   0 |   0   0   0   0   0    0    0    0    0   60  20   0   0 |   0   0  0   0   0    0   0  15  30  0 |  0  0   0  6   6
..... ..... .....    ..... ..x.. .....       | 0  0  2 |  *   *   *  * 480    0    0    0    8   0   6   1 |    0   0   0    0   12   24    8    4  12 |   0   0   0   0   0    8   12   12   24   12   4   4   4 |   0   0  0   2   8    8   8   6  12  1 |  0  2   2  4   4
---------------------------------------------+---------+-------------------+--------------------------------+-------------------------------------------+----------------------------------------------------------+----------------------------------------+-----------------
ox... ..... .....    ..... ..... .....&#x  & | 1  2  0 |  2   1  0   0   0 | 480    *    *    *   *   *   *     8   0   0    0    0    0    0    0   0 |   4  12   0   0   0    0    0    0    0    0   0   0   0 |   8   6  0   0   0    0   0   0   0  0 |  2  4   0  0   0
.x...3.o... .....    ..... ..... .....     & | 0  3  0 |  0   3   0  0   0 |   * 1280    *    *   *   *   *     1   1   3    3    0    0    0    0   0 |   1   3   3   3   3    3    0    0    0    0   0   0   0 |   3   3  1   3   3    1   0   0   0  0 |  1  3   1  1   0
.xo.. ..... .....    ..... ..... .....&#x  & | 0  2  1 |  0   1   2  0   0 |   *    * 2880    *   *   *   *     0   0   0    4    4    0    0    0   0 |   0   0   0   2   2    8    2    2    0    0   0   0   0 |   0   1  0   4   4    4   0   1   0  0 |  0  2   2  2   0
..... ..... .....    ..... .ox.. .....&#x  & | 0  1  2 |  0   0   2  0   1 |   *    *    * 3840   *   *   *     0   0   0    0    3    3    1    1   0 |   0   0   0   0   0    3    3    3    3    3   1   0   0 |   0   0  0   1   3    3   1   3   3  0 |  0  1   1  3   1
.ooo.3.ooo.3.ooo. *b3.ooo.3.ooo.3.ooo.&#xt   | 0  2  1 |  0   0   2  1   0 |   *    *    *    * 480   *   *     0   0   0    0    0    0    0    8   0 |   0   0   0   0   0    0    0    0    0   12   4   0   0 |   0   0  0   0   0    0   0   6   8  0 |  0  0   0  4   2
..... ..... .....    ..o..3..x.. .....       | 0  0  3 |  0   0   0  0   3 |   *    *    *    *   * 960   *     0   0   0    0    0    4    0    0   4 |   0   0   0   0   0    0    2    0    8    2   0   2   2 |   0   0  0   0   4    0   4   1   4  1 |  0  2   0  2   2
..... ..... .....    ..... ..x..3..o..       | 0  0  3 |  0   0   0  0   3 |   *    *    *    *   *   * 160     0   0   0    0    0    0    8    0   0 |   0   0   0   0   0    0    0   12    0    0   4   0   0 |   0   0  0   0   0    8   0   6   0  0 |  0  0   2  4   0
---------------------------------------------+---------+-------------------+--------------------------------+-------------------------------------------+----------------------------------------------------------+----------------------------------------+-----------------
ox...3oo... .....    ..... ..... .....&#x  &  1  3  0 |  3   3   0  0   0 |   3    1    0    0   0   0   0 | 1280   *   *    *    *    *    *    *   * |   1   3   0   0   0    0    0    0    0    0   0   0   0 |   3   3  0   0   0    0   0   0   0  0 |  1  3   0  0   0
.x...3.o...3.o...    ..... ..... .....     &  0  4  0 |  0   6   0  0   0 |   0    4    0    0   0   0   0 |    * 320   *    *    *    *    *    *   * |   1   0   0   3   0    0    0    0    0    0   0   0   0 |   0   3  0   3   0    0   0   0   0  0 |  0  3   1  0   0
.x...3.o... ..... *b3.o... ..... .....     &  0  4  0 |  0   6   0  0   0 |   0    4    0    0   0   0   0 |    *   * 960    *    *    *    *    *   * |   0   1   2   0   1    0    0    0    0    0   0   0   0 |   2   1  1   0   2    0   0   0   0  0 |  1  2   0  1   0
.xo..3.oo.. .....    ..... ..... .....&#x  &  0  3  1 |  0   3   3  0   0 |   0    1    3    0   0   0   0 |    *   *   * 3840    *    *    *    *   * |   0   0   0   1   1    2    0    0    0    0   0   0   0 |   0   1  0   2   2    1   0   0   0  0 |  0  2   1  1   0
.xo.. ..... .....    ..... .ox.. .....&#x  &  0  2  2 |  0   1   4  0   1 |   0    0    2    2   0   0   0 |    *   *   *    * 5760    *    *    *   * |   0   0   0   0   0    2    1    1    0    0   0   0   0 |   0   0  0   1   2    2   0   1   0  0 |  0  1   1  2   0
..... ..... .....    .oo..3.ox.. .....&#x  &  0  1  3 |  0   0   3  0   3 |   0    0    0    3   0   1   0 |    *   *   *    *    * 3840    *    *   * |   0   0   0   0   0    0    1    0    2    1   0   0   0 |   0   0  0   0   2    0   1   1   2  0 |  0  1   0  2   1
..... ..... .....    ..... .ox..3.oo..&#x  &  0  1  3 |  0   0   3  0   3 |   0    0    0    3   0   0   1 |    *   *   *    *    *    * 1280    *   * |   0   0   0   0   0    0    0    3    0    0   1   0   0 |   0   0  0   0   0    3   0   3   0  0 |  0  0   1  3   0
..... ..... .....    ..... .oxo. .....&#xt    0  2  2 |  0   0   4  1   1 |   0    0    0    2   2   0   0 |    *   *   *    *    *    *    * 1920   * |   0   0   0   0   0    0    0    0    0    3   1   0   0 |   0   0  0   0   0    0   0   3   3  0 |  0  0   0  3   1
..... ..o.. ..... *b3..o..3..x.. .....        0  0  4 |  0   0   0  0   6 |   0    0    0    0   0   4   0 |    *   *   *    *    *    *    *    * 960 |   0   0   0   0   0    0    0    0    2    0   0   1   1 |   0   0  0   0   2    0   2   0   1  1 |  0  2   0  1   1
---------------------------------------------+---------+-------------------+--------------------------------+-------------------------------------------+----------------------------------------------------------+----------------------------------------+-----------------
ox...3oo...3oo...    ..... ..... .....&#x  &  1  4  0 |  4   6   0  0   0 |   6    4    0    0   0   0   0 |    4   1   0    0    0    0    0    0   0 | 320   *   *   *   *    *    *    *    *    *   *   *   * |   0   3  0   0   0    0   0   0   0  0 |  0  3   0  0   0
ox...3oo... ..... *b3oo... ..... .....&#x  &  1  4  0 |  4   6   0  0   0 |   6    4    0    0   0   0   0 |    4   0   1    0    0    0    0    0   0 |   * 960   *   *   *    *    *    *    *    *   *   *   * |   2   1  0   0   0    0   0   0   0  0 |  1  2   0  0   0
.x...3.o... ..... *b3.o...3.o... .....     &  0  5  0 |  0  10   0  0   0 |   0   10    0    0   0   0   0 |    0   0   5    0    0    0    0    0   0 |   *   * 384   *   *    *    *    *    *    *   *   *   * |   1   0  1   0   1    0   0   0   0  0 |  1  1   0  1   0
.xo..3.oo..3.oo..    ..... ..... .....&#x  &  0  4  1 |  0   6   4  0   0 |   0    4    6    0   0   0   0 |    0   1   0    4    0    0    0    0   0 |   *   *   * 960   *    *    *    *    *    *   *   *   * |   0   1  0   2   0    0   0   0   0  0 |  0  2   1  0   0
.xo..3.oo.. ..... *b3.oo.. ..... .....&#x  &  0  4  1 |  0   6   4  0   0 |   0    4    6    0   0   0   0 |    0   0   1    4    0    0    0    0   0 |   *   *   *   * 960    *    *    *    *    *   *   *   * |   0   1  0   0   2    0   0   0   0  0 |  0  2   0  1   0
.xo..3.oo.. .....    ..... .ox.. .....&#x  &  0  3  2 |  0   3   6  0   1 |   0    1    6    3   0   0   0 |    0   0   0    2    3    0    0    0   0 |   *   *   *   *   * 3840    *    *    *    *   *   *   * |   0   0  0   1   1    1   0   0   0  0 |  0  1   1  1   0
.xo.. ..... .....    .oo..3.ox.. .....&#x  &  0  2  3 |  0   1   6  0   3 |   0    0    3    6   0   1   0 |    0   0   0    0    3    2    0    0   0 |   *   *   *   *   *    * 1920    *    *    *   *   *   * |   0   0  0   0   2    0   0   1   0  0 |  0  1   0  2   0
.xo.. ..... .....    ..... .ox..3.oo..&#x  &  0  2  3 |  0   1   6  0   3 |   0    0    3    6   0   0   1 |    0   0   0    0    3    0    2    0   0 |   *   *   *   *   *    *    * 1920    *    *   *   *   * |   0   0  0   0   0    2   0   1   0  0 |  0  0   1  2   0
..... .oo.. ..... *b3.oo..3.ox.. .....&#x  &  0  1  4 |  0   0   4  0   6 |   0    0    0    6   0   4   0 |    0   0   0    0    0    4    0    0   1 |   *   *   *   *   *    *    *    * 1920    *   *   *   * |   0   0  0   0   1    0   1   0   1  0 |  0  1   0  1   1
..... ..... .....    .ooo.3.oxo. .....&#xt    0  2  3 |  0   0   6  1   3 |   0    0    0    6   3   1   0 |    0   0   0    0    0    2    0    3   0 |   *   *   *   *   *    *    *    *    * 1920   *   *   * |   0   0  0   0   0    0   0   1   2  0 |  0  0   0  2   1
..... ..... .....    ..... .oxo.3.ooo.&#xt    0  2  3 |  0   0   6  1   3 |   0    0    0    6   3   0   1 |    0   0   0    0    0    0    2    3   0 |   *   *   *   *   *    *    *    *    *    * 640   *   * |   0   0  0   0   0    0   0   3   0  0 |  0  0   0  3   0
..o..3..o.. ..... *b3..o..3..x.. .....        0  0  5 |  0   0   0  0  10 |   0    0    0    0   0  10   0 |    0   0   0    0    0    0    0    0   5 |   *   *   *   *   *    *    *    *    *    *   * 192   * |   0   0  0   0   2    0   0    0  0  1 |  0  2   0  1   0
..... ..o..3..o.. *b3..o..3..x.. .....        0  0  5 |  0   0   0  0  10 |   0    0    0    0   0  10   0 |    0   0   0    0    0    0    0    0   5 |   *   *   *   *   *    *    *    *    *    *   *   * 192 |   0   0  0   0   0    0   2   0   0  1 |  0  2   0  0   1
---------------------------------------------+---------+-------------------+--------------------------------+-------------------------------------------+----------------------------------------------------------+----------------------------------------+-----------------
ox...3oo... ..... *b3oo...3oo... .....&#x  &  1  5  0 |  5  10   0  0   0 |  10   10    0    0   0   0   0 |   10   0   5    0    0    0    0    0   0 |   0   5   1   0   0    0    0    0    0    0   0   0   0 | 384   *  *   *   *    *   *   *   *  * |  1  1   0  0   0
oxo..3ooo..3ooo.. *b3ooo.. ..... .....&#x  &  1  8  1 |  8  24   8  0   0 |  24   32   24    0   0   0   0 |   32   8   8   32    0    0    0    0   0 |   8   8   0   8   8    0    0    0    0    0   0   0   0 |   * 120  *   *   *    *   *   *   *  * |  0  2   0  0   0
.x...3.o... ..... *b3.o...3.o...3.o...     &  0  6  0 |  0  15   0  0   0 |   0   20    0    0   0   0   0 |    0   0  15    0    0    0    0    0   0 |   0   0   6   0   0    0    0    0    0    0   0   0   0 |   *   * 64   *   *    *   *   *   *  * |  1  0   0  1   0
.xo..3.oo..3.oo..    ..... .ox.. .....&#x  &  0  4  2 |  0   6   8  0   1 |   0    4   12    4   0   0   0 |    0   1   0    8    6    0    0    0   0 |   0   0   0   2   0    4    0    0    0    0   0   0   0 |   *   *  * 960   *    *   *   *   *  * |  0  1   1  0   0
.xo..3.oo.. ..... *b3.oo..3.ox.. .....&#x  &  0  5  5 |  0  10  20  0  10 |   0   10   30   30   0  10   0 |    0   0   5   20   30   20    0    0   5 |   0   0   1   0   5   10   10    0    5    0   0   1   0 |   *   *  *   * 384    *   *   *   *  * |  0  1   0  1   0
.xo..3.oo.. .....    ..... .ox..3.oo..&#x  &  0  3  3 |  0   3   9  0   3 |   0    1    9    9   0   0   1 |    0   0   0    3    9    0    3    0   0 |   0   0   0   0   0    3    0    3    0    0   0   0   0 |   *   *  *   *   * 1280   *   *   *  * |  0  0   1  1   0
..... .oo..3.oo.. *b3.oo..3.ox.. .....&#x  &  0  1  5 |  0   0   5  0  10 |   0    0    0   10   0  10   0 |    0   0   0    0    0   10    0    0   5 |   0   0   0   0   0    0    0    0    5    0   0   0   1 |   *   *  *   *   *    * 384   *   *  * |  0  1   0  0   1
.xox. ..... .....    .ooo.3.oxo.3.ooo.&#xt    0  4  6 |  0   2  24  2  12 |   0    0   12   48  12   4   4 |    0   0   0    0   24   16   16   24   0 |   0   0   0   0   0    0    8    8    0    8   8   0   0 |   *   *  *   *   *    *   * 240   *  * |  0  0   0  2   0
..... .ooo. ..... *b3.ooo.3.oxo. .....&#x     0  2  4 |  0   0   8  1   6 |   0    0    0   12   4   4   0 |    0   0   0    0    0    8    0    6   1 |   0   0   0   0   0    0    0    0    2    4   0   0   0 |   *   *  *   *   *    *   *   * 960  * |  0  0   0  1   1
..o..3..o..3..o.. *b3..o..3..x.. .....        0  0 10 |  0   0   0  0  40 |   0    0    0    0   0  80   0 |    0   0   0    0    0    0    0    0  80 |   0   0   0   0   0    0    0    0    0    0   0  16  16 |   *   *  *   *   *    *   *   *   * 12 |  0  2   0  0   0
---------------------------------------------+---------+-------------------+--------------------------------+-------------------------------------------+----------------------------------------------------------+----------------------------------------+-----------------
ox...3oo... ..... *b3oo...3oo...3oo...&#x  &  1  6  0 |  6  15   0  0   0 |  15   20    0    0   0   0   0 |   20   0  15    0    0    0    0    0   0 |   0  15   6   0   0    0    0    0    0    0   0   0   0 |   6   0  1   0   0    0   0   0   0  0 | 64  *   *  *   *
oxo..3ooo..3ooo.. *b3ooo..3oox.. .....&#xt &  1 16 10 | 16  80  80  0  40 |  80  160  240  160   0  80   0 |  160  40  80  320  240  160    0    0  80 |  40  80  16  80  80  160   80    0   80    0   0  16  16 |  16  10  0  40  16    0  16   0   0  1 |  * 24   *  *   *
.xo..3.oo..3.oo..    ..... .ox..3.oo..&#x  &  0  4  3 |  0   6  12  0   3 |   0    4   18   12   0   0   1 |    0   1   0   12   18    0    4    0   0 |   0   0   0   3   0   12    0    6    0    0   0   0   0 |   0   0  0   3   0    4   0   0   0  0 |  *  * 320  *   *
.xox.3.ooo. ..... *b3.ooo.3.oxo.3.ooo.&#xt    0 12 15 |  0  30 120  6  60 |   0   40  180  360  60  60  20 |    0   0  30  120  360  240  120  180  30 |   0   0  12   0  30  120  120  120   60  120  60   6   0 |   0   0  2   0  12   40   0  15  30  0 |  *  *   * 32   *
..... .ooo.3.ooo. *b3.ooo.3.oxo. .....&#x     0  2  5 |  0   0  10  1  10 |   0    0    0   20   5  10   0 |    0   0   0    0    0   20    0   10   5 |   0   0   0   0   0    0    0    0   10   10   0   0   1 |   0   0  0   0   0    0   2   0   5  0 |  *  *   *  * 192

oxo3ooo3ooo *b3ooo3oox3ooo uxo&#zxt   → both heights = 0
(tegum sum of u-line, haxip and rag)

o..3o..3o.. *b3o..3o..3o.. o..     | 2  *  *  32   0   0  0   0 | 240    0    0    0   0   0   0 |  640   0   0    0    0    0    0    0   0 | 160 480   0   0   0    0    0    0    0    0   0   0   0 | 192  60  0   0   0    0   0   0   0  0 | 32 12   0  0   0
.o.3.o.3.o. *b3.o.3.o.3.o. .o.     | * 64  *   1  15  15  1   0 |  15   60   90   60  15   0   0 |   60  20  60  180  180   60   20   60   0 |  20  60  30  60  60  180   60   60   30   60  20   0   0 |  30  15  6  60  30   60   6  15  30  0 |  6  6  20  6   6
..o3..o3..o *b3..o3..o3..o ..o     | *  * 60   0   0  16  0  16 |   0    0   48  128   8  48   8 |    0   0   0   64  192  192   64   64  64 |   0   0   0  16  16  128   96   96  128   96  32  16  16 |   0   2  0  32  32   64  32  24  64  2 |  0  4  16  8  16
-----------------------------------+---------+-------------------+--------------------------------+-------------------------------------------+----------------------------------------------------------+----------------------------------------+-----------------
oo.3oo.3oo. *b3oo.3oo.3oo. oo.&#x  | 1  1  0 | 64   *   *  *   *   15    0    0    0   0   0   0 |   60   0   0    0    0    0    0    0   0 |  20  60   0   0   0    0    0    0    0    0   0   0   0 |  30  15  0   0   0    0   0   0   0  0 |  6  6   0  0   0
.x. ... ...    ... ... ... ...     | 0  2  0 |  * 480   *  *   *    1    8    6    0   0   0   0 |    8   4  12   24   12    0    0    0   0 |   4  12   8  12  12   24    4    4    0    0   0   0   0 |   8   6  2  12   8    8   0   1   0  0 |  2  4   4  2   0
.oo3.oo3.oo *b3.oo3.oo3.oo .oo&#x  | 0  1  1 |  *   * 960  *   *    0    0    6    8   1   0   0 |    0   0   0   12   24   12    4    8   0 |   0   0   0   4   4   24   12   12   12    8   4   0   0 |   0   1  0   8   8   12   2   6   8  0 |  0  2   4  4   2
... ... ...    ... ... ... .x.&#x  | 0  2  0 |  *   *   * 32   *    0    0    0    0  15   0   0 |    0   0   0    0    0    0    0   60   0 |   0   0   0   0   0    0    0    0    0   60  20   0   0 |   0   0  0   0   0    0   0  15  30  0 |  0  0   0  6   6
... ... ...    ... ..x ... ...     | 0  0  2 |  *   *   *  * 480    0    0    0    8   0   6   1 |    0   0   0    0   12   24    8    4  12 |   0   0   0   0   0    8   12   12   24   12   4   4   4 |   0   0  0   2   8    8   8   6  12  1 |  0  2   2  4   4
-----------------------------------+---------+-------------------+--------------------------------+-------------------------------------------+----------------------------------------------------------+----------------------------------------+-----------------
ox. ... ...    ... ... ... ...&#x  | 1  2  0 |  2   1  0   0   0 | 480    *    *    *   *   *   *     8   0   0    0    0    0    0    0   0 |   4  12   0   0   0    0    0    0    0    0   0   0   0 |   8   6  0   0   0    0   0   0   0  0 |  2  4   0  0   0
.x.3.o. ...    ... ... ... ...     | 0  3  0 |  0   3   0  0   0 |   * 1280    *    *   *   *   *     1   1   3    3    0    0    0    0   0 |   1   3   3   3   3    3    0    0    0    0   0   0   0 |   3   3  1   3   3    1   0   0   0  0 |  1  3   1  1   0
.xo ... ...    ... ... ... ...&#x  | 0  2  1 |  0   1   2  0   0 |   *    * 2880    *   *   *   *     0   0   0    4    4    0    0    0   0 |   0   0   0   2   2    8    2    2    0    0   0   0   0 |   0   1  0   4   4    4   0   1   0  0 |  0  2   2  2   0
... ... ...    ... .ox ... ...&#x  | 0  1  2 |  0   0   2  0   1 |   *    *    * 3840   *   *   *     0   0   0    0    3    3    1    1   0 |   0   0   0   0   0    3    3    3    3    3   1   0   0 |   0   0  0   1   3    3   1   3   3  0 |  0  1   1  3   1
... ... ...    ... ... ... .xo&#x  | 0  2  1 |  0   0   2  1   0 |   *    *    *    * 480   *   *     0   0   0    0    0    0    0    8   0 |   0   0   0   0   0    0    0    0    0   12   4   0   0 |   0   0  0   0   0    0   0   6   8  0 |  0  0   0  4   2
... ... ...    ..o3..x ... ...     | 0  0  3 |  0   0   0  0   3 |   *    *    *    *   * 960   *     0   0   0    0    0    4    0    0   4 |   0   0   0   0   0    0    2    0    8    2   0   2   2 |   0   0  0   0   4    0   4   1   4  1 |  0  2   0  2   2
... ... ...    ... ..x3..o ...     | 0  0  3 |  0   0   0  0   3 |   *    *    *    *   *   * 160     0   0   0    0    0    0    8    0   0 |   0   0   0   0   0    0    0   12    0    0   4   0   0 |   0   0  0   0   0    8   0   6   0  0 |  0  0   2  4   0
-----------------------------------+---------+-------------------+--------------------------------+-------------------------------------------+----------------------------------------------------------+----------------------------------------+-----------------
ox.3oo. ...    ... ... ... ...&#x   1  3  0 |  3   3   0  0   0 |   3    1    0    0   0   0   0 | 1280   *   *    *    *    *    *    *   * |   1   3   0   0   0    0    0    0    0    0   0   0   0 |   3   3  0   0   0    0   0   0   0  0 |  1  3   0  0   0
.x.3.o.3.o.    ... ... ... ...      0  4  0 |  0   6   0  0   0 |   0    4    0    0   0   0   0 |    * 320   *    *    *    *    *    *   * |   1   0   0   3   0    0    0    0    0    0   0   0   0 |   0   3  0   3   0    0   0   0   0  0 |  0  3   1  0   0
.x.3.o. ... *b3.o. ... ... ...      0  4  0 |  0   6   0  0   0 |   0    4    0    0   0   0   0 |    *   * 960    *    *    *    *    *   * |   0   1   2   0   1    0    0    0    0    0   0   0   0 |   2   1  1   0   2    0   0   0   0  0 |  1  2   0  1   0
.xo3.oo ...    ... ... ... ...&#x   0  3  1 |  0   3   3  0   0 |   0    1    3    0   0   0   0 |    *   *   * 3840    *    *    *    *   * |   0   0   0   1   1    2    0    0    0    0   0   0   0 |   0   1  0   2   2    1   0   0   0  0 |  0  2   1  1   0
.xo ... ...    ... .ox ... ...&#x   0  2  2 |  0   1   4  0   1 |   0    0    2    2   0   0   0 |    *   *   *    * 5760    *    *    *   * |   0   0   0   0   0    2    1    1    0    0   0   0   0 |   0   0  0   1   2    2   0   1   0  0 |  0  1   1  2   0
... ... ...    .oo3.ox ... ...&#x   0  1  3 |  0   0   3  0   3 |   0    0    0    3   0   1   0 |    *   *   *    *    * 3840    *    *   * |   0   0   0   0   0    0    1    0    2    1   0   0   0 |   0   0  0   0   2    0   1   1   2  0 |  0  1   0  2   1
... ... ...    ... .ox3.oo ...&#x   0  1  3 |  0   0   3  0   3 |   0    0    0    3   0   0   1 |    *   *   *    *    *    * 1280    *   * |   0   0   0   0   0    0    0    3    0    0   1   0   0 |   0   0  0   0   0    3   0   3   0  0 |  0  0   1  3   0
... ... ...    ... .ox ... .xo&#x   0  2  2 |  0   0   4  1   1 |   0    0    0    2   2   0   0 |    *   *   *    *    *    *    * 1920   * |   0   0   0   0   0    0    0    0    0    3   1   0   0 |   0   0  0   0   0    0   0   3   3  0 |  0  0   0  3   1
... ..o ... *b3..o3..x ... ...      0  0  4 |  0   0   0  0   6 |   0    0    0    0   0   4   0 |    *   *   *    *    *    *    *    * 960 |   0   0   0   0   0    0    0    0    2    0   0   1   1 |   0   0  0   0   2    0   2   0   1  1 |  0  2   0  1   1
-----------------------------------+---------+-------------------+--------------------------------+-------------------------------------------+----------------------------------------------------------+----------------------------------------+-----------------
ox.3oo.3oo.    ... ... ... ...&#x   1  4  0 |  4   6   0  0   0 |   6    4    0    0   0   0   0 |    4   1   0    0    0    0    0    0   0 | 320   *   *   *   *    *    *    *    *    *   *   *   * |   0   3  0   0   0    0   0   0   0  0 |  0  3   0  0   0
ox.3oo. ... *b3oo. ... ... ...&#x   1  4  0 |  4   6   0  0   0 |   6    4    0    0   0   0   0 |    4   0   1    0    0    0    0    0   0 |   * 960   *   *   *    *    *    *    *    *   *   *   * |   2   1  0   0   0    0   0   0   0  0 |  1  2   0  0   0
.x.3.o. ... *b3.o.3.o. ... ...      0  5  0 |  0  10   0  0   0 |   0   10    0    0   0   0   0 |    0   0   5    0    0    0    0    0   0 |   *   * 384   *   *    *    *    *    *    *   *   *   * |   1   0  1   0   1    0   0   0   0  0 |  1  1   0  1   0
.xo3.oo3.oo    ... ... ... ...&#x   0  4  1 |  0   6   4  0   0 |   0    4    6    0   0   0   0 |    0   1   0    4    0    0    0    0   0 |   *   *   * 960   *    *    *    *    *    *   *   *   * |   0   1  0   2   0    0   0   0   0  0 |  0  2   1  0   0
.xo3.oo ... *b3.oo ... ... ...&#x   0  4  1 |  0   6   4  0   0 |   0    4    6    0   0   0   0 |    0   0   1    4    0    0    0    0   0 |   *   *   *   * 960    *    *    *    *    *   *   *   * |   0   1  0   0   2    0   0   0   0  0 |  0  2   0  1   0
.xo3.oo ...    ... .ox ... ...&#x   0  3  2 |  0   3   6  0   1 |   0    1    6    3   0   0   0 |    0   0   0    2    3    0    0    0   0 |   *   *   *   *   * 3840    *    *    *    *   *   *   * |   0   0  0   1   1    1   0   0   0  0 |  0  1   1  1   0
.xo ... ...    .oo3.ox ... ...&#x   0  2  3 |  0   1   6  0   3 |   0    0    3    6   0   1   0 |    0   0   0    0    3    2    0    0   0 |   *   *   *   *   *    * 1920    *    *    *   *   *   * |   0   0  0   0   2    0   0   1   0  0 |  0  1   0  2   0
.xo ... ...    ... .ox3.oo ...&#x   0  2  3 |  0   1   6  0   3 |   0    0    3    6   0   0   1 |    0   0   0    0    3    0    2    0   0 |   *   *   *   *   *    *    * 1920    *    *   *   *   * |   0   0  0   0   0    2   0   1   0  0 |  0  0   1  2   0
... .oo ... *b3.oo3.ox ... ...&#x   0  1  4 |  0   0   4  0   6 |   0    0    0    6   0   4   0 |    0   0   0    0    0    4    0    0   1 |   *   *   *   *   *    *    *    * 1920    *   *   *   * |   0   0  0   0   1    0   1   0   1  0 |  0  1   0  1   1
... ... ...    .oo3.ox ... .xo&#x   0  2  3 |  0   0   6  1   3 |   0    0    0    6   3   1   0 |    0   0   0    0    0    2    0    3   0 |   *   *   *   *   *    *    *    *    * 1920   *   *   * |   0   0  0   0   0    0   0   1   2  0 |  0  0   0  2   1
... ... ...    ... .ox3.oo .xo&#x   0  2  3 |  0   0   6  1   3 |   0    0    0    6   3   0   1 |    0   0   0    0    0    0    2    3   0 |   *   *   *   *   *    *    *    *    *    * 640   *   * |   0   0  0   0   0    0   0   3   0  0 |  0  0   0  3   0
..o3..o ... *b3..o3..x ... ...      0  0  5 |  0   0   0  0  10 |   0    0    0    0   0  10   0 |    0   0   0    0    0    0    0    0   5 |   *   *   *   *   *    *    *    *    *    *   * 192   * |   0   0  0   0   2    0   0    0  0  1 |  0  2   0  1   0
... ..o3..o *b3..o3..x ... ...      0  0  5 |  0   0   0  0  10 |   0    0    0    0   0  10   0 |    0   0   0    0    0    0    0    0   5 |   *   *   *   *   *    *    *    *    *    *   *   * 192 |   0   0  0   0   0    0   2   0   0  1 |  0  2   0  0   1
-----------------------------------+---------+-------------------+--------------------------------+-------------------------------------------+----------------------------------------------------------+----------------------------------------+-----------------
ox.3oo. ... *b3oo.3oo. ... ...&#x   1  5  0 |  5  10   0  0   0 |  10   10    0    0   0   0   0 |   10   0   5    0    0    0    0    0   0 |   0   5   1   0   0    0    0    0    0    0   0   0   0 | 384   *  *   *   *    *   *   *   *  * |  1  1   0  0   0
oxo3ooo3ooo *b3ooo ... ... ...&#xt  1  8  1 |  8  24   8  0   0 |  24   32   24    0   0   0   0 |   32   8   8   32    0    0    0    0   0 |   8   8   0   8   8    0    0    0    0    0   0   0   0 |   * 120  *   *   *    *   *   *   *  * |  0  2   0  0   0
.x.3.o. ... *b3.o.3.o.3.o. ...      0  6  0 |  0  15   0  0   0 |   0   20    0    0   0   0   0 |    0   0  15    0    0    0    0    0   0 |   0   0   6   0   0    0    0    0    0    0   0   0   0 |   *   * 64   *   *    *   *   *   *  * |  1  0   0  1   0
.xo3.oo3.oo    ... .ox ... ...&#x   0  4  2 |  0   6   8  0   1 |   0    4   12    4   0   0   0 |    0   1   0    8    6    0    0    0   0 |   0   0   0   2   0    4    0    0    0    0   0   0   0 |   *   *  * 960   *    *   *   *   *  * |  0  1   1  0   0
.xo3.oo ... *b3.oo3.ox ... ...&#x   0  5  5 |  0  10  20  0  10 |   0   10   30   30   0  10   0 |    0   0   5   20   30   20    0    0   5 |   0   0   1   0   5   10   10    0    5    0   0   1   0 |   *   *  *   * 384    *   *   *   *  * |  0  1   0  1   0
.xo3.oo ...    ... .ox3.oo ...&#x   0  3  3 |  0   3   9  0   3 |   0    1    9    9   0   0   1 |    0   0   0    3    9    0    3    0   0 |   0   0   0   0   0    3    0    3    0    0   0   0   0 |   *   *  *   *   * 1280   *   *   *  * |  0  0   1  1   0
... .oo3.oo *b3.oo3.ox ... ...&#x   0  1  5 |  0   0   5  0  10 |   0    0    0   10   0  10   0 |    0   0   0    0    0   10    0    0   5 |   0   0   0   0   0    0    0    0    5    0   0   0   1 |   *   *  *   *   *    * 384   *   *  * |  0  1   0  0   1
.xo ... ...    .oo3.ox3.oo .xo&#x   0  4  6 |  0   2  24  2  12 |   0    0   12   48  12   4   4 |    0   0   0    0   24   16   16   24   0 |   0   0   0   0   0    0    8    8    0    8   8   0   0 |   *   *  *   *   *    *   * 240   *  * |  0  0   0  2   0
... .oo ... *b3.oo3.ox ... .xo&#x   0  2  4 |  0   0   8  1   6 |   0    0    0   12   4   4   0 |    0   0   0    0    0    8    0    6   1 |   0   0   0   0   0    0    0    0    2    4   0   0   0 |   *   *  *   *   *    *   *   * 960  * |  0  0   0  1   1
..o3..o3..o *b3..o3..x ... ...      0  0 10 |  0   0   0  0  40 |   0    0    0    0   0  80   0 |    0   0   0    0    0    0    0    0  80 |   0   0   0   0   0    0    0    0    0    0   0  16  16 |   *   *  *   *   *    *   *   *   * 12 |  0  2   0  0   0
-----------------------------------+---------+-------------------+--------------------------------+-------------------------------------------+----------------------------------------------------------+----------------------------------------+-----------------
ox.3oo. ... *b3oo.3oo.3oo. ...&#x   1  6  0 |  6  15   0  0   0 |  15   20    0    0   0   0   0 |   20   0  15    0    0    0    0    0   0 |   0  15   6   0   0    0    0    0    0    0   0   0   0 |   6   0  1   0   0    0   0   0   0  0 | 64  *   *  *   *
oxo3ooo3ooo *b3ooo3oox ... ...&#xt  1 16 10 | 16  80  80  0  40 |  80  160  240  160   0  80   0 |  160  40  80  320  240  160    0    0  80 |  40  80  16  80  80  160   80    0   80    0   0  16  16 |  16  10  0  40  16    0  16   0   0  1 |  * 24   *  *   *
.xo3.oo3.oo    ... .ox3.oo ...&#x   0  4  3 |  0   6  12  0   3 |   0    4   18   12   0   0   1 |    0   1   0   12   18    0    4    0   0 |   0   0   0   3   0   12    0    6    0    0   0   0   0 |   0   0  0   3   0    4   0   0   0  0 |  *  * 320  *   *
.xo3.oo ... *b3.oo3.ox3.oo .xo&#x   0 12 15 |  0  30 120  6  60 |   0   40  180  360  60  60  20 |    0   0  30  120  360  240  120  180  30 |   0   0  12   0  30  120  120  120   60  120  60   6   0 |   0   0  2   0  12   40   0  15  30  0 |  *  *   * 32   *
... .oo3.oo *b3.oo3.ox ... .xo&#x   0  2  5 |  0   0  10  1  10 |   0    0    0   20   5  10   0 |    0   0   0    0    0   20    0   10   5 |   0   0   0   0   0    0    0    0   10   10   0   0   1 |   0   0  0   0   0    0   2   0   5  0 |  *  *   *  * 192

xoxoo3ooooo3oooxo3oxooo3ooooo3ooxox&#xt   → all heights = 1/sqrt(7) = 0.377964
(hop || inv pseudo bril || pseudo staf || pseudo bril || inv hop)

o....3o....3o....3o....3o....3o....     & | 14  *  *   6  20  6   0   0   0   0 | 15  60   90  15  60   0   0    0    0   0   0    0   0 | 20  60  180  60  60  20  180  60   0  0   0    0    0   0    0   0   0    0    0   0 | 15 20  90  60 120  15  15  15  120  60   90  20  0   0   0   0   0   0   0  0   0    0    0   0  0 |  6 15  60  30  6  30  30  60  15  0   0   0   0   0   0  0 | 1 15  1  6  15  6   0
.o...3.o...3.o...3.o...3.o...3.o...     & |  * 70  *   0   4  0  12  12   4   0 |  0   6   36   0  12  18  12   18   72  12  18   36   0 |  0   4   36  36  36   0   72  12  12  4  12   72   72  36   36   4  16   72  108   0 |  0  1  12  18  36  12  12   0   72  36   36   4  3   3  24  36  36  24  36  5  24   54  108  48  0 |  0  3  12  12  0  18  24  36  15  6  12  12  36  18  48  0 | 0  4  0  3  12  9  16
..o..3..o..3..o..3..o..3..o..3..o..       |  *  * 42   0   0  2   0  20   0  10 |  0   0    0  10  20   0   0   60   60  40   0   30  20 |  0   0    0   0   0  20   60  40   0  0  60  120   40  20   60  20   0  120   60  20 |  0  0   0   0   0   0   0  20   40  20   60  20  0  20  60  40  40  10  40  0  60   60  120  20 10 |  0  0   0   0 10  10  10  40  20 10  20  10  60  20  40  2 | 0  0  2  2  10 10  20
------------------------------------------+----------+---------------------------+--------------------------------------------------------+--------------------------------------------------------------------------------------+----------------------------------------------------------------------------------------------------+------------------------------------------------------------+----------------------
x.... ..... ..... ..... ..... .....     & |  2  0  0 | 42   *  *   *   *   *   *   5  10    0   0   0   0   0    0    0   0   0    0   0 | 10  20   30   0   0   0    0   0   0  0   0    0    0   0    0   0   0    0    0   0 | 10 10  30  10  20   0   0   0    0   0    0   0  0   0   0   0   0   0   0  0   0    0    0   0  0 |  5 10  20   5  0   5   0   0   0  0   0   0   0   0   0  0 | 1  5  0  5   0  1   0
oo...3oo...3oo...3oo...3oo...3oo...&#x  & |  1  1  0 |  * 280  *   *   *   *   *   0   3    9   0   3   0   0    0    0   0   0    0   0 |  0   3   18   9   9   0   18   3   0  0   0    0    0   0    0   0   0    0    0   0 |  0  1   9   9  18   3   3   0   18   9    9   1  0   0   0   0   0   0   0  0   0    0    0   0  0 |  0  3   9   6  0   9   6   9   3  0   0   0   0   0   0  0 | 0  3  0  3   3  3   0
o.o..3o.o..3o.o..3o.o..3o.o..3o.o..&#x  & |  1  0  1 |  *   * 84   *   *   *   *   0   0    0   5  10   0   0    0    0   0   0    0   0 |  0   0    0   0   0  10   30  20   0  0   0    0    0   0    0   0   0    0    0   0 |  0  0   0   0   0   0   0  10   20  10   30  10  0   0   0   0   0   0   0  0   0    0    0   0  0 |  0  0   0   0  5   5   5  20  10  0   0   0   0   0   0  0 | 0  0  1  1   5  5   0
..... ..... ..... .x... ..... .....     & |  0  2  0 |  *   *  * 420   *   *   *   0   0    3   0   0   3   2    0    6   0   1    0   0 |  0   0    3   6   6   0    6   0   3  1   0    6   12   6    3   0   2    0    6   0 |  0  0   1   3   6   3   3   0   12   6    3   0  1   0   2   6   6   6   6  1   0    3    6   6  0 |  0  1   2   3  0   6   6   6   3  2   2   3   2   3   6  0 | 0  1  0  2   3  4   2
.oo..3.oo..3.oo..3.oo..3.oo..3.oo..&#x  & |  0  1  1 |  *   *  *   * 840   *   *   0   0    0   0   1   0   0    3    6   2   0    3   0 |  0   0    0   0   0   0    6   2   0  0   3   12    6   3    6   1   0   12    9   0 |  0  0   0   0   0   0   0   0    6   3    6   1  0   1   6   6   6   2   6  0   6    9   18   4  0 |  0  0   0   0  0   3   2   6   4  2   3   2   9   6   8  0 | 0  0  0  1   2  5   4
.o.o.3.o.o.3.o.o.3.o.o.3.o.o.3.o.o.&#x    |  0  2  0 |  *   *  *   *   * 140   *   0   0    0   0   0   0   0    0    0   0   6    9   0 |  0   0    0   0   0   0    0   0   0  0   0    0    0   0    0   0   6   18   36   0 |  0  0   0   0   0   0   0   0    0   0    0   0  0   0   0   0   0   0   0  2   6   18   36  18  0 |  0  0   0   0  0   0   0   0   6  0   0   0  12   9  18  0 | 0  0  0  0   0  6   6
..x.. ..... ..... ..... ..... .....     & |  0  0  2 |  *   *  *   *   *   * 210   0   0    0   1   0   0   0    6    0   4   0    0   4 |  0   0    0   0   0   4    0   4   0  0  12   12    0   0    6   4   0   12    0   6 |  0  0   0   0   0   0   0   6    0   0    6   4  0   6  12   4   4   0   4  0  12    6   12   0  4 |  0  0   0   0  4   1   0   4   6  4   4   1  12   4   4  1 | 0  0  1  1   1  5   4
------------------------------------------+----------+---------------------------+--------------------------------------------------------+--------------------------------------------------------------------------------------+----------------------------------------------------------------------------------------------------+------------------------------------------------------------+----------------------
x....3o.... ..... ..... ..... .....     & |  3  0  0 |  3   0  0   0   0   0   0 | 70   *    *   *   *   *   *    *    *   *   *    *   *   4   4    0   0   0   0    0   0   0  0   0    0    0   0    0   0   0    0    0   0 |  6  4   6   0   0   0   0   0    0   0    0   0  0   0   0   0   0   0   0  0   0    0    0   0  0 |  4  6   4   0  0   0   0   0   0  0   0   0   0   0   0  0 | 1  1  0  4   0  0   0
xo... ..... ..... ..... ..... .....&#x  & |  2  1  0 |  1   2  0   0   0   0   0 |  * 420    *   *   *   *   *    *    *   *   *    *   *   0   2    6   0   0   0    0   0   0  0   0    0    0   0    0   0   0    0    0   0 |  0  1   6   3   6   0   0   0    0   0    0   0  0   0   0   0   0   0   0  0   0    0    0   0  0 |  0  3   6   2  0   3   0   0   0  0   0   0   0   0   0  0 | 0  2  0  3   0  1   0
..... ..... ..... ox... ..... .....&#x  & |  1  2  0 |  0   2  0   1   0   0   0 |  *   * 1260   *   *   *   *    *    *   *   *    *   *   0   0    2   2   2   0    2   0   0  0   0    0    0   0    0   0   0    0    0   0 |  0  0   1   2   4   1   1   0    4   2    1   0  0   0   0   0   0   0   0  0   0    0    0   0  0 |  0  1   2   2  0   4   2   2   1  0   0   0   0   0   0  0 | 0  1  0  2   1  2   0
..... ..... ..... ..... ..... o.x..&#x  & |  1  0  2 |  0   0  2   0   0   0   1 |  *   *    * 210   *   *   *    *    *   *   *    *   *   0   0    0   0   0   4    0   4   0  0   0    0    0   0    0   0   0    0    0   0 |  0  0   0   0   0   0   0   6    0   0    6   4  0   0   0   0   0   0   0  0   0    0    0   0  0 |  0  0   0   0  4   0   0   4   6  0   0   0   0   0   0  0 | 0  0  1  0   1  4   0
ooo..3ooo..3ooo..3ooo..3ooo..3ooo..&#x  & |  1  1  1 |  0   1  1   0   1   0   0 |  *   *    *   * 840   *   *    *    *   *   *    *   *   0   0    0   0   0   0    6   2   0  0   0    0    0   0    0   0   0    0    0   0 |  0  0   0   0   0   0   0   0    6   3    6   1  0   0   0   0   0   0   0  0   0    0    0   0  0 |  0  0   0   0  0   3   2   6   3  0   0   0   0   0   0  0 | 0  0  0  1   2  3   0
..... ..... .o...3.x... ..... .....     & |  0  3  0 |  0   0  0   3   0   0   0 |  *   *    *   *   * 420   *    *    *   *   *    *   *   0   0    0   2   0   0    0   0   2  0   0    0    4   0    0   0   0    0    0   0 |  0  0   0   1   0   2   0   0    4   0    0   0  1   0   0   2   0   4   2  0   0    0    0   0  0 |  0  1   0   0  0   2   4   2   0  2   0   2   0   1   0  0 | 0  0  0  2   2  2   0
..... ..... ..... .x...3.o... .....     & |  0  3  0 |  0   0  0   3   0   0   0 |  *   *    *   *   *   * 280    *    *   *   *    *   *   0   0    0   0   3   0    0   0   0  1   0    0    0   3    0   0   1    0    0   0 |  0  0   0   0   3   0   3   0    0   3    0   0  0   0   0   0   3   0   0  1   0    0    0   3  0 |  0  0   1   3  0   3   0   0   3  0   1   0   0   0   3  0 | 0  1  0  1   0  3   1
.ox.. ..... ..... ..... ..... .....&#x  & |  0  1  2 |  0   0  0   0   2   0   1 |  *   *    *   *   *   *   * 1260    *   *   *    *   *   0   0    0   0   0   0    0   0   0  0   2    4    0   0    0   0   0    2    0   0 |  0  0   0   0   0   0   0   0    0   0    0   0  0   1   4   2   2   0   0  0   2    1    4   0  0 |  0  0   0   0  0   1   0   0   1  2   2   0   4   2   2  0 | 0  0  0  1   0  3   2
..... ..... ..... .xo.. ..... .....&#x  & |  0  2  1 |  0   0  0   1   2   0   0 |  *   *    *   *   *   *   *    * 2520   *   *    *   *   0   0    0   0   0   0    1   0   0  0   0    2    2   1    1   0   0    0    1   0 |  0  0   0   0   0   0   0   0    2   1    1   0  0   0   1   2   2   1   2  0   0    1    2   1  0 |  0  0   0   0  0   2   1   2   1  1   1   1   1   2   2  0 | 0  0  0  1   1  3   1
..... ..... ..... ..... ..... .ox..&#x  & |  0  1  2 |  0   0  0   0   2   0   1 |  *   *    *   *   *   *   *    *    * 840   *    *   *   0   0    0   0   0   0    0   1   0  0   0    0    0   0    3   1   0    3    0   0 |  0  0   0   0   0   0   0   0    0   0    3   1  0   0   0   0   0   0   3  0   3    3    3   0  0 |  0  0   0   0  0   0   0   3   3  0   0   1   3   3   1  0 | 0  0  0  0   1  4   1
..... ..... .o.x. ..... ..... .....&#x  & |  0  3  0 |  0   0  0   1   0   2   0 |  *   *    *   *   *   *   *    *    *   * 420    *   *   0   0    0   0   0   0    0   0   0  0   0    0    0   0    0   0   2    0    6   0 |  0  0   0   0   0   0   0   0    0   0    0   0  0   0   0   0   0   0   0  1   0    3    6   3  0 |  0  0   0   0  0   0   0   0   3  0   0   0   2   3   6  0 | 0  0  0  0   0  4   2
.ooo.3.ooo.3.ooo.3.ooo.3.ooo.3.ooo.&#x  & |  0  2  1 |  0   0  0   0   2   1   0 |  *   *    *   *   *   *   *    *    *   *   * 1260   *   0   0    0   0   0   0    0   0   0  0   0    0    0   0    0   0   0    4    4   0 |  0  0   0   0   0   0   0   0    0   0    0   0  0   0   0   0   0   0   0  0   2    4    8   2  0 |  0  0   0   0  0   0   0   0   2  0   0   0   4   4   4  0 | 0  0  0  0   0  4   2
..x..3..o.. ..... ..... ..... .....     & |  0  0  3 |  0   0  0   0   0   0   3 |  *   *    *   *   *   *   *    *    *   *   *    * 280   0   0    0   0   0   1    0   0   0  0   3    0    0   0    0   1   0    0    0   3 |  0  0   0   0   0   0   0   3    0   0    0   1  0   3   3   0   0   0   0  0   3    0    0   0  3 |  0  0   0   0  3   0   0   0   3  3   1   0   3   0   0  1 | 0  0  1  1   0  3   1
------------------------------------------+----------+---------------------------+--------------------------------------------------------+--------------------------------------------------------------------------------------+----------------------------------------------------------------------------------------------------+------------------------------------------------------------+----------------------
x....3o....3o.... ..... ..... .....     &   4  0  0 |  6   0  0   0   0   0   0 |  4   0    0   0   0   0   0    0    0   0   0    0   0 | 70   *    *   *   *   *    *   *   *  *   *    *    *   *    *   *   *    *    *   * |  3  1   0   0   0   0   0   0    0   0    0   0  0   0   0   0   0   0   0  0   0    0    0   0  0 |  3  3   0   0  0   0   0   0   0  0   0   0   0   0   0  0 | 1  0  0  3   0  0   0
xo...3oo... ..... ..... ..... .....&#x  &   3  1  0 |  3   3  0   0   0   0   0 |  1   3    0   0   0   0   0    0    0   0   0    0   0 |  * 280    *   *   *   *    *   *   *  *   *    *    *   *    *   *   *    *    *   * |  0  1   3   0   0   0   0   0    0   0    0   0  0   0   0   0   0   0   0  0   0    0    0   0  0 |  0  3   3   0  0   0   0   0   0  0   0   0   0   0   0  0 | 0  1  0  3   0  0   0
xo... ..... ..... ox... ..... .....&#x  &   2  2  0 |  1   4  0   1   0   0   0 |  0   2    2   0   0   0   0    0    0   0   0    0   0 |  *   * 1260   *   *   *    *   *   *  *   *    *    *   *    *   *   *    *    *   * |  0  0   1   1   2   0   0   0    0   0    0   0  0   0   0   0   0   0   0  0   0    0    0   0  0 |  0  1   2   1  0   2   0   0   0  0   0   0   0   0   0  0 | 0  1  0  2   0  1   0
..... ..... oo...3ox... ..... .....&#x  &   1  3  0 |  0   3  0   3   0   0   0 |  0   0    3   0   0   1   0    0    0   0   0    0   0 |  *   *    * 840   *   *    *   *   *  *   *    *    *   *    *   *   *    *    *   * |  0  0   0   1   0   1   0   0    2   0    0   0  0   0   0   0   0   0   0  0   0    0    0   0  0 |  0  1   0   0  0   2   2   1   0  0   0   0   0   0   0  0 | 0  0  0  2   1  1   0
..... ..... ..... ox...3oo... .....&#x  &   1  3  0 |  0   3  0   3   0   0   0 |  0   0    3   0   0   0   1    0    0   0   0    0   0 |  *   *    *   * 840   *    *   *   *  *   *    *    *   *    *   *   *    *    *   * |  0  0   0   0   2   0   1   0    0   1    0   0  0   0   0   0   0   0   0  0   0    0    0   0  0 |  0  0   1   2  0   2   0   0   1  0   0   0   0   0   0  0 | 0  1  0  1   0  2   0
..... ..... ..... ..... o.o..3o.x..&#x  &   1  0  3 |  0   0  3   0   0   0   3 |  0   0    0   3   0   0   0    0    0   0   0    0   1 |  *   *    *   *   * 280    *   *   *  *   *    *    *   *    *   *   *    *    *   * |  0  0   0   0   0   0   0   3    0   0    0   1  0   0   0   0   0   0   0  0   0    0    0   0  0 |  0  0   0   0  3   0   0   0   3  0   0   0   0   0   0  0 | 0  0  1  0   0  3   0
..... ..... ..... oxo.. ..... .....&#x  &   1  2  1 |  0   2  1   1   2   0   0 |  0   0    1   0   2   0   0    0    1   0   0    0   0 |  *   *    *   *   *   * 2520   *   *  *   *    *    *   *    *   *   *    *    *   * |  0  0   0   0   0   0   0   0    2   1    1   0  0   0   0   0   0   0   0  0   0    0    0   0  0 |  0  0   0   0  0   2   1   2   1  0   0   0   0   0   0  0 | 0  0  0  1   1  2   0
..... ..... ..... ..... ..... oox..&#x  &   1  1  2 |  0   1  2   0   2   0   1 |  0   0    0   1   2   0   0    0    0   1   0    0   0 |  *   *    *   *   *   *    * 840   *  *   *    *    *   *    *   *   *    *    *   * |  0  0   0   0   0   0   0   0    0   0    3   1  0   0   0   0   0   0   0  0   0    0    0   0  0 |  0  0   0   0  0   0   0   3   3  0   0   0   0   0   0  0 | 0  0  0  0   1  3   0
..... .o...3.o...3.x... ..... .....     &   0  4  0 |  0   0  0   6   0   0   0 |  0   0    0   0   0   4   0    0    0   0   0    0   0 |  *   *    *   *   *   *    *   * 210  *   *    *    *   *    *   *   *    *    *   * |  0  0   0   0   0   1   0   0    0   0    0   0  1   0   0   0   0   2   0  0   0    0    0   0  0 |  0  1   0   0  0   0   2   0   0  2   0   1   0   0   0  0 | 0  0  0  2   1  1   0
..... ..... ..... .x...3.o...3.o...     &   0  4  0 |  0   0  0   6   0   0   0 |  0   0    0   0   0   0   4    0    0   0   0    0   0 |  *   *    *   *   *   *    *   *   * 70   *    *    *   *    *   *   *    *    *   * |  0  0   0   0   0   0   3   0    0   0    0   0  0   0   0   0   0   0   0  1   0    0    0   0  0 |  0  0   0   3  0   0   0   0   3  0   0   0   0   0   0  0 | 0  1  0  0   0  3   0
.ox..3.oo.. ..... ..... ..... .....&#x  &   0  1  3 |  0   0  0   0   3   0   3 |  0   0    0   0   0   0   0    3    0   0   0    0   1 |  *   *    *   *   *   *    *   *   *  * 840    *    *   *    *   *   *    *    *   * |  0  0   0   0   0   0   0   0    0   0    0   0  0   1   2   0   0   0   0  0   1    0    0   0  0 |  0  0   0   0  0   0   0   0   1  2   1   0   2   0   0  0 | 0  0  0  1   0  2   1
.ox.. ..... ..... .xo.. ..... .....&#x  &   0  2  2 |  0   0  0   1   4   0   1 |  0   0    0   0   0   0   0    2    2   0   0    0   0 |  *   *    *   *   *   *    *   *   *  *   * 2520    *   *    *   *   *    *    *   * |  0  0   0   0   0   0   0   0    0   0    0   0  0   0   1   1   1   0   0  0   0    0    1   0  0 |  0  0   0   0  0   1   0   0   0  1   1   0   1   1   1  0 | 0  0  0  1   0  2   1
..... ..... .oo..3.xo.. ..... .....&#x  &   0  3  1 |  0   0  0   3   3   0   0 |  0   0    0   0   0   1   0    0    3   0   0    0   0 |  *   *    *   *   *   *    *   *   *  *   *    * 1680   *    *   *   *    *    *   * |  0  0   0   0   0   0   0   0    1   0    0   0  0   0   0   1   0   1   1  0   0    0    0   0  0 |  0  0   0   0  0   1   1   1   0  1   0   1   0   1   0  0 | 0  0  0  1   1  2   0
..... ..... ..... .xo..3.oo.. .....&#x  &   0  3  1 |  0   0  0   3   3   0   0 |  0   0    0   0   0   0   1    0    3   0   0    0   0 |  *   *    *   *   *   *    *   *   *  *   *    *    * 840    *   *   *    *    *   * |  0  0   0   0   0   0   0   0    0   1    0   0  0   0   0   0   2   0   0  0   0    0    0   1  0 |  0  0   0   0  0   2   0   0   1  0   1   0   0   0   2  0 | 0  0  0  1   0  2   1
..... ..... ..... .xo.. ..... .ox..&#x  &   0  2  2 |  0   0  0   1   4   0   1 |  0   0    0   0   0   0   0    0    2   2   0    0   0 |  *   *    *   *   *   *    *   *   *  *   *    *    *   * 1260   *   *    *    *   * |  0  0   0   0   0   0   0   0    0   0    1   0  0   0   0   0   0   0   2  0   0    1    0   0  0 |  0  0   0   0  0   0   0   2   1  0   0   1   0   2   0  0 | 0  0  0  0   1  3   0
..... ..... ..... ..... .oo..3.ox..&#x  &   0  1  3 |  0   0  0   0   3   0   3 |  0   0    0   0   0   0   0    0    0   3   0    0   1 |  *   *    *   *   *   *    *   *   *  *   *    *    *   *    * 280   *    *    *   * |  0  0   0   0   0   0   0   0    0   0    0   1  0   0   0   0   0   0   0  0   3    0    0   0  0 |  0  0   0   0  0   0   0   0   3  0   0   0   3   0   0  0 | 0  0  0  0   0  3   1
..... .o.o.3.o.x. ..... ..... .....&#x  &   0  4  0 |  0   0  0   3   0   3   0 |  0   0    0   0   0   0   1    0    0   0   3    0   0 |  *   *    *   *   *   *    *   *   *  *   *    *    *   *    *   * 280    *    *   * |  0  0   0   0   0   0   0   0    0   0    0   0  0   0   0   0   0   0   0  1   0    0    0   3  0 |  0  0   0   0  0   0   0   0   3  0   0   0   0   0   3  0 | 0  0  0  0   0  3   1
.oxo. ..... ..... ..... ..... .....&#x  &   0  2  2 |  0   0  0   0   4   1   1 |  0   0    0   0   0   0   0    1    0   1   0    2   0 |  *   *    *   *   *   *    *   *   *  *   *    *    *   *    *   *   * 2520    *   * |  0  0   0   0   0   0   0   0    0   0    0   0  0   0   0   0   0   0   0  0   1    1    2   0  0 |  0  0   0   0  0   0   0   0   1  0   0   0   2   2   1  0 | 0  0  0  0   0  3   1
..... ..... .oox. ..... ..... .....&#x  &   0  3  1 |  0   0  0   1   3   2   0 |  0   0    0   0   0   0   0    0    1   0   1    2   0 |  *   *    *   *   *   *    *   *   *  *   *    *    *   *    *   *   *    * 2520   * |  0  0   0   0   0   0   0   0    0   0    0   0  0   0   0   0   0   0   0  0   0    1    2   1  0 |  0  0   0   0  0   0   0   0   1  0   0   0   1   2   2  0 | 0  0  0  0   0  3   1
..x..3..o..3..o.. ..... ..... .....     &   0  0  4 |  0   0  0   0   0   0   6 |  0   0    0   0   0   0   0    0    0   0   0    0   4 |  *   *    *   *   *   *    *   *   *  *   *    *    *   *    *   *   *    *    * 210 |  0  0   0   0   0   0   0   1    0   0    0   0  0   1   0   0   0   0   0  0   0    0    0   0  2 |  0  0   0   0  2   0   0   0   1  2   0   0   0   0   0  1 | 0  0  1  1   0  2   0
------------------------------------------+----------+---------------------------+--------------------------------------------------------+--------------------------------------------------------------------------------------+----------------------------------------------------------------------------------------------------+------------------------------------------------------------+----------------------
x....3o....3o....3o.... ..... .....     &   5  0  0 | 10   0  0   0   0   0   0 | 10   0    0   0   0   0   0    0    0   0   0    0   0 |  5   0    0   0   0   0    0   0   0  0   0    0    0   0    0   0   0    0    0   0 | 42  *   *   *   *   *   *   *    *   *    *   *  *   *   *   *   *   *   *  *   *    *    *   *  * |  2  1   0   0  0   0   0   0   0  0   0   0   0   0   0  0 | 1  0  0  2   0  0   0
xo...3oo...3oo... ..... ..... .....&#x  &   4  1  0 |  6   4  0   0   0   0   0 |  4   6    0   0   0   0   0    0    0   0   0    0   0 |  1   4    0   0   0   0    0   0   0  0   0    0    0   0    0   0   0    0    0   0 |  * 70   *   *   *   *   *   *    *   *    *   *  *   *   *   *   *   *   *  *   *    *    *   *  * |  0  3   0   0  0   0   0   0   0  0   0   0   0   0   0  0 | 0  0  0  3   0  0   0
xo...3oo... ..... ox... ..... .....&#x  &   3  2  0 |  3   6  0   1   0   0   0 |  1   6    3   0   0   0   0    0    0   0   0    0   0 |  0   2    3   0   0   0    0   0   0  0   0    0    0   0    0   0   0    0    0   0 |  *  * 420   *   *   *   *   *    *   *    *   *  *   *   *   *   *   *   *  *   *    *    *   *  * |  0  1   2   0  0   0   0   0   0  0   0   0   0   0   0  0 | 0  1  0  2   0  0   0
xo... ..... oo...3ox... ..... .....&#x  &   2  3  0 |  1   6  0   3   0   0   0 |  0   3    6   0   0   1   0    0    0   0   0    0   0 |  0   0    3   2   0   0    0   0   0  0   0    0    0   0    0   0   0    0    0   0 |  *  *   * 420   *   *   *   *    *   *    *   *  *   *   *   *   *   *   *  *   *    *    *   *  * |  0  1   0   0  0   2   0   0   0  0   0   0   0   0   0  0 | 0  0  0  2   0  1   0
xo... ..... ..... ox...3oo... .....&#x  &   2  3  0 |  1   6  0   3   0   0   0 |  0   3    6   0   0   0   1    0    0   0   0    0   0 |  0   0    3   0   2   0    0   0   0  0   0    0    0   0    0   0   0    0    0   0 |  *  *   *   * 840   *   *   *    *   *    *   *  *   *   *   *   *   *   *  *   *    *    *   *  * |  0  0   1   1  0   1   0   0   0  0   0   0   0   0   0  0 | 0  1  0  1   0  1   0
..... oo...3oo...3ox... ..... .....&#x  &   1  4  0 |  0   4  0   6   0   0   0 |  0   0    6   0   0   4   0    0    0   0   0    0   0 |  0   0    0   4   0   0    0   0   1  0   0    0    0   0    0   0   0    0    0   0 |  *  *   *   *   * 210   *   *    *   *    *   *  *   *   *   *   *   *   *  *   *    *    *   *  * |  0  1   0   0  0   0   1   0   0  0   0   0   0   0   0  0 | 0  0  0  2   1  0   0
..... ..... ..... ox...3oo...3oo...&#x  &   1  4  0 |  0   4  0   6   0   0   0 |  0   0    6   0   0   0   4    0    0   0   0    0   0 |  0   0    0   0   4   0    0   0   0  1   0    0    0   0    0   0   0    0    0   0 |  *  *   *   *   *   * 210   *    *   *    *   *  *   *   *   *   *   *   *  *   *    *    *   *  * |  0  0   0   2  0   0   0   0   1  0   0   0   0   0   0  0 | 0  1  0  0   0  2   0
..... ..... ..... o.o..3o.o..3o.x..&#x  &   1  0  4 |  0   0  4   0   0   0   6 |  0   0    0   6   0   0   0    0    0   0   0    0   4 |  0   0    0   0   0   4    0   0   0  0   0    0    0   0    0   0   0    0    0   1 |  *  *   *   *   *   *   * 210    *   *    *   *  *   *   *   *   *   *   *  *   *    *    *   *  * |  0  0   0   0  2   0   0   0   1  0   0   0   0   0   0  0 | 0  0  1  0   0  2   0
..... ..... ooo..3oxo.. ..... .....&#x  &   1  3  1 |  0   3  1   3   3   0   0 |  0   0    3   0   3   1   0    0    3   0   0    0   0 |  0   0    0   1   0   0    3   0   0  0   0    0    1   0    0   0   0    0    0   0 |  *  *   *   *   *   *   *   * 1680   *    *   *  *   *   *   *   *   *   *  *   *    *    *   *  * |  0  0   0   0  0   1   1   1   0  0   0   0   0   0   0  0 | 0  0  0  1   1  1   0
..... ..... ..... oxo..3ooo.. .....&#x  &   1  3  1 |  0   3  1   3   3   0   0 |  0   0    3   0   3   0   1    0    3   0   0    0   0 |  0   0    0   0   1   0    3   0   0  0   0    0    0   1    0   0   0    0    0   0 |  *  *   *   *   *   *   *   *    * 840    *   *  *   *   *   *   *   *   *  *   *    *    *   *  * |  0  0   0   0  0   2   0   0   1  0   0   0   0   0   0  0 | 0  0  0  1   0  2   0
..... ..... ..... oxo.. ..... oox..&#x  &   1  2  2 |  0   2  2   1   4   0   1 |  0   0    1   1   4   0   0    0    2   2   0    0   0 |  0   0    0   0   0   0    2   2   0  0   0    0    0   0    1   0   0    0    0   0 |  *  *   *   *   *   *   *   *    *   * 1260   *  *   *   *   *   *   *   *  *   *    *    *   *  * |  0  0   0   0  0   0   0   2   1  0   0   0   0   0   0  0 | 0  0  0  0   1  2   0
..... ..... ..... ..... ooo..3oox..&#x  &   1  1  3 |  0   1  3   0   3   0   3 |  0   0    0   3   3   0   0    0    0   3   0    0   1 |  0   0    0   0   0   1    0   3   0  0   0    0    0   0    0   1   0    0    0   0 |  *  *   *   *   *   *   *   *    *   *    * 280  *   *   *   *   *   *   *  *   *    *    *   *  * |  0  0   0   0  0   0   0   0   3  0   0   0   0   0   0  0 | 0  0  0  0   0  3   0
.o...3.o...3.o...3.x... ..... .....     &   0  5  0 |  0   0  0  10   0   0   0 |  0   0    0   0   0  10   0    0    0   0   0    0   0 |  0   0    0   0   0   0    0   0   5  0   0    0    0   0    0   0   0    0    0   0 |  *  *   *   *   *   *   *   *    *   *    *   * 42   *   *   *   *   *   *  *   *    *    *   *  * |  0  1   0   0  0   0   0   0   0  2   0   0   0   0   0  0 | 0  0  0  2   0  1   0
.ox..3.oo..3.oo.. ..... ..... .....&#x  &   0  1  4 |  0   0  0   0   4   0   6 |  0   0    0   0   0   0   0    6    0   0   0    0   4 |  0   0    0   0   0   0    0   0   0  0   4    0    0   0    0   0   0    0    0   1 |  *  *   *   *   *   *   *   *    *   *    *   *  * 210   *   *   *   *   *  *   *    *    *   *  * |  0  0   0   0  0   0   0   0   1  2   0   0   0   0   0  0 | 0  0  0  1   0  2   0
.ox..3.oo.. ..... .xo.. ..... .....&#x  &   0  2  3 |  0   0  0   1   6   0   3 |  0   0    0   0   0   0   0    6    3   0   0    0   1 |  0   0    0   0   0   0    0   0   0  0   2    3    0   0    0   0   0    0    0   0 |  *  *   *   *   *   *   *   *    *   *    *   *  *   * 840   *   *   *   *  *   *    *    *   *  * |  0  0   0   0  0   0   0   0   0  1   1   0   1   0   0  0 | 0  0  0  1   0  1   1
.ox.. ..... .oo..3.xo.. ..... .....&#x  &   0  3  2 |  0   0  0   3   6   0   1 |  0   0    0   0   0   1   0    3    6   0   0    0   0 |  0   0    0   0   0   0    0   0   0  0   0    3    2   0    0   0   0    0    0   0 |  *  *   *   *   *   *   *   *    *   *    *   *  *   *   * 840   *   *   *  *   *    *    *   *  * |  0  0   0   0  0   1   0   0   0  1   0   0   0   1   0  0 | 0  0  0  1   0  2   0
.ox.. ..... ..... .xo..3.oo.. .....&#x  &   0  3  2 |  0   0  0   3   6   0   1 |  0   0    0   0   0   0   1    3    6   0   0    0   0 |  0   0    0   0   0   0    0   0   0  0   0    3    0   2    0   0   0    0    0   0 |  *  *   *   *   *   *   *   *    *   *    *   *  *   *   *   * 840   *   *  *   *    *    *   *  * |  0  0   0   0  0   1   0   0   0  0   1   0   0   0   1  0 | 0  0  0  1   0  1   1
..... .oo..3.oo..3.xo.. ..... .....&#x  &   0  4  1 |  0   0  0   6   4   0   0 |  0   0    0   0   0   4   0    0    6   0   0    0   0 |  0   0    0   0   0   0    0   0   1  0   0    0    4   0    0   0   0    0    0   0 |  *  *   *   *   *   *   *   *    *   *    *   *  *   *   *   *   * 420   *  *   *    *    *   *  * |  0  0   0   0  0   0   1   0   0  1   0   1   0   0   0  0 | 0  0  0  1   1  1   0
..... ..... .oo..3.xo.. ..... .ox..&#x  &   0  3  2 |  0   0  0   3   6   0   1 |  0   0    0   0   0   1   0    0    6   3   0    0   0 |  0   0    0   0   0   0    0   0   0  0   0    0    2   0    3   0   0    0    0   0 |  *  *   *   *   *   *   *   *    *   *    *   *  *   *   *   *   *   * 840  *   *    *    *   *  * |  0  0   0   0  0   0   0   1   0  0   0   1   0   1   0  0 | 0  0  0  0   1  2   0
..... ..... ..... .x.o.3.o.o.3.o.o.&#x  &   0  5  0 |  0   0  0   6   0   4   0 |  0   0    0   0   0   0   4    0    0   0   6    0   0 |  0   0    0   0   0   0    0   0   0  1   0    0    0   0    0   0   4    0    0   0 |  *  *   *   *   *   *   *   *    *   *    *   *  *   *   *   *   *   *   * 70   *    *    *   *  * |  0  0   0   0  0   0   0   0   3  0   0   0   0   0   0  0 | 0  0  0  0   0  3   0
.oxo.3.ooo. ..... ..... ..... .....&#x  &   0  2  3 |  0   0  0   0   6   1   3 |  0   0    0   0   0   0   0    3    0   3   0    3   1 |  0   0    0   0   0   0    0   0   0  0   1    0    0   0    0   1   0    3    0   0 |  *  *   *   *   *   *   *   *    *   *    *   *  *   *   *   *   *   *   *  * 840    *    *   *  * |  0  0   0   0  0   0   0   0   1  0   0   0   2   0   0  0 | 0  0  0  0   0  2   1
.oxo. ..... .oox. ..... ..... .....&#x  &   0  3  2 |  0   0  0   1   6   2   1 |  0   0    0   0   0   0   0    1    2   2   1    4   0 |  0   0    0   0   0   0    0   0   0  0   0    0    0   0    1   0   0    2    2   0 |  *  *   *   *   *   *   *   *    *   *    *   *  *   *   *   *   *   *   *  *   * 1260    *   *  * |  0  0   0   0  0   0   0   0   1  0   0   0   0   2   0  0 | 0  0  0  0   0  3   0
.oxo. ..... ..... .xoo. ..... .....&#x  &   0  3  2 |  0   0  0   1   6   2   1 |  0   0    0   0   0   0   0    2    2   1   1    4   0 |  0   0    0   0   0   0    0   0   0  0   0    1    0   0    0   0   0    2    2   0 |  *  *   *   *   *   *   *   *    *   *    *   *  *   *   *   *   *   *   *  *   *    * 2520   *  * |  0  0   0   0  0   0   0   0   0  0   0   0   1   1   1  0 | 0  0  0  0   0  2   1
..... .ooo.3.oox. ..... ..... .....&#x  &   0  4  1 |  0   0  0   3   4   3   0 |  0   0    0   0   0   0   1    0    3   0   3    3   0 |  0   0    0   0   0   0    0   0   0  0   0    0    0   1    0   0   1    0    3   0 |  *  *   *   *   *   *   *   *    *   *    *   *  *   *   *   *   *   *   *  *   *    *    * 840  * |  0  0   0   0  0   0   0   0   1  0   0   0   0   0   2  0 | 0  0  0  0   0  2   1
..x..3..o..3..o..3..o.. ..... .....     &   0  0  5 |  0   0  0   0   0   0  10 |  0   0    0   0   0   0   0    0    0   0   0    0  10 |  0   0    0   0   0   0    0   0   0  0   0    0    0   0    0   0   0    0    0   5 |  *  *   *   *   *   *   *   *    *   *    *   *  *   *   *   *   *   *   *  *   *    *    *   * 84 |  0  0   0   0  1   0   0   0   0  1   0   0   0   0   0  1 | 0  0  1  1   0  1   0
------------------------------------------+----------+---------------------------+--------------------------------------------------------+--------------------------------------------------------------------------------------+----------------------------------------------------------------------------------------------------+------------------------------------------------------------+----------------------
x....3o....3o....3o....3o.... .....     &   6  0  0 | 15   0  0   0   0   0   0 | 20   0    0   0   0   0   0    0    0   0   0    0   0 | 15   0    0   0   0   0    0   0   0  0   0    0    0   0    0   0   0    0    0   0 |  6  0   0   0   0   0   0   0    0   0    0   0  0   0   0   0   0   0   0  0   0    0    0   0  0 | 14  *   *   *  *   *   *   *   *  *   *   *   *   *   *  * | 1  0  0  1   0  0   0
xo...3oo...3oo...3ox... ..... .....&#x  &   5  5  0 | 10  20  0  10   0   0   0 | 10  30   30   0   0  10   0    0    0   0   0    0   0 |  5  20   30  20   0   0    0   0   5  0   0    0    0   0    0   0   0    0    0   0 |  1  5  10  10   0   5   0   0    0   0    0   0  1   0   0   0   0   0   0  0   0    0    0   0  0 |  * 42   *   *  *   *   *   *   *  *   *   *   *   *   *  * | 0  0  0  2   0  0   0
xo...3oo... ..... ox...3oo... .....&#x  &   3  3  0 |  3   9  0   3   0   0   0 |  1   9    9   0   0   0   1    0    0   0   0    0   0 |  0   3    9   0   3   0    0   0   0  0   0    0    0   0    0   0   0    0    0   0 |  0  0   3   0   3   0   0   0    0   0    0   0  0   0   0   0   0   0   0  0   0    0    0   0  0 |  *  * 280   *  *   *   *   *   *  *   *   *   *   *   *  * | 0  1  0  1   0  0   0
xo... ..... ..... ox...3oo...3oo...&#x  &   2  4  0 |  1   8  0   6   0   0   0 |  0   4   12   0   0   0   4    0    0   0   0    0   0 |  0   0    6   0   8   0    0   0   0  1   0    0    0   0    0   0   0    0    0   0 |  0  0   0   0   4   0   2   0    0   0    0   0  0   0   0   0   0   0   0  0   0    0    0   0  0 |  *  *   * 210  *   *   *   *   *  *   *   *   *   *   *  * | 0  1  0  0   0  1   0
..... ..... o.o..3o.o..3o.o..3o.x..&#x  &   1  0  5 |  0   0  5   0   0   0  10 |  0   0    0  10   0   0   0    0    0   0   0    0  10 |  0   0    0   0   0  10    0   0   0  0   0    0    0   0    0   0   0    0    0   5 |  0  0   0   0   0   0   0   5    0   0    0   0  0   0   0   0   0   0   0  0   0    0    0   0  1 |  *  *   *   * 84   *   *   *   *  *   *   *   *   *   *  * | 0  0  1  0   0  1   0
xox.. ..... ooo..3oxo..3ooo.. .....&#xt &   2  6  2 |  1  12  2  12  12   0   1 |  0   6   24   0  12   4   4    6   24   0   0    0   0 |  0   0   12   8   8   0   24   0   0  0   0   12    8   8    0   0   0    0    0   0 |  0  0   0   4   4   0   0   0    8   8    0   0  0   0   0   4   4   0   0  0   0    0    0   0  0 |  *  *   *   *  * 210   *   *   *  *   *   *   *   *   *  * | 0  0  0  1   0  1   0
..... ooo..3ooo..3oxo.. ..... .....&#x  &   1  4  1 |  0   4  1   6   4   0   0 |  0   0    6   0   4   4   0    0    6   0   0    0   0 |  0   0    0   4   0   0    6   0   1  0   0    0    4   0    0   0   0    0    0   0 |  0  0   0   0   0   1   0   0    4   0    0   0  0   0   0   0   0   1   0  0   0    0    0   0  0 |  *  *   *   *  *   * 420   *   *  *   *   *   *   *   *  * | 0  0  0  1   1  0   0
..... ..... ooo..3oxo.. ..... oox..&#x  &   1  3  2 |  0   3  2   3   6   0   1 |  0   0    3   1   6   1   0    0    6   3   0    0   0 |  0   0    0   1   0   0    6   3   0  0   0    0    2   0    3   0   0    0    0   0 |  0  0   0   0   0   0   0   0    2   0    3   0  0   0   0   0   0   0   1  0   0    0    0   0  0 |  *  *   *   *  *   *   * 840   *  *   *   *   *   *   *  * | 0  0  0  0   1  1   0
..... ..... ..... oxoo.3oooo.3ooox.&#xr &   1  5  4 |  0   4  4   6  16   4   6 |  0   0    6   6  12   0   4    6   12  12   6   12   4 |  0   0    0   0   4   4   12  12   0  1   4    0    0   4    6   4   4   12   12   1 |  0  0   0   0   0   0   1   1    0   4    6   4  0   1   0   0   0   0   0  1   4    6    0   4  0 |  *  *   *   *  *   *   *   * 210  *   *   *   *   *   *  * | 0  0  0  0   0  2   0
.ox..3.oo..3.oo..3.xo.. ..... .....&#x  &   0  5  5 |  0   0  0  10  20   0  10 |  0   0    0   0   0  10   0   30   30   0   0    0  10 |  0   0    0   0   0   0    0   0   5  0  20   30   20   0    0   0   0    0    0   5 |  0  0   0   0   0   0   0   0    0   0    0   0  1   5  10  10   0   5   0  0   0    0    0   0  1 |  *  *   *   *  *   *   *   *   * 84   *   *   *   *   *  * | 0  0  0  1   0  1   0
.ox..3.oo.. ..... .xo..3.oo.. .....&#x  &   0  3  3 |  0   0  0   3   9   0   3 |  0   0    0   0   0   0   1    9    9   0   0    0   1 |  0   0    0   0   0   0    0   0   0  0   3    9    0   3    0   0   0    0    0   0 |  0  0   0   0   0   0   0   0    0   0    0   0  0   0   3   0   3   0   0  0   0    0    0   0  0 |  *  *   *   *  *   *   *   *   *  * 280   *   *   *   *  * | 0  0  0  1   0  0   1
..... .oo..3.oo..3.xo.. ..... .ox..&#x  &   0  4  2 |  0   0  0   6   8   0   1 |  0   0    0   0   0   4   0    0   12   4   0    0   0 |  0   0    0   0   0   0    0   0   1  0   0    0    8   0    6   0   0    0    0   0 |  0  0   0   0   0   0   0   0    0   0    0   0  0   0   0   0   0   2   4  0   0    0    0   0  0 |  *  *   *   *  *   *   *   *   *  *   * 210   *   *   *  * | 0  0  0  0   1  1   0
.oxo.3.ooo. ..... .xoo. ..... .....&#x  &   0  3  3 |  0   0  0   1   9   2   3 |  0   0    0   0   0   0   0    6    3   3   1    6   1 |  0   0    0   0   0   0    0   0   0  0   2    3    0   0    0   1   0    6    3   0 |  0  0   0   0   0   0   0   0    0   0    0   0  0   0   1   0   0   0   0  0   2    0    3   0  0 |  *  *   *   *  *   *   *   *   *  *   *   * 840   *   *  * | 0  0  0  0   0  1   1
.oxo. ..... .oox.3.xoo. ..... .oxo.&#xt     0  6  4 |  0   0  0   6  24   6   4 |  0   0    0   0   0   2   0   12   24  12   6   24   0 |  0   0    0   0   0   0    0   0   0  0   0   12    8   0   12   0   0   24   24   0 |  0  0   0   0   0   0   0   0    0   0    0   0  0   0   0   4   0   0   4  0   0   12   12   0  0 |  *  *   *   *  *   *   *   *   *  *   *   *   * 210   *  * | 0  0  0  0   0  2   0
.oxo. ..... ..... .xoo.3.ooo. .....&#x  &   0  4  2 |  0   0  0   3   8   3   1 |  0   0    0   0   0   0   1    3    6   1   3    6   0 |  0   0    0   0   0   0    0   0   0  0   0    3    0   2    0   0   1    3    6   0 |  0  0   0   0   0   0   0   0    0   0    0   0  0   0   0   0   1   0   0  0   0    0    3   2  0 |  *  *   *   *  *   *   *   *   *  *   *   *   *   * 840  * | 0  0  0  0   0  1   1
..x..3..o..3..o..3..o..3..o.. .....     &   0  0  6 |  0   0  0   0   0   0  15 |  0   0    0   0   0   0   0    0    0   0   0    0  20 |  0   0    0   0   0   0    0   0   0  0   0    0    0   0    0   0   0    0    0  15 |  0  0   0   0   0   0   0   0    0   0    0   0  0   0   0   0   0   0   0  0   0    0    0   0  6 |  *  *   *   *  *   *   *   *   *  *   *   *   *   *   * 14 | 0  0  1  1   0  0   0
------------------------------------------+----------+---------------------------+--------------------------------------------------------+--------------------------------------------------------------------------------------+----------------------------------------------------------------------------------------------------+------------------------------------------------------------+----------------------
x....3o....3o....3o....3o....3o....     &   7  0  0 | 21   0  0   0   0   0   0 | 35   0    0   0   0   0   0    0    0   0   0    0   0 | 35   0    0   0   0   0    0   0   0  0   0    0    0   0    0   0   0    0    0   0 | 21  0   0   0   0   0   0   0    0   0    0   0  0   0   0   0   0   0   0  0   0    0    0   0  0 |  7  0   0   0  0   0   0   0   0  0   0   0   0   0   0  0 | 2  *  *  *   *  *   *
xo...3oo... ..... ox...3oo...3oo...&#x  &   3  4  0 |  3  12  0   6   0   0   0 |  1  12   18   0   0   0   4    0    0   0   0    0   0 |  0   4   18   0  12   0    0   0   0  1   0    0    0   0    0   0   0    0    0   0 |  0  0   6   0  12   0   3   0    0   0    0   0  0   0   0   0   0   0   0  0   0    0    0   0  0 |  0  0   4   3  0   0   0   0   0  0   0   0   0   0   0  0 | * 70  *  *   *  *   *
..... o.o..3o.o..3o.o..3o.o..3o.x..&#x  &   1  0  6 |  0   0  6   0   0   0  15 |  0   0    0  15   0   0   0    0    0   0   0    0  20 |  0   0    0   0   0  20    0   0   0  0   0    0    0   0    0   0   0    0    0  15 |  0  0   0   0   0   0   0  15    0   0    0   0  0   0   0   0   0   0   0  0   0    0    0   0  6 |  0  0   0   0  6   0   0   0   0  0   0   0   0   0   0  1 | *  * 14  *   *  *   *
xox..3ooo..3ooo..3oxo..3ooo.. .....&#xt &   6 15  6 | 15  60  6  60  60   0  15 | 20  90  180   0  60  60  20   90  180   0   0    0  20 | 15  60  180 120  60   0  180   0  30  0  60  180  120  60    0   0   0    0    0  15 |  6 15  60  60  60  30   0   0  120  60    0   0  6  15  60  60  60  30   0  0   0    0    0   0  6 |  1  6  20   0  0  15  30   0   0  6  20   0   0   0   0  1 | *  *  * 14   *  *   *
..... ooo..3ooo..3oxo.. ..... oox..&#x  &   1  4  2 |  0   4  2   6   8   0   1 |  0   0    6   1   8   4   0    0   12   4   0    0   0 |  0   0    0   4   0   0   12   4   1  0   0    0    8   0    6   0   0    0    0   0 |  0  0   0   0   0   1   0   0    8   0    6   0  0   0   0   0   0   2   4  0   0    0    0   0  0 |  0  0   0   0  0   0   2   4   0  0   0   1   0   0   0  0 | *  *  *  * 210  *   *
xoxo. ..... ooox.3oxoo.3oooo.3ooxo.&#xt &   2 15 10 |  1  20 10  40 100  20  25 |  0  10   60  20  60  20  20   90  180  80  40  120  20 |  0   0   30  20  40  20  120  60   5  5  40  120   80  40   90  20  20  180  180  10 |  0  0   0  10  20   0  10  10   40  40   60  20  1  10  20  40  20  10  40  5  40   90  120  40  2 |  0  0   0   5  2   5   0  20  10  2   0   5  20  10  20  0 | *  *  *  *   * 42   *
.oxo.3.ooo. ..... .xoo.3.ooo. .....&#x  &   0  4  3 |  0   0  0   3  12   3   3 |  0   0    0   0   0   0   1    9    9   3   3    9   1 |  0   0    0   0   0   0    0   0   0  0   3    9    0   3    0   1   1    9    9   0 |  0  0   0   0   0   0   0   0    0   0    0   0  0   0   3   0   3   0   0  0   3    0    9   3  0 |  0  0   0   0  0   0   0   0   0  0   1   0   3   0   3  0 | *  *  *  *   *  * 280

xoo3ooo3ooo3ooo3oox *c3oxo&#xt   → both heights = 1/sqrt(3) = 0.577350
(jak || pseudo mo || alt. jak)

o..3o..3o..3o..3o.. *c3o..     & | 54  *   16  16   0 |   80   80   80    0 |  160  160  160  160    0 |  80  40  160   80  160   40   80   0 |  16 10  80  40   80  10  16 | 1  16 11  16
.o.3.o.3.o.3.o.3.o. *c3.o.       |  * 72    0  12  20 |    0   30  120   90 |    0   40  120  360  120 |   0   0   30   40  180  120  240  30 |   0  0  12  30  240  30  60 | 0   2 12  30
---------------------------------+-------+-------------+---------------------+--------------------------+--------------------------------------+-----------------------------+-------------
x.. ... ... ... ...    ...     & |  2  0 | 432   *   *    10    5    0    0 |   30   20   10    0    0 |  20  10   30   10   10    0    0   0 |   5  5  20  10    5   0   0 | 1   5  5   1
oo.3oo.3oo.3oo.3oo. *c3oo.&#x  & |  1  1 |   * 864   *     0    5   10    0 |    0   10   20   30    0 |   0   0   10   10   30   10   20   0 |   0  0   5  10   20   5   5 | 0   1  6   5
... ... ... ... ...    .x.       |  0  2 |   *   * 720     0    0    6    9 |    0    0    6   36   18 |   0   0    0    2   18   18   36   6 |   0  0   0   6   18   9  12 | 0   0  6   6
---------------------------------+-------+-------------+---------------------+--------------------------+--------------------------------------+-----------------------------+-------------
x..3o.. ... ... ...    ...     & |  3  0 |   3   0   0 | 1440    *    *    *     6    2    0    0    0 |   6   3    6    1    0    0    0   0 |   2  3   6   3    0   0   0 | 1   2  3   0
xo. ... ... ... ...    ...&#x  & |  2  1 |   1   2   0 |    * 2160    *    *     0    4    4    0    0 |   0   0    6    4    6    0    0   0 |   0  0   4   6    4   0   0 | 0   1  4   1
... ... ... ... ...    ox.&#x  & |  1  2 |   0   2   1 |    *    * 4320    *     0    0    2    6    0 |   0   0    0    1    6    3    6   0 |   0  0   0   3    6   3   2 | 0   0  4   2
... ... .o. ... ... *c3.x.       |  0  3 |   0   0   3 |    *    *    * 2160     0    0    0    4    4 |   0   0    0    0    2    4    8   2 |   0  0   0   2    4   4   4 | 0   0  4   2
---------------------------------+-------+-------------+---------------------+--------------------------+--------------------------------------+-----------------------------+-------------
x..3o..3o.. ... ...    ...     &   4  0 |   6   0   0 |    4    0    0    0 | 2160    *    *    *    * |   2   1    1    0    0    0    0   0 |   1  2   2   1    0   0   0 | 1   1  2   0 tet
xo.3oo. ... ... ...    ...&#x  &   3  1 |   3   3   0 |    1    3    0    0 |    * 2880    *    *    * |   0   0    3    1    0    0    0   0 |   0  0   3   3    0   0   0 | 0   1  3   0 tet
xo. ... ... ... ...    ox.&#x  &   2  2 |   1   4   1 |    0    2    2    0 |    *    * 4320    *    * |   0   0    0    1    3    0    0   0 |   0  0   0   3    3   0   0 | 0   0  3   1 tet
... ... oo. ... ... *c3ox.&#x  &   1  3 |   0   3   3 |    0    0    3    1 |    *    *    * 8640    * |   0   0    0    0    1    1    2   0 |   0  0   0   1    2   2   1 | 0   0  3   1 tet
... .o.3.o. ... ... *c3.x.     &   0  4 |   0   0   6 |    0    0    0    4 |    *    *    *    * 2160 |   0   0    0    0    0    1    2   1 |   0  0   0   1    1   2   2 | 0   0  3   1 tet
---------------------------------+-------+-------------+---------------------+--------------------------+--------------------------------------+-----------------------------+-------------
x..3o..3o..3o.. ...    ...     &   5  0 |  10   0   0 |   10    0    0    0 |    5    0    0    0    0 | 864   *    *    *    *    *    *   * |   1  1   1   0    0   0   0 | 1   1  1   0 pen
x..3o..3o.. ... ... *c3o..     &   5  0 |  10   0   0 |   10    0    0    0 |    5    0    0    0    0 |   * 432    *    *    *    *    *   * |   0  2   0   1    0   0   0 | 1   0  2   0 pen
xo.3oo.3oo. ... ...    ...&#x  &   4  1 |   6   4   0 |    4    6    0    0 |    1    4    0    0    0 |   *   * 2160    *    *    *    *   * |   0  0   2   1    0   0   0 | 0   1  2   0 pen
xo.3oo. ... ... ...    ox.&#x  &   3  2 |   3   6   1 |    1    6    3    0 |    0    2    3    0    0 |   *   *    * 1440    *    *    *   * |   0  0   0   3    0   0   0 | 0   0  3   0 pen
xo. ... oo. ... ... *c3ox.&#x  &   2  3 |   1   6   3 |    0    3    6    1 |    0    0    3    2    0 |   *   *    *    * 4320    *    *   * |   0  0   0   1    2   0   0 | 0   0  2   1 pen
... oo.3oo. ... ... *c3ox.&#x  &   1  4 |   0   4   6 |    0    0    6    4 |    0    0    0    4    1 |   *   *    *    *    * 2160    *   * |   0  0   0   1    0   2   0 | 0   0  3   0 pen
... ... oo.3oo. ... *c3ox.&#x  &   1  4 |   0   4   6 |    0    0    6    4 |    0    0    0    4    1 |   *   *    *    *    *    * 4320   * |   0  0   0   0    1   1   1 | 0   0  2   1 pen
.o.3.o.3.o. ... ... *c3.x.     &   0  5 |   0   0  10 |    0    0    0   10 |    0    0    0    0    5 |   *   *    *    *    *    *    * 432 |   0  0   0   1    0   0   2 | 0   0  2   1 pen
---------------------------------+-------+-------------+---------------------+--------------------------+--------------------------------------+-----------------------------+-------------
x..3o..3o..3o..3o..    ...     &   6  0 |  15   0   0 |   20    0    0    0 |   15    0    0    0    0 |   6   0    0    0    0    0    0   0 | 144  *   *   *    *   *   * | 1   1  0   0 hix
x..3o..3o..3o.. ... *c3o..     &  10  0 |  40   0   0 |   80    0    0    0 |   80    0    0    0    0 |  16  16    0    0    0    0    0   0 |   * 54   *   *    *   *   * | 1   0  1   0 tac
xo.3oo.3oo.3oo. ...    ...&#x  &   5  1 |  10   5   0 |   10   10    0    0 |    5   10    0    0    0 |   1   0    5    0    0    0    0   0 |   *  * 864   *    *   *   * | 0   1  1   0 hix
xo.3oo.3oo. ... ... *c3ox.&#x  &   5  5 |  10  20  10 |   10   30   30   10 |    5   20   30   20    5 |   0   1    5   10   10    5    0   1 |   *  *   * 432    *   *   * | 0   0  2   0 tac
xo. ... oo.3oo. ... *c3ox.&#x  &   2  4 |   1   8   6 |    0    4   12    4 |    0    0    6    8    1 |   0   0    0    0    4    0    2   0 |   *  *   *   * 2160   *   * | 0   0  1   1 hix
... ooo3ooo3ooo ... *c3oxo&#xt     2  8 |   0  16  24 |    0    0   48   32 |    0    0    0   64   16 |   0   0    0    0    0   16   16   0 |   *  *   *   *    * 270   * | 0   0  2   0 tac
... ... oo.3oo.3oo. *c3ox.&#x  &   1  5 |   0   5  10 |    0    0   10   10 |    0    0    0   10    5 |   0   0    0    0    0    0    5   1 |   *  *   *   *    *   * 864 | 0   0  1   1 hix
---------------------------------+-------+-------------+---------------------+--------------------------+--------------------------------------+-----------------------------+-------------
x..3o..3o..3o..3o.. *c3o..     &  27  0 | 216   0   0 |  720    0    0    0 | 1080    0    0    0    0 | 432 216    0    0    0    0    0   0 |  72 27   0   0    0   0   0 | 2   *  *   * jak
xo.3oo.3oo.3oo.3oo.    ...&#x  &   6  1 |  15   6   0 |   20   15    0    0 |   15   20    0    0    0 |   6   0   15    0    0    0    0   0 |   1  0   6   0    0   0   0 | * 144  *   * hop
xoo3ooo3ooo3ooo ... *c3oxo&#xt &  11 16 |  40  96  80 |   80  160  320  160 |   80  160  240  480  120 |  16  16   80   80  160  120  160  16 |   0  1  16  16   40  10  16 | *   * 54   * jak
xo. ... oo.3oo.3oo. *c3ox.&#x  &   2  5 |   1  10  10 |    0    5   20   10 |    0    0   10   20    5 |   0   0    0    0   10    0   10   1 |   0  0   0   0    5   0   2 | *   *  * 432 hop

xo3oo3oo3ox3oo3oo3xo&#zx   → height = 0
(tegum sum of suph and he)

o.3o.3o.3o.3o.3o.3o.       | 56  *   12   20   0 |  30  120   90    0 |  40  120   360  120   0 |  30  40  180  120  240   30   0 |  12  30  120  30   60 |  2 12  30
.o3.o3.o3.o3.o3.o3.o       |  * 70    0   16  16 |   0   48  144   48 |   0   32   288  288  32 |   0   8   96  144  288   96   8 |   0  24   96  36   96 |  0 12  32
---------------------------+-------+--------------+--------------------+-------------------------+---------------------------------+-----------------------+----------
x. .. .. .. .. .. ..     & |  2  0 | 336    *   *    5   10    0    0 |  10   20    30    0   0 |  10  10   30   10   20    0   0 |   5  10   20   5    5 |  1  6   5
oo3oo3oo3oo3oo3oo3oo&#x    |  1  1 |   * 1120   *    0    6    9    0 |   0    6    36   18   0 |   0   2   18   18   36    6   0 |   0   6   18   9   12 |  0  6   6
.. .. .. .x .. .. ..       |  0  2 |   *    * 560    0    0    9    6 |   0    0    18   36   6 |   0   0    6   18   36   18   2 |   0   6   12   9   18 |  0  6   6
---------------------------+-------+--------------+--------------------+-------------------------+---------------------------------+-----------------------+----------
x.3o. .. .. .. .. ..     & |  3  0 |   3    0   0 | 560    *    *    *    4    4     0    0   0 |   6   4    6    0    0    0   0 |   4   6    4   0    0 |  1  4   1
xo .. .. .. .. .. ..&#x  & |  2  1 |   1    2   0 |   * 3360    *    *    0    2     6    0   0 |   0   1    6    3    6    0   0 |   0   3    6   3    2 |  0  4   2
.. .. .. ox .. .. ..&#x    |  1  2 |   0    2   1 |   *    * 5040    *    0    0     4    4   0 |   0   0    2    4    8    2   0 |   0   2    4   4    4 |  0  4   2
.. .. .o3.x .. .. ..     & |  0  3 |   0    0   3 |   *    *    * 1120    0    0     0    6   2 |   0   0    0    3    6    6   1 |   0   3    2   3    6 |  0  4   2
---------------------------+-------+--------------+--------------------+-------------------------+---------------------------------+-----------------------+----------
x.3o.3o. .. .. .. ..     &   4  0 |   6    0   0 |   4    0    0    0 | 560    *     *    *   * |   3   1    0    0    0    0   0 |   3   3    0   0    0 |  1  3   0
xo3oo .. .. .. .. ..&#x  &   3  1 |   3    3   0 |   1    3    0    0 |   * 2240     *    *   * |   0   1    3    0    0    0   0 |   0   3    3   0    0 |  0  3   1
xo .. .. ox .. .. ..&#x  &   2  2 |   1    4   1 |   0    2    2    0 |   *    * 10080    *   * |   0   0    1    1    2    0   0 |   0   1    2   2    1 |  0  3   1
.. .. oo3ox .. .. ..&#x  &   1  3 |   0    3   3 |   0    0    3    1 |   *    *     * 6720   * |   0   0    0    1    2    1   0 |   0   1    1   2    2 |  0  3   1
.. .o3.o3.x .. .. ..     &   0  4 |   0    0   6 |   0    0    0    4 |   *    *     *    * 560 |   0   0    0    0    0    3   1 |   0   3    0   0    3 |  0  3   1
---------------------------+-------+--------------+--------------------+-------------------------+---------------------------------+-----------------------+----------
x.3o.3o.3o. .. .. ..     &   5  0 |  10    0   0 |  10    0    0    0 |   5    0     0    0   0 | 336   *    *    *    *    *   * |   2   1    0   0    0 |  1  2   0
xo3oo3oo .. .. .. ..&#x  &   4  1 |   6    4   0 |   4    6    0    0 |   1    4     0    0   0 |   * 560    *    *    *    *   * |   0   3    0   0    0 |  0  3   0
xo3oo .. ox .. .. ..&#x  &   3  2 |   3    6   1 |   1    6    3    0 |   0    2     3    0   0 |   *   * 3360    *    *    *   * |   0   1    2   0    0 |  0  2   1
xo .. oo3ox .. .. ..&#x  &   2  3 |   1    6   3 |   0    3    6    1 |   0    0     3    2   0 |   *   *    * 3360    *    *   * |   0   1    0   2    0 |  0  3   0
xo .. .. ox3oo .. ..&#x  &   2  3 |   1    6   3 |   0    3    6    1 |   0    0     3    2   0 |   *   *    *    * 6720    *   * |   0   0    1   1    1 |  0  2   1
.. oo3oo3ox .. .. ..&#x  &   1  4 |   0    4   6 |   0    0    6    4 |   0    0     0    4   1 |   *   *    *    *    * 1680   * |   0   1    0   0    2 |  0  2   1
.o3.o3.o3.x .. .. ..     &   0  5 |   0    0  10 |   0    0    0   10 |   0    0     0    0   5 |   *   *    *    *    *    * 112 |   0   3    0   0    0 |  0  3   0
---------------------------+-------+--------------+--------------------+-------------------------+---------------------------------+-----------------------+----------
x.3o.3o.3o.3o. .. ..     &   6  0 |  15    0   0 |  20    0    0    0 |  15    0     0    0   0 |   6   0    0    0    0    0   0 | 112   *    *   *    * |  1  1   0
xo3oo3oo3ox .. .. ..&#x  &   5  5 |  10   20  10 |  10   30   30   10 |   5   20    30   20   5 |   1   5   10   10    0    5   1 |   * 336    *   *    * |  0  2   0
xo3oo .. ox3oo .. ..&#x  &   3  3 |   3    9   3 |   1    9    9    1 |   0    3     9    3   0 |   0   0    3    0    3    0   0 |   *   * 2240   *    * |  0  1   1
xo .. oo3ox3oo .. xo&#zx     4  6 |   4   24  12 |   0   24   48    8 |   0    0    48   32   0 |   0   0    0   16   16    0   0 |   *   *    * 420    * |  0  2   0
xo .. .. ox3oo3oo ..&#x  &   2  4 |   1    8   6 |   0    4   12    4 |   0    0     6    8   1 |   0   0    0    0    4    2   0 |   *   *    *   * 1680 |  0  1   1
---------------------------+-------+--------------+--------------------+-------------------------+---------------------------------+-----------------------+----------
x.3o.3o.3o.3o.3o. ..     &   7  0 |  21    0   0 |  35    0    0    0 |  35    0     0    0   0 |  21   0    0    0    0    0   0 |   7   0    0   0    0 | 16  *   *
xo3oo3oo3ox3oo .. xo&#zx &  12 15 |  36  120  60 |  40  240  360   80 |  30  120   540  360  30 |  12  30  120  180  240   60   6 |   2  12   40  15   30 |  * 56   *
xo3oo .. ox3oo3oo ..&#x  &   3  4 |   3   12   6 |   1   12   18    4 |   0    4    18   12   1 |   0   0    6    0   12    3   0 |   0   0    4   0    3 |  *  * 560

ox(uo)xo ox(oo)oo3oo(oo)oo3oo(oo)xo *c3oo(ox)oo3xo(oo)ox&#xt   → all heights = 1/sqrt(8) = 0.353553
(tac || pseudo hinnip || pseudo compound of perp u-line and rat || pseudo alt. hinnip || tac)

...

© 2004-2019
top of page