Acronym sochax
Name small cellated hemihexeract,
stericated demihexeract,
pentic hexaract
Circumradius sqrt(7)/2 = 1.322876
Inradius
wrt. hix
2/sqrt(3) = 1.154701
Inradius
wrt. scad
sqrt(3)/2 = 0.866025
Inradius
wrt. tratet
5/sqrt(24) = 1.020621
Inradius
wrt. hexip
1
Inradius
wrt. hin
3/sqrt(8) = 1.060660
Lace city
in approx. ASCII-art
 ©  
    H   h    		-- x3o3o *b3o3o (hin)
             
H   R   r   h		-- x3o3o *b3o3x (siphin)
             
h   r   R   H		-- o3o3x *b3o3x (alt. siphin)
             
    h   H    		-- o3o3x *b3o3o (alt. hin)

where:
H = x3o3o *b3o (hex)
h = o3o3x *b3o (gyro hex)
R = x3o3o *b3x (gyro rit)
r = o3o3x *b3x (rit)
                     _+----------- x3o3o3o3x (scad)
                  _-    _+-------- uo3oo3ox3oo3ox (inv. sarx + u-hix)
               _-    _-    _+----- xo3oo3xo3oo3ou (sarx + dual u-hix)
            _-    _-    _-    _+-- x3o3o3o3x (scad)

        q     o    		-- x3o3o3o3o (hix)
                   
    d     S     r  		-- x3o3o3x3o (spix)
                   
p     uT    Ut    q		-- xo3xo3ox3ox (tix + inv. tix)
                   
  R     s     d    		-- o3x3o3o3x (inv. spix)
                   
    o     p        		-- o3o3o3o3x (dual hix)

      \     \     \     +-- x3o3o *b3o3o (hin)
       \     \     +------- x3o3o *b3o3x (siphin)
        \     +------------ o3o3x *b3o3x (alt. siphin)
         +----------------- o3o3x *b3o3o (alt. hin)

where:
o = o3o3o3o (pt)
p = x3o3o3o (pen)
q = o3o3o3x (dual pen)
r = o3x3o3o (rap)
R = o3o3x3o (inv. rap)
t = x3x3o3o (tip)
T = o3o3x3x (inv. tip)
u = u3o3o3o (u-pen)
U = o3o3o3u (dual u-pen)
s = x3o3x3o (srip)
S = o3x3o3x (inv. srip)
d = x3o3o3x (spid)
Coordinates (1/sqrt(8), 1/sqrt(8), 1/sqrt(8), 1/sqrt(8), 1/sqrt(8), 3/sqrt(8))       & all permutations, all even changes of sign
Volume 2737/360 = 7.602778
Surface [300+39 sqrt(2)+506 sqrt(3)+100 sqrt(6)]/30 = 49.217367
Confer
related segmentopeta:
hinasiphin   siphina   ritas  
analogs:
maximal expanded demihypercube eDn  
External
links
wikipedia   polytopewiki  

°: The equatorial layer in its hix-first orientation alternatively could be seen as a compound of tix & inv tix, or, more convex, as the tegum sum of tix & inv tix, but then with u-lacings, i.e. as xo3xo3oo3ox3ox&#zu. These u-lacings simply happen to be medial sections of the inscribed (unit) hexagons of scad.


Incidence matrix according to Dynkin symbol

x3o3o *b3o3o3x

. . .    . . . | 192 |  10   5 |   30   30  10 |  10  20   60  30  20 |   5  20   5  20  30  10   5 |  1  5  10  5  1
---------------+-----+---------+---------------+----------------------+-----------------------------+----------------
x . .    . . . |   2 | 960   * |    6    3   0 |   3   6   12   3   0 |   3   6   2   6   6   1   0 |  1  3   3  2  0
. . .    . . x |   2 |   * 480 |    0    6   4 |   0   0   12  12   6 |   0   4   0   4  12   6   4 |  0  1   4  4  1
---------------+-----+---------+---------------+----------------------+-----------------------------+----------------
x3o .    . . . |   3 |   3   0 | 1920    *   * |   1   2    2   0   0 |   2   2   1   2   1   0   0 |  1  2   1  1  0
x . .    . . x |   4 |   2   2 |    * 1440   * |   0   0    4   2   0 |   0   2   0   2   4   1   0 |  0  1   2  2  0
. . .    . o3x |   3 |   0   3 |    *    * 640 |   0   0    0   3   3 |   0   0   0   0   3   3   3 |  0  0   1  3  1
---------------+-----+---------+---------------+----------------------+-----------------------------+----------------
x3o3o    . . .    4 |   6   0 |    4    0   0 | 480   *    *   *   * |   2   2   0   0   0   0   0 |  1  2   1  0  0
x3o . *b3o . .    4 |   6   0 |    4    0   0 |   * 960    *   *   * |   1   0   1   1   0   0   0 |  1  1   0  1  0
x3o .    . . x    6 |   6   3 |    2    3   0 |   *   * 1920   *   * |   0   1   0   1   1   0   0 |  0  1   1  1  0
x . .    . o3x    6 |   3   6 |    0    3   2 |   *   *    * 960   * |   0   0   0   0   2   1   0 |  0  0   1  2  0
. . .    o3o3x    4 |   0   6 |    0    0   4 |   *   *    *   * 480 |   0   0   0   0   0   1   2 |  0  0   0  2  1
---------------+-----+---------+---------------+----------------------+-----------------------------+----------------
x3o3o *b3o . .    8 |  24   0 |   32    0   0 |   8   8    0   0   0 | 120   *   *   *   *   *   * |  1  1   0  0  0
x3o3o    . . x    8 |  12   4 |    8    6   0 |   2   0    4   0   0 |   * 480   *   *   *   *   * |  0  1   1  0  0
x3o . *b3o3o .    5 |  10   0 |   10    0   0 |   0   5    0   0   0 |   *   * 192   *   *   *   * |  1  0   0  1  0
x3o . *b3o . x    8 |  12   4 |    8    6   0 |   0   2    4   0   0 |   *   *   * 480   *   *   * |  0  1   0  1  0
x3o .    . o3x    9 |   9   9 |    3    9   3 |   0   0    3   3   0 |   *   *   *   * 640   *   * |  0  0   1  1  0
x . .    o3o3x    8 |   4  12 |    0    6   8 |   0   0    0   4   2 |   *   *   *   *   * 240   * |  0  0   0  2  0
. o . *b3o3o3x    5 |   0  10 |    0    0  10 |   0   0    0   0   5 |   *   *   *   *   *   * 192 |  0  0   0  1  1
---------------+-----+---------+---------------+----------------------+-----------------------------+----------------
x3o3o *b3o3o .   16 |  80   0 |  160    0   0 |  40  80    0   0   0 |  10   0  16   0   0   0   0 | 12  *   *  *  *
x3o3o *b3o . x   16 |  48   8 |   64   24   0 |  16  16   32   0   0 |   2   8   0   8   0   0   0 |  * 60   *  *  *
x3o3o    . o3x   12 |  18  12 |   12   18   4 |   3   0   12   6   0 |   0   3   0   0   4   0   0 |  *  * 160  *  *
x3o . *b3o3o3x   30 |  60  60 |   60   90  60 |   0  30   60  60  30 |   0   0   6  15  20  15   6 |  *  *   * 32  *
. o3o *b3o3o3x    6 |   0  15 |    0    0  20 |   0   0    0   0  15 |   0   0   0   0   0   0   6 |  *  *   *  * 32

xxoo3oooo3ooxx *b3oooo3oxxo&#xt   → all heights = 1/sqrt(2) = 0.707107
(hin || siphin || alt. siphin || alt. hin)

o...3o...3o... *b3o...3o...     & | 32   * |  10   5   0   0   0 |  30  30  10   0   0   0   0   0 | 10  20  60  30  10   0   0   0   0   0   0   0   0   0 |  5  5  20  20  30  10   5  0  0  0  0   0   0   0   0  0 | 1  5 10  5  1  0  0  0
.o..3.o..3.o.. *b3.o..3.o..     & |  * 160 |   0   1   6   4   4 |   0   6   4  12  12   6  18  12 |  0   0  12  12   6   4   4  12   6   4  16   6  36  12 |  0  0   4   4  12   6   4  1  4  1  4   5  16  12  18  4 | 0  1  4  5  1  1  4  6
----------------------------------+--------+---------------------+---------------------------------+--------------------------------------------------------+----------------------------------------------------------+-----------------------
x... .... ....    .... ....     & |  2   0 | 160   *   *   *   * |   6   3   0   0   0   0   0   0 |  3   6  12   3   0   0   0   0   0   0   0   0   0   0 |  3  2   6   6   6   1   0  0  0  0  0   0   0   0   0  0 | 1  3  3  2  0  0  0  0
oo..3oo..3oo.. *b3oo..3oo..&#x  & |  1   1 |   * 160   *   *   * |   0   6   4   0   0   0   0   0 |  0   0  12  12   6   0   0   0   0   0   0   0   0   0 |  0  0   4   4  12   6   4  0  0  0  0   0   0   0   0  0 | 0  1  4  4  1  0  0  0
.x.. .... ....    .... ....     & |  0   2 |   *   * 480   *   * |   0   1   0   4   2   0   2   0 |  0   0   4   2   0   2   2   4   1   0   4   1   4   0 |  0  0   2   2   4   1   0  1  2  0  2   2   4   2   2  0 | 0  1  2  2  0  1  2  1
.... .... ....    .... .x..     & |  0   2 |   *   *   * 320   * |   0   0   1   0   3   3   0   3 |  0   0   0   3   3   0   0   3   3   3   0   0   9   6 |  0  0   0   0   3   3   3  0  1  1  0   0   4   3   9  3 | 0  0  1  4  1  0  1  3
.oo.3.oo.3.oo. *b3.oo.3.oo.&#x    |  0   2 |   *   *   *   * 320 |   0   0   0   0   0   0   6   3 |  0   0   0   0   0   0   0   0   0   0   6   3  12   3 |  0  0   0   0   0   0   0  0  0  0  3   2   6   6   6  1 | 0  0  0  2  0  1  3  3
----------------------------------+--------+---------------------+---------------------------------+--------------------------------------------------------+----------------------------------------------------------+-----------------------
x...3o... ....    .... ....     & |  3   0 |   3   0   0   0   0 | 320   *   *   *   *   *   *   * |  1   2   2   0   0   0   0   0   0   0   0   0   0   0 |  2  1   2   2   1   0   0  0  0  0  0   0   0   0   0  0 | 1  2  1  1  0  0  0  0
xx.. .... ....    .... ....&#x  & |  2   2 |   1   2   1   0   0 |   * 480   *   *   *   *   *   * |  0   0   4   2   0   0   0   0   0   0   0   0   0   0 |  0  0   2   2   4   1   0  0  0  0  0   0   0   0   0  0 | 0  1  2  2  0  0  0  0
.... .... ....    .... ox..&#x  & |  1   2 |   0   2   0   1   0 |   *   * 320   *   *   *   *   * |  0   0   0   3   3   0   0   0   0   0   0   0   0   0 |  0  0   0   0   3   3   3  0  0  0  0   0   0   0   0  0 | 0  0  1  3  1  0  0  0
.x..3.o.. ....    .... ....     & |  0   3 |   0   0   3   0   0 |   *   *   * 640   *   *   *   * |  0   0   1   0   0   1   1   1   0   0   1   0   0   0 |  0  0   1   1   1   0   0  1  1  0  1   1   1   0   0  0 | 0  1  1  1  0  1  1  0
.x.. .... ....    .... .x..     & |  0   4 |   0   0   2   2   0 |   *   *   *   * 480   *   *   * |  0   0   0   1   0   0   0   2   1   0   0   0   2   0 |  0  0   0   0   2   1   0  0  1  0  0   0   2   1   2  0 | 0  0  1  2  0  0  1  1
.... .... ....    .o..3.x..     & |  0   3 |   0   0   0   3   0 |   *   *   *   *   * 320   *   * |  0   0   0   0   1   0   0   0   1   2   0   0   0   2 |  0  0   0   0   0   1   2  0  0  1  0   0   0   0   3  2 | 0  0  0  3  1  0  0  1
.xo. .... ....    .... ....&#x  & |  0   3 |   0   0   1   0   2 |   *   *   *   *   *   * 960   * |  0   0   0   0   0   0   0   0   0   0   2   1   2   0 |  0  0   0   0   0   0   0  0  0  0  2   1   2   2   1  0 | 0  0  0  1  0  1  2  1
.... .... ....    .... .xx.&#x    |  0   4 |   0   0   0   2   2 |   *   *   *   *   *   *   * 480 |  0   0   0   0   0   0   0   0   0   0   0   0   4   2 |  0  0   0   0   0   0   0  0  0  0  0   0   2   2   4  1 | 0  0  0  2  0  0  1  2
----------------------------------+--------+---------------------+---------------------------------+--------------------------------------------------------+----------------------------------------------------------+-----------------------
x...3o...3o...    .... ....     &   4   0 |   6   0   0   0   0 |   4   0   0   0   0   0   0   0 | 80   *   *   *   *   *   *   *   *   *   *   *   *   * |  2  0   2   0   0   0   0  0  0  0  0   0   0   0   0  0 | 1  2  1  0  0  0  0  0
x...3o... .... *b3o... ....     &   4   0 |   6   0   0   0   0 |   4   0   0   0   0   0   0   0 |  * 160   *   *   *   *   *   *   *   *   *   *   *   * |  1  1   0   1   0   0   0  0  0  0  0   0   0   0   0  0 | 1  1  0  1  0  0  0  0
xx..3oo.. ....    .... ....&#x  &   3   3 |   3   3   3   0   0 |   1   3   0   1   0   0   0   0 |  *   * 640   *   *   *   *   *   *   *   *   *   *   * |  0  0   1   1   1   0   0  0  0  0  0   0   0   0   0  0 | 0  1  1  1  0  0  0  0
xx.. .... ....    .... ox..&#x  &   2   4 |   1   4   2   2   0 |   0   2   2   0   1   0   0   0 |  *   *   * 480   *   *   *   *   *   *   *   *   *   * |  0  0   0   0   2   1   0  0  0  0  0   0   0   0   0  0 | 0  0  1  2  0  0  0  0
.... .... ....    oo..3ox..&#x  &   1   3 |   0   3   0   3   0 |   0   0   3   0   0   1   0   0 |  *   *   *   * 320   *   *   *   *   *   *   *   *   * |  0  0   0   0   0   1   2  0  0  0  0   0   0   0   0  0 | 0  0  0  2  1  0  0  0
.x..3.o..3.o..    .... ....     &   0   4 |   0   0   6   0   0 |   0   0   0   4   0   0   0   0 |  *   *   *   *   * 160   *   *   *   *   *   *   *   * |  0  0   1   0   0   0   0  1  1  0  1   0   0   0   0  0 | 0  1  1  0  0  1  1  0
.x..3.o.. .... *b3.o.. ....     &   0   4 |   0   0   6   0   0 |   0   0   0   4   0   0   0   0 |  *   *   *   *   *   * 160   *   *   *   *   *   *   * |  0  0   0   1   0   0   0  1  0  0  0   1   0   0   0  0 | 0  1  0  1  0  1  0  0
.x..3.o.. ....    .... .x..     &   0   6 |   0   0   6   3   0 |   0   0   0   2   3   0   0   0 |  *   *   *   *   *   *   * 320   *   *   *   *   *   * |  0  0   0   0   1   0   0  0  1  0  0   0   1   0   0  0 | 0  0  1  1  0  0  1  0
.x.. .... ....    .o..3.x..     &   0   6 |   0   0   3   6   0 |   0   0   0   0   3   2   0   0 |  *   *   *   *   *   *   *   * 160   *   *   *   *   * |  0  0   0   0   0   1   0  0  0  0  0   0   0   0   2  0 | 0  0  0  2  0  0  0  1
.... .o.. .... *b3.o..3.x..     &   0   4 |   0   0   0   6   0 |   0   0   0   0   0   4   0   0 |  *   *   *   *   *   *   *   *   * 160   *   *   *   * |  0  0   0   0   0   0   1  0  0  1  0   0   0   0   0  1 | 0  0  0  2  1  0  0  0
.xo.3.oo. ....    .... ....&#x  &   0   4 |   0   0   3   0   3 |   0   0   0   1   0   0   3   0 |  *   *   *   *   *   *   *   *   *   * 640   *   *   * |  0  0   0   0   0   0   0  0  0  0  1   1   1   0   0  0 | 0  0  0  1  0  1  1  0
.xo. .... .ox.    .... ....&#x      0   4 |   0   0   2   0   4 |   0   0   0   0   0   0   4   0 |  *   *   *   *   *   *   *   *   *   *   * 240   *   * |  0  0   0   0   0   0   0  0  0  0  2   0   0   2   0  0 | 0  0  0  0  0  1  2  1
.xo. .... ....    .... .xx.&#x  &   0   6 |   0   0   2   3   4 |   0   0   0   0   1   0   2   2 |  *   *   *   *   *   *   *   *   *   *   *   * 960   * |  0  0   0   0   0   0   0  0  0  0  0   0   1   1   1  0 | 0  0  0  1  0  0  1  1
.... .... ....    .oo.3.xx.&#x      0   6 |   0   0   0   6   3 |   0   0   0   0   0   2   0   3 |  *   *   *   *   *   *   *   *   *   *   *   *   * 320 |  0  0   0   0   0   0   0  0  0  0  0   0   0   0   2  1 | 0  0  0  2  0  0  0  1
----------------------------------+--------+---------------------+---------------------------------+--------------------------------------------------------+----------------------------------------------------------+-----------------------
x...3o...3o... *b3o... ....     &   8   0 |  24   0   0   0   0 |  32   0   0   0   0   0   0   0 |  8   8   0   0   0   0   0   0   0   0   0   0   0   0 | 20  *   *   *   *   *   *  *  *  *  *   *   *   *   *  * | 1  1  0  0  0  0  0  0
x...3o... .... *b3o...3o...     &   5   0 |  10   0   0   0   0 |  10   0   0   0   0   0   0   0 |  0   5   0   0   0   0   0   0   0   0   0   0   0   0 |  * 32   *   *   *   *   *  *  *  *  *   *   *   *   *  * | 1  0  0  1  0  0  0  0
xx..3oo..3oo..    .... ....&#x  &   4   4 |   6   4   6   0   0 |   4   6   0   4   0   0   0   0 |  1   0   4   0   0   1   0   0   0   0   0   0   0   0 |  *  * 160   *   *   *   *  *  *  *  *   *   *   *   *  * | 0  1  1  0  0  0  0  0
xx..3oo.. .... *b3oo.. ....&#x  &   4   4 |   6   4   6   0   0 |   4   6   0   4   0   0   0   0 |  0   1   4   0   0   0   1   0   0   0   0   0   0   0 |  *  *   * 160   *   *   *  *  *  *  *   *   *   *   *  * | 0  1  0  1  0  0  0  0
xx..3oo.. ....    .... ox..&#x  &   3   6 |   3   6   6   3   0 |   1   6   3   2   3   0   0   0 |  0   0   2   3   0   0   0   1   0   0   0   0   0   0 |  *  *   *   * 320   *   *  *  *  *  *   *   *   *   *  * | 0  0  1  1  0  0  0  0
xx.. .... ....    oo..3ox..&#x  &   2   6 |   1   6   3   6   0 |   0   3   6   0   3   2   0   0 |  0   0   0   3   2   0   0   0   1   0   0   0   0   0 |  *  *   *   *   * 160   *  *  *  *  *   *   *   *   *  * | 0  0  0  2  0  0  0  0
.... oo.. .... *b3oo..3ox..&#x  &   1   4 |   0   4   0   6   0 |   0   0   6   0   0   4   0   0 |  0   0   0   0   4   0   0   0   0   1   0   0   0   0 |  *  *   *   *   *   * 160  *  *  *  *   *   *   *   *  * | 0  0  0  1  1  0  0  0
.x..3.o..3.o.. *b3.o.. ....     &   0   8 |   0   0  24   0   0 |   0   0   0  32   0   0   0   0 |  0   0   0   0   0   8   8   0   0   0   0   0   0   0 |  *  *   *   *   *   *   * 20  *  *  *   *   *   *   *  * | 0  1  0  0  0  1  0  0
.x..3.o..3.o..    .... .x..     &   0   8 |   0   0  12   4   0 |   0   0   0   8   6   0   0   0 |  0   0   0   0   0   2   0   4   0   0   0   0   0   0 |  *  *   *   *   *   *   *  * 80  *  *   *   *   *   *  * | 0  0  1  0  0  0  1  0
.... .o..3.o.. *b3.o..3.x..     &   0   5 |   0   0   0  10   0 |   0   0   0   0   0  10   0   0 |  0   0   0   0   0   0   0   0   0   5   0   0   0   0 |  *  *   *   *   *   *   *  *  * 32  *   *   *   *   *  * | 0  0  0  1  1  0  0  0
.xo.3.oo.3.ox.    .... ....&#x      0   8 |   0   0  12   0  12 |   0   0   0   8   0   0  24   0 |  0   0   0   0   0   2   0   0   0   0   8   6   0   0 |  *  *   *   *   *   *   *  *  *  * 80   *   *   *   *  * | 0  0  0  0  0  1  1  0
.xo.3.oo. .... *b3.oo. ....&#x  &   0   5 |   0   0   6   0   4 |   0   0   0   4   0   0   6   0 |  0   0   0   0   0   0   1   0   0   0   4   0   0   0 |  *  *   *   *   *   *   *  *  *  *  * 160   *   *   *  * | 0  0  0  1  0  1  0  0
.xo.3.oo. ....    .... .xx.&#x  &   0   8 |   0   0   6   4   6 |   0   0   0   2   3   0   6   3 |  0   0   0   0   0   0   0   1   0   0   2   0   3   0 |  *  *   *   *   *   *   *  *  *  *  *   * 320   *   *  * | 0  0  0  1  0  0  1  0
.xo. .... .ox.    .... .xx.&#x      0   8 |   0   0   4   4   8 |   0   0   0   0   2   0   8   4 |  0   0   0   0   0   0   0   0   0   0   0   2   4   0 |  *  *   *   *   *   *   *  *  *  *  *   *   * 240   *  * | 0  0  0  0  0  0  1  1
.xo. .... ....    .oo.3.xx.&#x  &   0   9 |   0   0   3   9   6 |   0   0   0   0   3   3   3   6 |  0   0   0   0   0   0   0   0   1   0   0   0   3   2 |  *  *   *   *   *   *   *  *  *  *  *   *   *   * 320  * | 0  0  0  1  0  0  0  1
.... .oo. .... *b3.oo.3.xx.&#x      0   8 |   0   0   0  12   4 |   0   0   0   0   0   8   0   6 |  0   0   0   0   0   0   0   0   0   2   0   0   0   4 |  *  *   *   *   *   *   *  *  *  *  *   *   *   *   * 80 | 0  0  0  2  0  0  0  0
----------------------------------+--------+---------------------+---------------------------------+--------------------------------------------------------+----------------------------------------------------------+-----------------------
x...3o...3o... *b3o...3o...     &  16   0 |  80   0   0   0   0 | 160   0   0   0   0   0   0   0 | 40  80   0   0   0   0   0   0   0   0   0   0   0   0 | 10 16   0   0   0   0   0  0  0  0  0   0   0   0   0  0 | 2  *  *  *  *  *  *  *
xx..3oo..3oo.. *b3oo.. ....&#x  &   8   8 |  24   8  24   0   0 |  32  24   0  32   0   0   0   0 |  8   8  32   0   0   8   8   0   0   0   0   0   0   0 |  1  0   8   8   0   0   0  1  0  0  0   0   0   0   0  0 | * 20  *  *  *  *  *  *
xx..3oo..3oo..    .... ox..&#x  &   4   8 |   6   8  12   4   0 |   4  12   4   8   6   0   0   0 |  1   0   8   6   0   2   0   4   0   0   0   0   0   0 |  0  0   2   0   4   0   0  0  1  0  0   0   0   0   0  0 | *  * 80  *  *  *  *  *
xxo.3ooo. .... *b3ooo.3oxx.&#xt &   5  25 |  10  20  30  40  20 |  10  30  30  20  30  30  30  30 |  0   5  20  30  20   0   5  10  10  10  20   0  30  20 |  0  1   0   5  10  10   5  0  0  1  0   5  10   0  10  5 | *  *  * 32  *  *  *  *
.... oo..3oo.. *b3oo..3ox..&#x  &   1   5 |   0   5   0  10   0 |   0   0  10   0   0  10   0   0 |  0   0   0   0  10   0   0   0   0   5   0   0   0   0 |  0  0   0   0   0   0   5  0  0  1  0   0   0   0   0  0 | *  *  *  * 32  *  *  *
.xo.3.oo.3.ox. *b3.oo. ....&#x      0  16 |   0   0  48   0  32 |   0   0   0  64   0   0  96   0 |  0   0   0   0   0  16  16   0   0   0  64  24   0   0 |  0  0   0   0   0   0   0  2  0  0  8  16   0   0   0  0 | *  *  *  *  * 10  *  *
.xo.3.oo.3.ox.    .... .xx.&#x      0  16 |   0   0  24   8  24 |   0   0   0  16  12   0  48  12 |  0   0   0   0   0   4   0   8   0   0  16  12  24   0 |  0  0   0   0   0   0   0  0  2  0  2   0   8   6   0  0 | *  *  *  *  *  * 40  *
.xo. .... .ox.    .oo.3.xx.&#x      0  12 |   0   0   6  12  12 |   0   0   0   0   6   4  12  12 |  0   0   0   0   0   0   0   0   2   0   0   3  12   4 |  0  0   0   0   0   0   0  0  0  0  0   0   0   3   4  0 | *  *  *  *  *  *  * 80

xx(xo)oo3ox(xo)xo3oo(oo)oo3ox(ox)oo3oo(ox)xx&#xt   → all heights = 1/sqrt(3) = 0.577350
(hix || spix || (tix, inv tix)-compound° || inv spix || dual hix)

o.(..)..3o.(..)..3o.(..)..3o.(..)..3o.(..)..     & | 12   *  * |  5  10   0   0   0   0  0   0 | 10  30  30   0   0   0   0   0   0   0   0   0   0   0   0 | 10  30  60  20  10  0   0   0   0  0   0   0   0   0   0   0   0   0   0   0   0  0 |  5 10  30  20  20  5  5  0   0   0  0   0  0   0   0   0  0   0  0   0   0  0 | 1 10  5  1  5  0  0   0  0
.o(..)..3.o(..)..3.o(..)..3.o(..)..3.o(..)..     & |  * 120  * |  0   1   3   6   3   2  0   0 |  0   3   6   3  12   6   3   3   3  12   6   6   1   3   0 |  0   3  12   6   3  1   6   6   6  2  12   1   6   6   6   6  12   3   6   9  18  0 |  0  1   6   6   6  2  3  3   6   6  2   3  2   6   3   6  2  15  3   8   6  0 | 0  3  3  1  2  1  3   7  2
..(o.)..3..(o.)..3..(o.)..3..(o.)..3..(o.)..     & |  *   * 60 |  0   0   0   0   6   4  1   4 |  0   0   0   0   0   0   0   6  12  12   6  12   4   6   6 |  0   0   0   0   0  0   0   0   0  0  12   6  12   4   4   4  12   6  12  18  36  4 |  0  0   0   0   0  0  1  0   4   4  4   4  1   4   4   6  4  24  6  16  12  1 | 0  0  1  1  1  1  4  10  4
---------------------------------------------------+-----------+-------------------------------+------------------------------------------------------------+-------------------------------------------------------------------------------------+-------------------------------------------------------------------------------+---------------------------
x.(..).. ..(..).. ..(..).. ..(..).. ..(..)..     & |  2   0  0 | 30   *   *   *   *   *  *   * |  4   6   0   0   0   0   0   0   0   0   0   0   0   0   0 |  6  12  12   0   0  0   0   0   0  0   0   0   0   0   0   0   0   0   0   0   0  0 |  4  6  12   4   4  0  0  0   0   0  0   0  0   0   0   0  0   0  0   0   0  0 | 1  4  1  0  4  0  0   0  0
oo(..)..3oo(..)..3oo(..)..3oo(..)..3oo(..)..&#x  & |  1   1  0 |  * 120   *   *   *   *  *   * |  0   3   6   0   0   0   0   0   0   0   0   0   0   0   0 |  0   3  12   6   3  0   0   0   0  0   0   0   0   0   0   0   0   0   0   0   0  0 |  0  1   6   6   6  2  3  0   0   0  0   0  0   0   0   0  0   0  0   0   0  0 | 0  3  3  1  2  0  0   0  0
.x(..).. ..(..).. ..(..).. ..(..).. ..(..)..     & |  0   2  0 |  *   * 180   *   *   *  *   * |  0   1   0   2   4   0   0   1   0   0   2   0   0   0   0 |  0   2   4   0   0  1   4   2   2  0   4   0   0   0   0   4   4   1   0   2   0  0 |  0  1   4   2   2  0  0  2   2   2  0   0  2   4   2   2  0   4  1   0   0  0 | 0  2  1  0  2  1  2   2  0
..(..).. ..(..).. ..(..).. .x(..).. ..(..)..     & |  0   2  0 |  *   *   * 360   *   *  *   * |  0   0   1   0   2   2   1   0   0   2   0   1   0   0   0 |  0   0   2   2   1  0   1   2   2  1   2   0   1   2   2   0   2   0   2   0   2  0 |  0  0   1   2   2  1  2  1   2   2  4   1  0   1   0   2  1   2  0   2   1  0 | 0  1  2  1  1  0  1   2  1
.o(o.)..3.o(o.)..3.o(o.)..3.o(o.)..3.o(o.)..&#x  & |  0   1  1 |  *   *   *   * 360   *  *   * |  0   0   0   0   0   0   0   1   2   4   0   0   0   2   0 |  0   0   0   0   0  0   0   0   0  0   4   1   4   2   2   0   0   0   0   3   8  0 |  0  0   0   0   0  0  1  0   2   2  2   2  0   0   0   0  0   6  1   4   4  0 | 0  0  1  1  0  0  2   3  2
.o(.o)..3.o(.o)..3.o(.o)..3.o(.o)..3.o(.o)..&#x  & |  0   1  1 |  *   *   *   *   * 240  *   * |  0   0   0   0   0   0   0   0   0   0   3   3   1   3   0 |  0   0   0   0   0  0   0   0   0  0   0   0   0   0   0   3   6   3   3   6   9  0 |  0  0   0   0   0  0  0  0   0   0  0   0  1   3   3   3  1   9  3   4   3  0 | 0  0  0  0  1  1  3   4  1
..(x.).. ..(..).. ..(..).. ..(..).. ..(..)..     & |  0   0  2 |  *   *   *   *   *   * 30   * |  0   0   0   0   0   0   0   6   0   0   0   0   4   0   0 |  0   0   0   0   0  0   0   0   0  0  12   0   0   0   0   0   0   6   0  12   0  0 |  0  0   0   0   0  0  0  0   4   4  0   0  0   0   0   0  0  12  6   0   0  0 | 0  0  1  0  0  1  4   4  0
..(..).. ..(x.).. ..(..).. ..(..).. ..(..)..     & |  0   0  2 |  *   *   *   *   *   *  * 120 |  0   0   0   0   0   0   0   0   3   0   0   3   0   0   3 |  0   0   0   0   0  0   0   0   0  0   0   3   3   0   0   0   3   0   2   0   6  3 |  0  0   0   0   0  0  0  0   0   0  3   1  0   1   1   3  3   3  0   6   3  1 | 0  0  0  1  1  0  1   3  3
---------------------------------------------------+-----------+-------------------------------+------------------------------------------------------------+-------------------------------------------------------------------------------------+-------------------------------------------------------------------------------+---------------------------
x.(..)..3o.(..).. ..(..).. ..(..).. ..(..)..     & |  3   0  0 |  3   0   0   0   0   0  0   0 | 40   *   *   *   *   *   *   *   *   *   *   *   *   *   * |  3   3   0   0   0  0   0   0   0  0   0   0   0   0   0   0   0   0   0   0   0  0 |  3  3   3   0   0  0  0  0   0   0  0   0  0   0   0   0  0   0  0   0   0  0 | 1  1  0  0  3  0  0   0  0
xx(..).. ..(..).. ..(..).. ..(..).. ..(..)..&#x  & |  2   2  0 |  1   2   1   0   0   0  0   0 |  * 180   *   *   *   *   *   *   *   *   *   *   *   *   * |  0   2   4   0   0  0   0   0   0  0   0   0   0   0   0   0   0   0   0   0   0  0 |  0  1   4   2   2  0  0  0   0   0  0   0  0   0   0   0  0   0  0   0   0  0 | 0  2  1  0  2  0  0   0  0
..(..).. ..(..).. ..(..).. ox(..).. ..(..)..&#x  & |  1   2  0 |  0   2   0   1   0   0  0   0 |  *   * 360   *   *   *   *   *   *   *   *   *   *   *   * |  0   0   2   2   1  0   0   0   0  0   0   0   0   0   0   0   0   0   0   0   0  0 |  0  0   1   2   2  1  2  0   0   0  0   0  0   0   0   0  0   0  0   0   0  0 | 0  1  2  1  1  0  0   0  0
.x(..)..3.o(..).. ..(..).. ..(..).. ..(..)..     & |  0   3  0 |  0   0   3   0   0   0  0   0 |  *   *   * 120   *   *   *   *   *   *   *   *   *   *   * |  0   1   0   0   0  1   2   0   0  0   0   0   0   0   0   2   0   0   0   0   0  0 |  0  1   2   0   0  0  0  1   0   0  0   0  2   2   1   0  0   0  0   0   0  0 | 0  1  0  0  2  1  1   0  0
.x(..).. ..(..).. ..(..).. .x(..).. ..(..)..     & |  0   4  0 |  0   0   2   2   0   0  0   0 |  *   *   *   * 360   *   *   *   *   *   *   *   *   *   * |  0   0   1   0   0  0   1   1   1  0   1   0   0   0   0   0   1   0   0   0   0  0 |  0  0   1   1   1  0  0  1   1   1  0   0  0   1   0   1  0   1  0   0   0  0 | 0  1  1  0  1  0  1   1  0
..(..).. ..(..).. .o(..)..3.x(..).. ..(..)..     & |  0   3  0 |  0   0   0   3   0   0  0   0 |  *   *   *   *   * 240   *   *   *   *   *   *   *   *   * |  0   0   0   1   0  0   0   4   0  1   0   0   0   1   0   0   0   0   1   0   0  0 |  0  0   0   1   0  1  1  0   1   0  1   0  0   0   0   1  1   0  0   1   0  0 | 0  0  1  1  1  0  0   1  1
..(..).. ..(..).. ..(..).. .x(..)..3.o(..)..     & |  0   3  0 |  0   0   0   3   0   0  0   0 |  *   *   *   *   *   * 120   *   *   *   *   *   *   *   * |  0   0   0   0   1  0   0   0   2  0   0   0   0   0   2   0   0   0   0   0   0  0 |  0  0   0   0   2  0  2  1   0   2  0   2  0   0   0   0  0   0  0   0   0  0 | 0  1  2  1  0  0  1   0  0
.x(x.).. ..(..).. ..(..).. ..(..).. ..(..)..&#x  & |  0   2  2 |  0   0   1   0   2   0  1   0 |  *   *   *   *   *   *   * 180   *   *   *   *   *   *   * |  0   0   0   0   0  0   0   0   0  0   4   0   0   0   0   0   0   0   0   2   0  0 |  0  0   0   0   0  0  0  0   2   2  0   0  0   0   0   0  0   4  1   0   0  0 | 0  0  1  0  0  0  2   2  0
..(..).. .o(x.).. ..(..).. ..(..).. ..(..)..&#x  & |  0   1  2 |  0   0   0   0   2   0  0   1 |  *   *   *   *   *   *   *   * 360   *   *   *   *   *   * |  0   0   0   0   0  0   0   0   0  0   0   1   2   0   0   0   0   0   0   0   2  0 |  0  0   0   0   0  0  0  0   0   0  2   1  0   0   0   0  0   1  0   2   2  0 | 0  0  0  1  0  0  1   1  2
..(..).. ..(..).. ..(..).. .x(o.).. ..(..)..&#x  & |  0   2  1 |  0   0   0   1   2   0  0   0 |  *   *   *   *   *   *   *   *   * 720   *   *   *   *   * |  0   0   0   0   0  0   0   0   0  0   1   0   1   1   1   0   0   0   0   0   1  0 |  0  0   0   0   0  0  1  0   1   1  1   1  0   0   0   0  0   1  0   1   1  0 | 0  0  1  1  0  0  1   1  1
.x(.o).. ..(..).. ..(..).. ..(..).. ..(..)..&#x  & |  0   2  1 |  0   0   1   0   0   2  0   0 |  *   *   *   *   *   *   *   *   *   * 360   *   *   *   * |  0   0   0   0   0  0   0   0   0  0   0   0   0   0   0   2   2   1   0   1   0  0 |  0  0   0   0   0  0  0  0   0   0  0   0  1   2   2   1  0   2  1   0   0  0 | 0  0  0  0  1  1  2   1  0
..(..).. ..(..).. ..(..).. .x(.x).. ..(..)..&#x  & |  0   2  2 |  0   0   0   1   0   2  0   1 |  *   *   *   *   *   *   *   *   *   *   * 360   *   *   * |  0   0   0   0   0  0   0   0   0  0   0   0   0   0   0   0   2   0   2   0   2  0 |  0  0   0   0   0  0  0  0   0   0  0   0  0   1   0   2  1   2  0   2   1  0 | 0  0  0  0  1  0  1   2  1
..(..).. ..(..).. ..(..).. ..(..).. .o(.x)..&#x  & |  0   1  2 |  0   0   0   0   0   2  1   0 |  *   *   *   *   *   *   *   *   *   *   *   * 120   *   * |  0   0   0   0   0  0   0   0   0  0   0   0   0   0   0   0   0   3   0   3   0  0 |  0  0   0   0   0  0  0  0   0   0  0   0  0   0   3   0  0   3  3   0   0  0 | 0  0  0  0  0  1  3   1  0
.oooo.  3.oooo.  3.oooo.  3.oooo.  3.oooo.  &#xr   |  0   2  2 |  0   0   0   0   2   2  0   0 |  *   *   *   *   *   *   *   *   *   *   *   *   * 360   * |  0   0   0   0   0  0   0   0   0  0   0   0   0   0   0   0   0   0   0   2   4  0 |  0  0   0   0   0  0  0  0   0   0  0   0  0   0   0   0  0   4  1   2   2  0 | 0  0  0  0  0  0  2   2  1
..(..).. ..(x.)..3..(o.).. ..(..).. ..(..)..     & |  0   0  3 |  0   0   0   0   0   0  0   3 |  *   *   *   *   *   *   *   *   *   *   *   *   *   * 120 |  0   0   0   0   0  0   0   0   0  0   0   1   0   0   0   0   0   0   2   0   0  2 |  0  0   0   0   0  0  0  0   0   0  2   0  0   0   0   1  2   0  0   2   0  1 | 0  0  0  1  1  0  0   1  2
---------------------------------------------------+-----------+-------------------------------+------------------------------------------------------------+-------------------------------------------------------------------------------------+-------------------------------------------------------------------------------+---------------------------
x.(..)..3o.(..)..3o.(..).. ..(..).. ..(..)..     &   4   0  0 |  6   0   0   0   0   0  0   0 |  4   0   0   0   0   0   0   0   0   0   0   0   0   0   0 | 30   *   *   *   *  *   *   *   *  *   *   *   *   *   *   *   *   *   *   *   *  * |  2  1   0   0   0  0  0  0   0   0  0   0  0   0   0   0  0   0  0   0   0  0 | 1  0  0  0  2  0  0   0  0
xx(..)..3oo(..).. ..(..).. ..(..).. ..(..)..&#x  &   3   3  0 |  3   3   3   0   0   0  0   0 |  1   3   0   1   0   0   0   0   0   0   0   0   0   0   0 |  * 120   *   *   *  *   *   *   *  *   *   *   *   *   *   *   *   *   *   *   *  * |  0  1   2   0   0  0  0  0   0   0  0   0  0   0   0   0  0   0  0   0   0  0 | 0  1  0  0  2  0  0   0  0
xx(..).. ..(..).. ..(..).. ox(..).. ..(..)..&#x  &   2   4  0 |  1   4   2   2   0   0  0   0 |  0   2   2   0   1   0   0   0   0   0   0   0   0   0   0 |  *   * 360   *   *  *   *   *   *  *   *   *   *   *   *   *   *   *   *   *   *  * |  0  0   1   1   1  0  0  0   0   0  0   0  0   0   0   0  0   0  0   0   0  0 | 0  1  1  0  1  0  0   0  0
..(..).. ..(..).. oo(..)..3ox(..).. ..(..)..&#x  &   1   3  0 |  0   3   0   3   0   0  0   0 |  0   0   3   0   0   1   0   0   0   0   0   0   0   0   0 |  *   *   * 240   *  *   *   *   *  *   *   *   *   *   *   *   *   *   *   *   *  * |  0  0   0   1   0  1  1  0   0   0  0   0  0   0   0   0  0   0  0   0   0  0 | 0  0  1  1  1  0  0   0  0
..(..).. ..(..).. ..(..).. ox(..)..3oo(..)..&#x  &   1   3  0 |  0   3   0   3   0   0  0   0 |  0   0   3   0   0   0   1   0   0   0   0   0   0   0   0 |  *   *   *   * 120  *   *   *   *  *   *   *   *   *   *   *   *   *   *   *   *  * |  0  0   0   0   2  0  2  0   0   0  0   0  0   0   0   0  0   0  0   0   0  0 | 0  1  2  1  0  0  0   0  0
.x(..)..3.o(..)..3.o(..).. ..(..).. ..(..)..     &   0   4  0 |  0   0   6   0   0   0  0   0 |  0   0   0   4   0   0   0   0   0   0   0   0   0   0   0 |  *   *   *   *   * 30   *   *   *  *   *   *   *   *   *   *   *   *   *   *   *  * |  0  1   0   0   0  0  0  0   0   0  0   0  2   0   0   0  0   0  0   0   0  0 | 0  0  0  0  2  1  0   0  0
.x(..)..3.o(..).. ..(..).. .x(..).. ..(..)..     &   0   6  0 |  0   0   6   3   0   0  0   0 |  0   0   0   2   3   0   0   0   0   0   0   0   0   0   0 |  *   *   *   *   *  * 120   *   *  *   *   *   *   *   *   *   *   *   *   *   *  * |  0  0   1   0   0  0  0  1   0   0  0   0  0   1   0   0  0   0  0   0   0  0 | 0  1  0  0  1  0  1   0  0
.x(..).. ..(..).. .o(..)..3.x(..).. ..(..)..     &   0   6  0 |  0   0   3   6   0   0  0   0 |  0   0   0   0   3   2   0   0   0   0   0   0   0   0   0 |  *   *   *   *   *  *   * 120   *  *   *   *   *   *   *   *   *   *   *   *   *  * |  0  0   0   1   0  0  0  0   1   0  0   0  0   0   0   1  0   0  0   0   0  0 | 0  0  1  0  1  0  0   1  0
.x(..).. ..(..).. ..(..).. .x(..)..3.o(..)..     &   0   6  0 |  0   0   3   6   0   0  0   0 |  0   0   0   0   3   0   2   0   0   0   0   0   0   0   0 |  *   *   *   *   *  *   *   * 120  *   *   *   *   *   *   *   *   *   *   *   *  * |  0  0   0   0   1  0  0  1   0   1  0   0  0   0   0   0  0   0  0   0   0  0 | 0  1  1  0  0  0  1   0  0
..(..).. .o(..)..3.o(..)..3.x(..).. ..(..)..     &   0   4  0 |  0   0   0   6   0   0  0   0 |  0   0   0   0   0   4   0   0   0   0   0   0   0   0   0 |  *   *   *   *   *  *   *   *   * 60   *   *   *   *   *   *   *   *   *   *   *  * |  0  0   0   0   0  1  0  0   0   0  1   0  0   0   0   0  1   0  0   0   0  0 | 0  0  0  1  1  0  0   0  1
.x(x.).. ..(..).. ..(..).. .x(o.).. ..(..)..&#x  &   0   4  2 |  0   0   2   2   4   0  1   0 |  0   0   0   0   1   0   0   2   0   2   0   0   0   0   0 |  *   *   *   *   *  *   *   *   *  * 360   *   *   *   *   *   *   *   *   *   *  * |  0  0   0   0   0  0  0  0   1   1  0   0  0   0   0   0  0   1  0   0   0  0 | 0  0  1  0  0  0  1   1  0
..(..).. .o(x.)..3.o(o.).. ..(..).. ..(..)..&#x  &   0   1  3 |  0   0   0   0   3   0  0   3 |  0   0   0   0   0   0   0   0   3   0   0   0   0   0   1 |  *   *   *   *   *  *   *   *   *  *   * 120   *   *   *   *   *   *   *   *   *  * |  0  0   0   0   0  0  0  0   0   0  2   0  0   0   0   0  0   0  0   2   0  0 | 0  0  0  1  0  0  0   1  2
..(..).. .o(x.).. ..(..).. .x(o.).. ..(..)..&#x  &   0   2  2 |  0   0   0   1   4   0  0   1 |  0   0   0   0   0   0   0   0   2   2   0   0   0   0   0 |  *   *   *   *   *  *   *   *   *  *   *   * 360   *   *   *   *   *   *   *   *  * |  0  0   0   0   0  0  0  0   0   0  1   1  0   0   0   0  0   0  0   0   1  0 | 0  0  0  1  0  0  1   0  1
..(..).. ..(..).. .o(o.)..3.x(o.).. ..(..)..&#x  &   0   3  1 |  0   0   0   3   3   0  0   0 |  0   0   0   0   0   1   0   0   0   3   0   0   0   0   0 |  *   *   *   *   *  *   *   *   *  *   *   *   * 240   *   *   *   *   *   *   *  * |  0  0   0   0   0  0  1  0   1   0  1   0  0   0   0   0  0   0  0   1   0  0 | 0  0  1  1  0  0  0   1  1
..(..).. ..(..).. ..(..).. .x(o.)..3.o(o.)..&#x  &   0   3  1 |  0   0   0   3   3   0  0   0 |  0   0   0   0   0   0   1   0   0   3   0   0   0   0   0 |  *   *   *   *   *  *   *   *   *  *   *   *   *   * 240   *   *   *   *   *   *  * |  0  0   0   0   0  0  1  0   0   1  0   1  0   0   0   0  0   0  0   0   0  0 | 0  0  1  1  0  0  1   0  0
.x(.o)..3.o(.o).. ..(..).. ..(..).. ..(..)..&#x  &   0   3  1 |  0   0   3   0   0   3  0   0 |  0   0   0   1   0   0   0   0   0   0   3   0   0   0   0 |  *   *   *   *   *  *   *   *   *  *   *   *   *   *   * 240   *   *   *   *   *  * |  0  0   0   0   0  0  0  0   0   0  0   0  1   1   1   0  0   0  0   0   0  0 | 0  0  0  0  1  1  1   0  0
.x(.o).. ..(..).. ..(..).. .x(.x).. ..(..)..&#x  &   0   4  2 |  0   0   2   2   0   4  0   1 |  0   0   0   0   1   0   0   0   0   0   2   2   0   0   0 |  *   *   *   *   *  *   *   *   *  *   *   *   *   *   *   * 360   *   *   *   *  * |  0  0   0   0   0  0  0  0   0   0  0   0  0   1   0   1  0   1  0   0   0  0 | 0  0  0  0  1  0  1   1  0
.x(.o).. ..(..).. ..(..).. ..(..).. .o(.x)..&#x  &   0   2  2 |  0   0   1   0   0   4  1   0 |  0   0   0   0   0   0   0   0   0   0   2   0   2   0   0 |  *   *   *   *   *  *   *   *   *  *   *   *   *   *   *   *   * 180   *   *   *  * |  0  0   0   0   0  0  0  0   0   0  0   0  0   0   2   0  0   0  1   0   0  0 | 0  0  0  0  0  1  2   0  0
..(..).. ..(..).. .o(.o)..3.x(.x).. ..(..)..&#x  &   0   3  3 |  0   0   0   3   0   3  0   1 |  0   0   0   0   0   1   0   0   0   0   0   3   0   0   1 |  *   *   *   *   *  *   *   *   *  *   *   *   *   *   *   *   *   * 240   *   *  * |  0  0   0   0   0  0  0  0   0   0  0   0  0   0   0   1  1   0  0   1   0  0 | 0  0  0  0  1  0  0   1  1
.xxoo.   ......   ......   ......   ......  &#xr &   0   3  3 |  0   0   1   0   3   4  1   0 |  0   0   0   0   0   0   0   1   0   0   1   0   1   2   0 |  *   *   *   *   *  *   *   *   *  *   *   *   *   *   *   *   *   *   * 360   *  * |  0  0   0   0   0  0  0  0   0   0  0   0  0   0   0   0  0   2  1   0   0  0 | 0  0  0  0  0  0  2   1  0
......   .oxxo.   ......   ......   ......  &#xr &   0   3  3 |  0   0   0   1   4   3  0   1 |  0   0   0   0   0   0   0   0   1   1   0   1   0   2   0 |  *   *   *   *   *  *   *   *   *  *   *   *   *   *   *   *   *   *   *   * 720  * |  0  0   0   0   0  0  0  0   0   0  0   0  0   0   0   0  0   1  0   1   1  0 | 0  0  0  0  0  0  1   1  1
..(..).. ..(x.)..3..(o.)..3..(o.).. ..(..)..     &   0   0  4 |  0   0   0   0   0   0  0   6 |  0   0   0   0   0   0   0   0   0   0   0   0   0   0   4 |  *   *   *   *   *  *   *   *   *  *   *   *   *   *   *   *   *   *   *   *   * 60 |  0  0   0   0   0  0  0  0   0   0  1   0  0   0   0   0  1   0  0   0   0  1 | 0  0  0  1  1  0  0   0  1
---------------------------------------------------+-----------+-------------------------------+------------------------------------------------------------+-------------------------------------------------------------------------------------+-------------------------------------------------------------------------------+---------------------------
x.(..)..3o.(..)..3o.(..)..3o.(..).. ..(..)..     &   5   0  0 | 10   0   0   0   0   0  0   0 | 10   0   0   0   0   0   0   0   0   0   0   0   0   0   0 |  5   0   0   0   0  0   0   0   0  0   0   0   0   0   0   0   0   0   0   0   0  0 | 12  *   *   *   *  *  *  *   *   *  *   *  *   *   *   *  *   *  *   *   *  * | 1  0  0  0  1  0  0   0  0
xx(..)..3oo(..)..3oo(..).. ..(..).. ..(..)..&#x  &   4   4  0 |  6   4   6   0   0   0  0   0 |  4   6   0   4   0   0   0   0   0   0   0   0   0   0   0 |  1   4   0   0   0  1   0   0   0  0   0   0   0   0   0   0   0   0   0   0   0  0 |  * 30   *   *   *  *  *  *   *   *  *   *  *   *   *   *  *   *  *   *   *  * | 0  0  0  0  2  0  0   0  0
xx(..)..3oo(..).. ..(..).. ox(..).. ..(..)..&#x  &   3   6  0 |  3   6   6   3   0   0  0   0 |  1   6   3   2   3   0   0   0   0   0   0   0   0   0   0 |  0   2   3   0   0  0   1   0   0  0   0   0   0   0   0   0   0   0   0   0   0  0 |  *  * 120   *   *  *  *  *   *   *  *   *  *   *   *   *  *   *  *   *   *  * | 0  1  0  0  1  0  0   0  0
xx(..).. ..(..).. oo(..)..3ox(..).. ..(..)..&#x  &   2   6  0 |  1   6   3   6   0   0  0   0 |  0   3   6   0   3   2   0   0   0   0   0   0   0   0   0 |  0   0   3   2   0  0   0   1   0  0   0   0   0   0   0   0   0   0   0   0   0  0 |  *  *   * 120   *  *  *  *   *   *  *   *  *   *   *   *  *   *  *   *   *  * | 0  0  1  0  1  0  0   0  0
xx(..).. ..(..).. ..(..).. ox(..)..3oo(..)..&#x  &   2   6  0 |  1   6   3   6   0   0  0   0 |  0   3   6   0   3   0   2   0   0   0   0   0   0   0   0 |  0   0   3   0   2  0   0   0   1  0   0   0   0   0   0   0   0   0   0   0   0  0 |  *  *   *   * 120  *  *  *   *   *  *   *  *   *   *   *  *   *  *   *   *  * | 0  1  1  0  0  0  0   0  0
..(..).. oo(..)..3oo(..)..3ox(..).. ..(..)..&#x  &   1   4  0 |  0   4   0   6   0   0  0   0 |  0   0   6   0   0   4   0   0   0   0   0   0   0   0   0 |  0   0   0   4   0  0   0   0   0  1   0   0   0   0   0   0   0   0   0   0   0  0 |  *  *   *   *   * 60  *  *   *   *  *   *  *   *   *   *  *   *  *   *   *  * | 0  0  0  1  1  0  0   0  0
..(..).. ..(..).. oo(o.)..3ox(o.)..3oo(o.)..&#xt &   1   6  1 |  0   6   0  12   6   0  0   0 |  0   0  12   0   0   4   4   0   0  12   0   0   0   0   0 |  0   0   0   4   4  0   0   0   0  0   0   0   0   4   4   0   0   0   0   0   0  0 |  *  *   *   *   *  * 60  *   *   *  *   *  *   *   *   *  *   *  *   *   *  * | 0  0  1  1  0  0  0   0  0
.x(..)..3.o(..).. ..(..).. .x(..)..3.o(..)..     &   0   9  0 |  0   0   9   9   0   0  0   0 |  0   0   0   3   9   0   3   0   0   0   0   0   0   0   0 |  0   0   0   0   0  0   3   0   3  0   0   0   0   0   0   0   0   0   0   0   0  0 |  *  *   *   *   *  *  * 40   *   *  *   *  *   *   *   *  *   *  *   *   *  * | 0  1  0  0  0  0  1   0  0
.x(x.).. ..(..).. .o(o.)..3.x(o.).. ..(..)..&#x  &   0   6  2 |  0   0   3   6   6   0  1   0 |  0   0   0   0   3   2   0   3   0   6   0   0   0   0   0 |  0   0   0   0   0  0   0   1   0  0   3   0   0   2   0   0   0   0   0   0   0  0 |  *  *   *   *   *  *  *  * 120   *  *   *  *   *   *   *  *   *  *   *   *  * | 0  0  1  0  0  0  0   1  0
.x(x.).. ..(..).. ..(..).. .x(o.)..3.o(o.)..&#x  &   0   6  2 |  0   0   3   6   6   0  1   0 |  0   0   0   0   3   0   2   3   0   6   0   0   0   0   0 |  0   0   0   0   0  0   0   0   1  0   3   0   0   0   2   0   0   0   0   0   0  0 |  *  *   *   *   *  *  *  *   * 120  *   *  *   *   *   *  *   *  *   *   *  * | 0  0  1  0  0  0  1   0  0
..(..).. .o(x.)..3.o(o.)..3.x(o.).. ..(..)..&#x  &   0   4  4 |  0   0   0   6  12   0  0   6 |  0   0   0   0   0   4   0   0  12  12   0   0   0   0   4 |  0   0   0   0   0  0   0   0   0  1   0   4   6   4   0   0   0   0   0   0   0  1 |  *  *   *   *   *  *  *  *   *   * 60   *  *   *   *   *  *   *  *   *   *  * | 0  0  0  1  0  0  0   0  1
..(..).. .o(x.).. ..(..).. .x(o.)..3.o(o.)..&#x  &   0   3  2 |  0   0   0   3   6   0  0   1 |  0   0   0   0   0   0   1   0   3   6   0   0   0   0   0 |  0   0   0   0   0  0   0   0   0  0   0   0   3   0   2   0   0   0   0   0   0  0 |  *  *   *   *   *  *  *  *   *   *  * 120  *   *   *   *  *   *  *   *   *  * | 0  0  0  1  0  0  1   0  0
.x(.o)..3.o(.o)..3.o(.o).. ..(..).. ..(..)..&#x  &   0   4  1 |  0   0   6   0   0   4  0   0 |  0   0   0   4   0   0   0   0   0   0   6   0   0   0   0 |  0   0   0   0   0  1   0   0   0  0   0   0   0   0   0   4   0   0   0   0   0  0 |  *  *   *   *   *  *  *  *   *   *  *   * 60   *   *   *  *   *  *   *   *  * | 0  0  0  0  1  1  0   0  0
.x(.o)..3.o(.o).. ..(..).. .x(.x).. ..(..)..&#x  &   0   6  2 |  0   0   6   3   0   6  0   1 |  0   0   0   2   3   0   0   0   0   0   6   3   0   0   0 |  0   0   0   0   0  0   1   0   0  0   0   0   0   0   0   2   3   0   0   0   0  0 |  *  *   *   *   *  *  *  *   *   *  *   *  * 120   *   *  *   *  *   *   *  * | 0  0  0  0  1  0  1   0  0
.x(.o)..3.o(.o).. ..(..).. ..(..).. .o(.x)..&#x  &   0   3  2 |  0   0   3   0   0   6  0   1 |  0   0   0   1   0   0   0   0   0   0   6   0   3   0   0 |  0   0   0   0   0  0   0   0   0  0   0   0   0   0   0   2   0   3   0   0   0  0 |  *  *   *   *   *  *  *  *   *   *  *   *  *   * 120   *  *   *  *   *   *  * | 0  0  0  0  0  1  1   0  0
.x(.o).. ..(..).. .o(.o)..3.x(.x).. ..(..)..&#x  &   0   6  3 |  0   0   3   6   0   6  0   3 |  0   0   0   0   3   2   0   0   0   0   3   6   0   0   1 |  0   0   0   0   0  0   0   1   0  0   0   0   0   0   0   0   3   0   2   0   0  0 |  *  *   *   *   *  *  *  *   *   *  *   *  *   *   * 120  *   *  *   *   *  * | 0  0  0  0  1  0  0   1  0
..(..).. .o(.o)..3.o(.o)..3.x(.x).. ..(..)..&#x  &   0   4  4 |  0   0   0   6   0   4  0   6 |  0   0   0   0   0   4   0   0   0   0   0   6   0   0   4 |  0   0   0   0   0  0   0   0   0  1   0   0   0   0   0   0   0   0   4   0   0  1 |  *  *   *   *   *  *  *  *   *   *  *   *  *   *   *   * 60   *  *   *   *  * | 0  0  0  0  1  0  0   0  1
.xxoo.   ......   ......   .xoox.   ......  &#xr &   0   5  4 |  0   0   2   2   6   6  1   1 |  0   0   0   0   1   0   0   2   1   2   2   2   1   4   0 |  0   0   0   0   0  0   0   0   0  0   1   0   0   0   0   0   1   0   0   2   2  0 |  *  *   *   *   *  *  *  *   *   *  *   *  *   *   *   *  * 360  *   *   *  * | 0  0  0  0  0  0  1   1  0
.xxoo.   ......   ......   ......   .ooxx.  &#xr     0   4  4 |  0   0   2   0   4   8  2   0 |  0   0   0   0   0   0   0   2   0   0   4   0   4   4   0 |  0   0   0   0   0  0   0   0   0  0   0   0   0   0   0   0   0   2   0   4   0  0 |  *  *   *   *   *  *  *  *   *   *  *   *  *   *   *   *  *   * 90   *   *  * | 0  0  0  0  0  0  2   0  0
......   .oxxo.  3.oooo.   ......   ......  &#xr &   0   4  4 |  0   0   0   3   6   4  0   3 |  0   0   0   0   0   1   0   0   3   3   0   3   0   3   1 |  0   0   0   0   0  0   0   0   0  0   0   1   0   1   0   0   0   0   1   0   3  0 |  *  *   *   *   *  *  *  *   *   *  *   *  *   *   *   *  *   *  * 240   *  * | 0  0  0  0  0  0  0   1  1
......   .oxxo.   ......   .xoox.   ......  &#xr     0   4  4 |  0   0   0   2   8   4  0   2 |  0   0   0   0   0   0   0   0   4   4   0   2   0   4   0 |  0   0   0   0   0  0   0   0   0  0   0   0   2   0   0   0   0   0   0   0   4  0 |  *  *   *   *   *  *  *  *   *   *  *   *  *   *   *   *  *   *  *   * 180  * | 0  0  0  0  0  0  1   0  1
..(..).. ..(x.)..3..(o.)..3..(o.)..3..(o.)..     &   0   0  5 |  0   0   0   0   0   0  0  10 |  0   0   0   0   0   0   0   0   0   0   0   0   0   0  10 |  0   0   0   0   0  0   0   0   0  0   0   0   0   0   0   0   0   0   0   0   0  5 |  *  *   *   *   *  *  *  *   *   *  *   *  *   *   *   *  *   *  *   *   * 12 | 0  0  0  1  1  0  0   0  0
---------------------------------------------------+-----------+-------------------------------+------------------------------------------------------------+-------------------------------------------------------------------------------------+-------------------------------------------------------------------------------+---------------------------
x.(..)..3o.(..)..3o.(..)..3o.(..)..3o.(..)..     &   6   0  0 | 15   0   0   0   0   0  0   0 | 20   0   0   0   0   0   0   0   0   0   0   0   0   0   0 | 15   0   0   0   0  0   0   0   0  0   0   0   0   0   0   0   0   0   0   0   0  0 |  6  0   0   0   0  0  0  0   0   0  0   0  0   0   0   0  0   0  0   0   0  0 | 2  *  *  *  *  *  *   *  *
xx(..)..3oo(..).. ..(..).. ox(..)..3oo(..)..&#x  &   3   9  0 |  3   9   9   9   0   0  0   0 |  1   9   9   3   9   0   3   0   0   0   0   0   0   0   0 |  0   3   9   0   3  0   3   0   3  0   0   0   0   0   0   0   0   0   0   0   0  0 |  0  0   3   0   3  0  0  1   0   0  0   0  0   0   0   0  0   0  0   0   0  0 | * 40  *  *  *  *  *   *  *
xx(x.).. ..(..).. oo(o.)..3ox(o.)..3oo(o.)..&#xt &   2  12  2 |  1  12   6  24  12   0  1   0 |  0   6  24   0  12   8   8   6   0  24   0   0   0   0   0 |  0   0  12   8   8  0   0   4   4  0  12   0   0   8   8   0   0   0   0   0   0  0 |  0  0   0   4   4  0  2  0   4   4  0   0  0   0   0   0  0   0  0   0   0  0 | *  * 30  *  *  *  *   *  *
..(..).. oo(x.)..3oo(o.)..3ox(o.)..3oo(o.)..&#xt &   1  10  5 |  0  10   0  30  30   0  0  10 |  0   0  30   0   0  20  10   0  30  60   0   0   0   0  10 |  0   0   0  20  10  0   0   0   0  5   0  10  30  20  20   0   0   0   0   0   0  5 |  0  0   0   0   0  5  5  0   0   0  5  10  0   0   0   0  0   0  0   0   0  1 | *  *  * 12  *  *  *   *  *
xx(.o)..3oo(.o)..3oo(.o)..3ox(.x).. ..(..)..&#xt &   5  20  5 | 10  20  30  30   0  20  0  10 | 10  30  30  20  30  20   0   0   0   0  30  30   0   0  10 |  5  20  30  20   0  5  10  10   0  5   0   0   0   0   0  20  30   0  20   0   0  5 |  1  5  10  10   0  5  0  0   0   0  0   0  5  10   0  10  5   0  0   0   0  1 | *  *  *  * 12  *  *   *  *
.x(.o)..3.o(.o)..3.o(.o).. ..(..).. .o(.x)..&#x  &   0   4  2 |  0   0   6   0   0   8  1   0 |  0   0   0   4   0   0   0   0   0   0  12   0   4   0   0 |  0   0   0   0   0  1   0   0   0  0   0   0   0   0   0   8   0   6   0   0   0  0 |  0  0   0   0   0  0  0  0   0   0  0   0  2   0   4   0  0   0  0   0   0  0 | *  *  *  *  * 30  *   *  *
.x(xo)o.3.o(xo)x. ..(..).. .x(ox)o.3.o(ox)x.&#xt     0  18 12 |  0   0  18  18  36  36  6   6 |  0   0   0   6  18   0   6  18  18  36  36  18  18  36   0 |  0   0   0   0   0  0   6   0   6  0  18   0  18   0  12  12  18  18   0  36  36  0 |  0  0   0   0   0  0  0  2   0   6  0   6  0   6   6   0  0  18  9   0   9  0 | *  *  *  *  *  * 20   *  *
.xxoo.   ......   .oooo.  3.xoox.   ......  &#xr &   0   7  5 |  0   0   3   6   9   8  1   3 |  0   0   0   0   3   2   0   3   3   6   3   6   1   6   1 |  0   0   0   0   0  0   0   1   0  0   3   1   0   2   0   0   3   0   2   3   6  0 |  0  0   0   0   0  0  0  0   1   0  0   0  0   0   0   1  0   3  0   2   0  0 | *  *  *  *  *  *  * 120  *
......   .oxxo.  3.oooo.  3.xoox.   ......  &#xr     0   8  8 |  0   0   0  12  24   8  0  12 |  0   0   0   0   0   8   0   0  24  24   0  12   0  12   8 |  0   0   0   0   0  0   0   0   0  2   0   8  12   8   0   0   0   0   8   0  24  2 |  0  0   0   0   0  0  0  0   0   0  2   0  0   0   0   0  2   0  0   8   6  0 | *  *  *  *  *  *  *   * 30

x(xo)(ou)x3o(oo)(oo)o3o(xo)(xo)o3o(oo)(oo)o3x(ou)(xo)x&#xt   → all heights = 1/sqrt(3) = 0.577350
(scad || (sarx + dual u-hix) || (inv. sarx + u-hix) || scad)

o(..)(..).3o(..)(..).3o(..)(..).3o(..)(..).3o(..)(..).     & | 60   *  * |   4   4   6  1   0   0   0   0 |   6  12   6  12  12  12   6   4  0   0   0   0   0   0   0 |  4  12  12  4   6  12  24   4   4  12   6  12  12   6   0  0   0   0   0   0   0   0 |  1  4  6  4  1  12   4  12  12   4  4   6  12   4   4  1  4  0   0   0  0  0 | 1  6  4  4   4  1  1  1  0
.(o.)(..).3.(o.)(..).3.(o.)(..).3.(o.)(..).3.(o.)(..).     & |  * 120  * |   0   0   3  0   2   6   3   1 |   0   0   0   6  12   3   6   0  1   6   3   6   9  12   6 |  0   0   0  0   3  12   6   6   6   6   1   9  24   0   6  2   4  18   6  12   3   6 |  0  0  0  0  0   3   6   6   2   3  2   4  18  12  12  3  0  2   5   9  6  2 | 0  1  2  5   9  3  1  0  1
.(.o)(..).3.(.o)(..).3.(.o)(..).3.(.o)(..).3.(.o)(..).     & |  *   * 12 |   0   0   0  5   0   0   0  10 |   0   0   0   0   0   0  30  10  0   0   0   0   0   0  30 |  0   0   0  0   0   0   0   0   0   0   0  30  60  10   0  0   0   0   0   0  10  20 |  0  0  0  0  0   0   0   0   0   0  0  10  30  20  20  5  5  0   0   0  0  5 | 0  0  0  5  10  5  1  1  0
-------------------------------------------------------------+-----------+--------------------------------+------------------------------------------------------------+--------------------------------------------------------------------------------------+------------------------------------------------------------------------------+---------------------------
x(..)(..). .(..)(..). .(..)(..). .(..)(..). .(..)(..).     & |  2   0  0 | 120   *   *  *   *   *   *   * |   3   3   0   3   0   0   0   1  0   0   0   0   0   0   0 |  3   6   3  0   3   3   6   0   0   0   0   3   0   3   0  0   0   0   0   0   0   0 |  1  3  3  1  0   6   1   3   3   0  0   3   3   0   0  0  3  0   0   0  0  0 | 1  3  1  3   1  0  0  1  0
.(..)(..). .(..)(..). .(..)(..). .(..)(..). x(..)(..).     & |  2   0  0 |   * 120   *  *   *   *   *   * |   0   3   3   0   0   3   0   0  0   0   0   0   0   0   0 |  0   3   6  3   0   0   6   0   0   3   3   0   0   0   0  0   0   0   0   0   0   0 |  0  1  3  3  1   3   0   3   6   1  3   0   0   0   0  0  0  0   0   0  0  0 | 1  3  3  1   0  0  1  0  0
o(o.)(..).3o(o.)(..).3o(o.)(..).3o(o.)(..).3o(o.)(..).&#x  & |  1   1  0 |   *   * 360  *   *   *   *   * |   0   0   0   2   4   2   1   0  0   0   0   0   0   0   0 |  0   0   0  0   1   4   4   2   2   4   1   2   4   0   0  0   0   0   0   0   0   0 |  0  0  0  0  0   2   2   4   2   2  2   1   4   2   2  1  0  0   0   0  0  0 | 0  1  2  2   2  1  1  0  0
o(.o)(..).3o(.o)(..).3o(.o)(..).3o(.o)(..).3o(.o)(..).&#x  & |  1   0  1 |   *   *   * 60   *   *   *   * |   0   0   0   0   0   0   6   4  0   0   0   0   0   0   0 |  0   0   0  0   0   0   0   0   0   0   0  12  12   6   0  0   0   0   0   0   0   0 |  0  0  0  0  0   0   0   0   0   0  0   6  12   4   4  0  4  0   0   0  0  0 | 0  0  0  4  12  1  0  1  0
.(x.)(..). .(..)(..). .(..)(..). .(..)(..). .(..)(..).     & |  0   2  0 |   *   *   *  * 120   *   *   * |   0   0   0   3   0   0   0   0  1   3   0   0   3   0   3 |  0   0   0  0   3   6   2   0   0   0   0   3   0   0   3  0   3   6   3   0   0   0 |  0  0  0  0  0   3   3   3   1   0  0   3   6   0   0  0  0  1   4   3  3  0 | 0  1  1  3   3  0  0  0  1
.(..)(..). .(..)(..). .(x.)(..). .(..)(..). .(..)(..).     & |  0   2  0 |   *   *   *  *   * 360   *   * |   0   0   0   0   2   0   0   0  0   1   1   2   0   2   0 |  0   0   0  0   0   2   0   2   2   1   0   0   4   0   2  1   0   3   0   4   1   2 |  0  0  0  0  0   0   2   1   0   1  1   0   3   4   4  2  0  1   0   3  1  1 | 0  0  1  2   3  2  1  0  0
.(o.)(o.).3.(o.)(o.).3.(o.)(o.).3.(o.)(o.).3.(o.)(o.).&#x    |  0   2  0 |   *   *   *  *   *   * 180   * |   0   0   0   0   0   0   2   0  0   0   0   0   4   4   0 |  0   0   0  0   0   0   0   0   0   0   0   4   8   0   0  0   2   8   4   4   0   0 |  0  0  0  0  0   0   0   0   0   0  0   2   8   4   4  0  0  0   4   4  4  0 | 0  0  0  4   4  1  0  0  1
.(o.)(.o).3.(o.)(.o).3.(o.)(.o).3.(o.)(.o).3.(o.)(.o).&#x  & |  0   1  1 |   *   *   *  *   *   *   * 120 |   0   0   0   0   0   0   3   0  0   0   0   0   0   0   6 |  0   0   0  0   0   0   0   0   0   0   0   3  12   0   0  0   0   0   0   0   3   6 |  0  0  0  0  0   0   0   0   0   0  0   1   6   6   6  3  0  0   0   0  0  2 | 0  0  0  2   3  3  1  0  0
-------------------------------------------------------------+-----------+--------------------------------+------------------------------------------------------------+--------------------------------------------------------------------------------------+------------------------------------------------------------------------------+---------------------------
x(..)(..).3o(..)(..). .(..)(..). .(..)(..). .(..)(..).     & |  3   0  0 |   3   0   0  0   0   0   0   0 | 120   *   *   *   *   *   *   *  *   *   *   *   *   *   * |  2   2   0  0   1   0   0   0   0   0   0   0   0   1   0  0   0   0   0   0   0   0 |  1  2  1  0  0   2   0   0   0   0  0   1   0   0   0  0  2  0   0   0  0  0 | 1  1  0  2   0  0  0  1  0
x(..)(..). .(..)(..). .(..)(..). .(..)(..). x(..)(..).     & |  4   0  0 |   2   2   0  0   0   0   0   0 |   * 180   *   *   *   *   *   *  *   *   *   *   *   *   * |  0   2   2  0   0   0   2   0   0   0   0   0   0   0   0  0   0   0   0   0   0   0 |  0  1  2  1  0   2   0   1   2   0  0   0   0   0   0  0  0  0   0   0  0  0 | 1  2  1  1   0  0  0  0  0
.(..)(..). .(..)(..). .(..)(..). o(..)(..).3x(..)(..).     & |  3   0  0 |   0   3   0  0   0   0   0   0 |   *   * 120   *   *   *   *   *  *   *   *   *   *   *   * |  0   0   2  2   0   0   0   0   0   0   1   0   0   0   0  0   0   0   0   0   0   0 |  0  0  1  2  1   0   0   0   2   0  2   0   0   0   0  0  0  0   0   0  0  0 | 1  1  2  0   0  0  1  0  0
x(x.)(..). .(..)(..). .(..)(..). .(..)(..). .(..)(..).&#x  & |  2   2  0 |   1   0   2  0   1   0   0   0 |   *   *   * 360   *   *   *   *  *   *   *   *   *   *   * |  0   0   0  0   1   2   2   0   0   0   0   1   0   0   0  0   0   0   0   0   0   0 |  0  0  0  0  0   2   1   2   1   0  0   1   2   0   0  0  0  0   0   0  0  0 | 0  1  1  2   1  0  0  0  0
.(..)(..). .(..)(..). o(x.)(..). .(..)(..). .(..)(..).&#x  & |  1   2  0 |   0   0   2  0   0   1   0   0 |   *   *   *   * 720   *   *   *  *   *   *   *   *   *   * |  0   0   0  0   0   1   0   1   1   1   0   0   1   0   0  0   0   0   0   0   0   0 |  0  0  0  0  0   0   1   1   0   1  1   0   1   1   1  1  0  0   0   0  0  0 | 0  0  1  1   1  1  1  0  0
.(..)(..). .(..)(..). .(..)(..). .(..)(..). x(o.)(..).&#x  & |  2   1  0 |   0   1   2  0   0   0   0   0 |   *   *   *   *   * 360   *   *  *   *   *   *   *   *   * |  0   0   0  0   0   0   2   0   0   2   1   0   0   0   0  0   0   0   0   0   0   0 |  0  0  0  0  0   1   0   2   2   1  2   0   0   0   0  0  0  0   0   0  0  0 | 0  1  2  1   0  0  1  0  0
o(oo)(o.).3o(oo)(o.).3o(oo)(o.).3o(oo)(o.).3o(oo)(o.).&#xt & |  1   2  1 |   0   0   1  1   0   0   1   1 |   *   *   *   *   *   * 360   *  *   *   *   *   *   *   * |  0   0   0  0   0   0   0   0   0   0   0   2   4   0   0  0   0   0   0   0   0   0 |  0  0  0  0  0   0   0   0   0   0  0   1   4   2   2  0  0  0   0   0  0  0 | 0  0  0  2   2  1  0  0  0
x(.o)(..). .(..)(..). .(..)(..). .(..)(..). .(..)(..).&#x  & |  2   0  1 |   1   0   0  2   0   0   0   0 |   *   *   *   *   *   *   * 120  *   *   *   *   *   *   * |  0   0   0  0   0   0   0   0   0   0   0   3   0   3   0  0   0   0   0   0   0   0 |  0  0  0  0  0   0   0   0   0   0  0   3   3   0   0  0  3  0   0   0  0  0 | 0  0  0  3   1  0  0  1  0
.(x.)(..).3.(o.)(..). .(..)(..). .(..)(..). .(..)(..).     & |  0   3  0 |   0   0   0  0   3   0   0   0 |   *   *   *   *   *   *   *   * 40   *   *   *   *   *   * |  0   0   0  0   3   0   0   0   0   0   0   0   0   0   0  0   3   0   0   0   0   0 |  0  0  0  0  0   3   0   0   0   0  0   3   0   0   0  0  0  0   3   0  0  0 | 0  1  0  3   0  0  0  0  1
.(x.)(..). .(..)(..). .(x.)(..). .(..)(..). .(..)(..).     & |  0   4  0 |   0   0   0  0   2   2   0   0 |   *   *   *   *   *   *   *   *  * 180   *   *   *   *   * |  0   0   0  0   0   2   0   0   0   0   0   0   0   0   2  0   0   2   0   0   0   0 |  0  0  0  0  0   0   2   1   0   0  0   0   2   0   0  0  0  1   0   2  1  0 | 0  0  1  2   2  0  0  0  0
.(..)(..). .(o.)(..).3.(x.)(..). .(..)(..). .(..)(..).     & |  0   3  0 |   0   0   0  0   0   3   0   0 |   *   *   *   *   *   *   *   *  *   * 120   *   *   *   * |  0   0   0  0   0   0   0   2   0   0   0   0   0   0   0  0   0   0   0   2   1   0 |  0  0  0  0  0   0   0   0   0   1  0   0   0   2   2  2  0  0   0   1  0  0 | 0  0  0  1   1  2  1  0  0
.(..)(..). .(..)(..). .(x.)(..).3.(o.)(..). .(..)(..).     & |  0   3  0 |   0   0   0  0   0   3   0   0 |   *   *   *   *   *   *   *   *  *   *   * 240   *   *   * |  0   0   0  0   0   0   0   0   1   0   0   0   0   0   1  1   0   0   0   1   0   1 |  0  0  0  0  0   0   1   0   0   0  1   0   0   1   1  1  0  1   0   1  0  1 | 0  0  1  1   1  1  1  0  0
.(x.)(o.). .(..)(..). .(..)(..). .(..)(..). .(..)(..).&#x  & |  0   3  0 |   0   0   0  0   1   0   2   0 |   *   *   *   *   *   *   *   *  *   *   *   * 360   *   * |  0   0   0  0   0   0   0   0   0   0   0   1   0   0   0  0   1   2   2   0   0   0 |  0  0  0  0  0   0   0   0   0   0  0   1   2   0   0  0  0  0   3   1  2  0 | 0  0  0  3   1  0  0  0  1
.(..)(..). .(..)(..). .(x.)(x.). .(..)(..). .(..)(..).&#x    |  0   4  0 |   0   0   0  0   0   2   2   0 |   *   *   *   *   *   *   *   *  *   *   *   *   * 360   * |  0   0   0  0   0   0   0   0   0   0   0   0   2   0   0  0   0   2   0   2   0   0 |  0  0  0  0  0   0   0   0   0   0  0   0   2   2   2  0  0  0   0   2  1  0 | 0  0  0  2   2  1  0  0  0
.(..)(..). .(..)(..). .(x.)(.o). .(..)(..). .(..)(..).&#x  & |  0   2  1 |   0   0   0  0   1   0   0   2 |   *   *   *   *   *   *   *   *  *   *   *   *   *   * 360 |  0   0   0  0   0   0   0   0   0   0   0   0   2   0   0  0   0   0   0   0   1   2 |  0  0  0  0  0   0   0   0   0   0  0   0   1   2   2  2  0  0   0   0  0  1 | 0  0  0  1   1  2  1  0  0
-------------------------------------------------------------+-----------+--------------------------------+------------------------------------------------------------+--------------------------------------------------------------------------------------+------------------------------------------------------------------------------+---------------------------
x(..)(..).3o(..)(..).3o(..)(..). .(..)(..). .(..)(..).     &   4   0  0 |   6   0   0  0   0   0   0   0 |   4   0   0   0   0   0   0   0  0   0   0   0   0   0   0 | 60   *   *  *   *   *   *   *   *   *   *   *   *   *   *  *   *   *   *   *   *   * |  1  1  0  0  0   0   0   0   0   0  0   0   0   0   0  0  1  0   0   0  0  0 | 1  0  0  1   0  0  0  1  0
x(..)(..).3o(..)(..). .(..)(..). .(..)(..). x(..)(..).     &   6   0  0 |   6   3   0  0   0   0   0   0 |   2   3   0   0   0   0   0   0  0   0   0   0   0   0   0 |  * 120   *  *   *   *   *   *   *   *   *   *   *   *   *  *   *   *   *   *   *   * |  0  1  1  0  0   1   0   0   0   0  0   0   0   0   0  0  0  0   0   0  0  0 | 1  1  0  1   0  0  0  0  0
x(..)(..). .(..)(..). .(..)(..). o(..)(..).3x(..)(..).     &   6   0  0 |   3   6   0  0   0   0   0   0 |   0   3   2   0   0   0   0   0  0   0   0   0   0   0   0 |  *   * 120  *   *   *   *   *   *   *   *   *   *   *   *  *   *   *   *   *   *   * |  0  0  1  1  0   0   0   0   1   0  0   0   0   0   0  0  0  0   0   0  0  0 | 1  1  1  0   0  0  0  0  0
.(..)(..). .(..)(..). o(..)(..).3o(..)(..).3x(..)(..).     &   4   0  0 |   0   6   0  0   0   0   0   0 |   0   0   4   0   0   0   0   0  0   0   0   0   0   0   0 |  *   *   * 60   *   *   *   *   *   *   *   *   *   *   *  *   *   *   *   *   *   * |  0  0  0  1  1   0   0   0   0   0  1   0   0   0   0  0  0  0   0   0  0  0 | 1  0  1  0   0  0  1  0  0
x(x.)(..).3o(o.)(..). .(..)(..). .(..)(..). .(..)(..).&#x  &   3   3  0 |   3   0   3  0   3   0   0   0 |   1   0   0   3   0   0   0   0  1   0   0   0   0   0   0 |  *   *   *  * 120   *   *   *   *   *   *   *   *   *   *  *   *   *   *   *   *   * |  0  0  0  0  0   2   0   0   0   0  0   1   0   0   0  0  0  0   0   0  0  0 | 0  1  0  2   0  0  0  0  0
x(x.)(..). .(..)(..). o(x.)(..). .(..)(..). .(..)(..).&#x  &   2   4  0 |   1   0   4  0   2   2   0   0 |   0   0   0   2   2   0   0   0  0   1   0   0   0   0   0 |  *   *   *  *   * 360   *   *   *   *   *   *   *   *   *  *   *   *   *   *   *   * |  0  0  0  0  0   0   1   1   0   0  0   0   1   0   0  0  0  0   0   0  0  0 | 0  0  1  1   1  0  0  0  0
x(x.)(..). .(..)(..). .(..)(..). .(..)(..). x(o.)(..).&#x  &   4   2  0 |   2   2   4  0   1   0   0   0 |   0   1   0   2   0   2   0   0  0   0   0   0   0   0   0 |  *   *   *  *   *   * 360   *   *   *   *   *   *   *   *  *   *   *   *   *   *   * |  0  0  0  0  0   1   0   1   1   0  0   0   0   0   0  0  0  0   0   0  0  0 | 0  1  1  1   0  0  0  0  0
.(..)(..). o(o.)(..).3o(x.)(..). .(..)(..). .(..)(..).&#x  &   1   3  0 |   0   0   3  0   0   3   0   0 |   0   0   0   0   3   0   0   0  0   0   1   0   0   0   0 |  *   *   *  *   *   *   * 240   *   *   *   *   *   *   *  *   *   *   *   *   *   * |  0  0  0  0  0   0   0   0   0   1  0   0   0   1   0  1  0  0   0   0  0  0 | 0  0  0  1   0  1  1  0  0
.(..)(..). .(..)(..). o(x.)(..).3o(o.)(..). .(..)(..).&#x  &   1   3  0 |   0   0   3  0   0   3   0   0 |   0   0   0   0   3   0   0   0  0   0   0   1   0   0   0 |  *   *   *  *   *   *   *   * 240   *   *   *   *   *   *  *   *   *   *   *   *   * |  0  0  0  0  0   0   1   0   0   0  1   0   0   0   1  1  0  0   0   0  0  0 | 0  0  1  0   1  1  1  0  0
.(..)(..). .(..)(..). o(x.)(..). .(..)(..). x(o.)(..).&#x  &   2   2  0 |   0   1   4  0   0   1   0   0 |   0   0   0   0   2   2   0   0  0   0   0   0   0   0   0 |  *   *   *  *   *   *   *   *   * 360   *   *   *   *   *  *   *   *   *   *   *   * |  0  0  0  0  0   0   0   1   0   1  1   0   0   0   0  0  0  0   0   0  0  0 | 0  0  1  1   0  0  1  0  0
.(..)(..). .(..)(..). .(..)(..). o(o.)(..).3x(o.)(..).&#x  &   3   1  0 |   0   3   3  0   0   0   0   0 |   0   0   1   0   0   3   0   0  0   0   0   0   0   0   0 |  *   *   *  *   *   *   *   *   *   * 120   *   *   *   *  *   *   *   *   *   *   * |  0  0  0  0  0   0   0   0   2   0  2   0   0   0   0  0  0  0   0   0  0  0 | 0  1  2  0   0  0  1  0  0
x(xo)(o.). .(..)(..). .(..)(..). .(..)(..). .(..)(..).&#xt &   2   3  1 |   1   0   2  2   1   0   2   1 |   0   0   0   1   0   0   2   1  0   0   0   0   1   0   0 |  *   *   *  *   *   *   *   *   *   *   * 360   *   *   *  *   *   *   *   *   *   * |  0  0  0  0  0   0   0   0   0   0  0   1   2   0   0  0  0  0   0   0  0  0 | 0  0  0  2   1  0  0  0  0
.(..)(..). .(..)(..). o(xo)(x.). .(..)(..). .(..)(..).&#xt &   1   4  1 |   0   0   2  1   0   2   2   2 |   0   0   0   0   1   0   2   0  0   0   0   0   0   1   1 |  *   *   *  *   *   *   *   *   *   *   *   * 720   *   *  *   *   *   *   *   *   * |  0  0  0  0  0   0   0   0   0   0  0   0   1   1   1  0  0  0   0   0  0  0 | 0  0  0  1   1  1  0  0  0
x(.o)(..).3o(.o)(..). .(..)(..). .(..)(..). .(..)(..).&#x  &   3   0  1 |   3   0   0  3   0   0   0   0 |   1   0   0   0   0   0   0   3  0   0   0   0   0   0   0 |  *   *   *  *   *   *   *   *   *   *   *   *   * 120   *  *   *   *   *   *   *   * |  0  0  0  0  0   0   0   0   0   0  0   1   0   0   0  0  2  0   0   0  0  0 | 0  0  0  2   0  0  0  1  0
.(x.)(..). .(..)(..). .(x.)(..).3.(o.)(..). .(..)(..).     &   0   6  0 |   0   0   0  0   3   6   0   0 |   0   0   0   0   0   0   0   0  0   3   0   2   0   0   0 |  *   *   *  *   *   *   *   *   *   *   *   *   *   * 120  *   *   *   *   *   *   * |  0  0  0  0  0   0   1   0   0   0  0   0   0   0   0  0  0  1   0   1  0  1 | 0  0  1  1   1  0  0  0  0
.(..)(..). .(..)(..). .(x.)(..).3.(o.)(..).3.(o.)(..).     &   0   4  0 |   0   0   0  0   0   6   0   0 |   0   0   0   0   0   0   0   0  0   0   0   4   0   0   0 |  *   *   *  *   *   *   *   *   *   *   *   *   *   *   * 60   *   *   *   *   *   * |  0  0  0  0  0   0   0   0   0   0  1   0   0   0   0  0  0  1   0   0  0  1 | 0  0  1  1   0  0  1  0  0
.(x.)(o.).3.(o.)(o.). .(..)(..). .(..)(..). .(..)(..).&#x  &   0   4  0 |   0   0   0  0   3   0   3   0 |   0   0   0   0   0   0   0   0  1   0   0   0   3   0   0 |  *   *   *  *   *   *   *   *   *   *   *   *   *   *   *  * 120   *   *   *   *   * |  0  0  0  0  0   0   0   0   0   0  0   1   0   0   0  0  0  0   2   0  0  0 | 0  0  0  2   0  0  0  0  1
.(x.)(o.). .(..)(..). .(x.)(x.). .(..)(..). .(..)(..).&#x  &   0   6  0 |   0   0   0  0   2   3   4   0 |   0   0   0   0   0   0   0   0  0   1   0   0   2   2   0 |  *   *   *  *   *   *   *   *   *   *   *   *   *   *   *  *   * 360   *   *   *   * |  0  0  0  0  0   0   0   0   0   0  0   0   1   0   0  0  0  0   0   1  1  0 | 0  0  0  2   1  0  0  0  0
.(x.)(o.). .(..)(..). .(..)(..). .(..)(..). .(o.)(x.).&#x      0   4  0 |   0   0   0  0   2   0   4   0 |   0   0   0   0   0   0   0   0  0   0   0   0   4   0   0 |  *   *   *  *   *   *   *   *   *   *   *   *   *   *   *  *   *   * 180   *   *   * |  0  0  0  0  0   0   0   0   0   0  0   0   0   0   0  0  0  0   2   0  1  0 | 0  0  0  2   0  0  0  0  1
.(..)(..). .(o.)(o.).3.(x.)(x.). .(..)(..). .(..)(..).&#x  &   0   6  0 |   0   0   0  0   0   6   3   0 |   0   0   0   0   0   0   0   0  0   0   1   1   0   3   0 |  *   *   *  *   *   *   *   *   *   *   *   *   *   *   *  *   *   *   * 240   *   * |  0  0  0  0  0   0   0   0   0   0  0   0   0   1   1  0  0  0   0   1  0  0 | 0  0  0  1   1  1  0  0  0
.(..)(..). .(o.)(.o).3.(x.)(.o). .(..)(..). .(..)(..).&#x  &   0   3  1 |   0   0   0  0   0   3   0   3 |   0   0   0   0   0   0   0   0  0   0   1   0   0   0   3 |  *   *   *  *   *   *   *   *   *   *   *   *   *   *   *  *   *   *   *   * 120   * |  0  0  0  0  0   0   0   0   0   0  0   0   0   0   2  2  0  0   0   0  0  0 | 0  0  0  0   1  2  1  0  0
.(..)(..). .(..)(..). .(x.)(.o).3.(o.)(.o). .(..)(..).&#x  &   0   3  1 |   0   0   0  0   0   3   0   3 |   0   0   0   0   0   0   0   0  0   0   0   1   0   0   3 |  *   *   *  *   *   *   *   *   *   *   *   *   *   *   *  *   *   *   *   *   * 240 |  0  0  0  0  0   0   0   0   0   0  0   0   0   1   0  1  0  0   0   0  0  1 | 0  0  0  1   0  1  1  0  0
-------------------------------------------------------------+-----------+--------------------------------+------------------------------------------------------------+--------------------------------------------------------------------------------------+------------------------------------------------------------------------------+---------------------------
x(..)(..).3o(..)(..).3o(..)(..).3o(..)(..). .(..)(..).     &   5   0  0 |  10   0   0  0   0   0   0   0 |  10   0   0   0   0   0   0   0  0   0   0   0   0   0   0 |  5   0   0  0   0   0   0   0   0   0   0   0   0   0   0  0   0   0   0   0   0   0 | 12  *  *  *  *   *   *   *   *   *  *   *   *   *   *  *  *  *   *   *  *  * | 1  0  0  0   0  0  0  1  0
x(..)(..).3o(..)(..).3o(..)(..). .(..)(..). x(..)(..).     &   8   0  0 |  12   4   0  0   0   0   0   0 |   8   6   0   0   0   0   0   0  0   0   0   0   0   0   0 |  2   4   0  0   0   0   0   0   0   0   0   0   0   0   0  0   0   0   0   0   0   0 |  * 30  *  *  *   *   *   *   *   *  *   *   *   *   *  *  *  *   *   *  *  * | 1  0  0  1   0  0  0  0  0
x(..)(..).3o(..)(..). .(..)(..). o(..)(..).3x(..)(..).     &   9   0  0 |   9   9   0  0   0   0   0   0 |   3   9   3   0   0   0   0   0  0   0   0   0   0   0   0 |  0   3   3  0   0   0   0   0   0   0   0   0   0   0   0  0   0   0   0   0   0   0 |  *  * 40  *  *   *   *   *   *   *  *   *   *   *   *  *  *  *   *   *  *  * | 1  1  0  0   0  0  0  0  0
x(..)(..). .(..)(..). o(..)(..).3o(..)(..).3x(..)(..).     &   8   0  0 |   4  12   0  0   0   0   0   0 |   0   6   8   0   0   0   0   0  0   0   0   0   0   0   0 |  0   0   4  2   0   0   0   0   0   0   0   0   0   0   0  0   0   0   0   0   0   0 |  *  *  * 30  *   *   *   *   *   *  *   *   *   *   *  *  *  *   *   *  *  * | 1  0  1  0   0  0  0  0  0
.(..)(..). o(..)(..).3o(..)(..).3o(..)(..).3x(..)(..).     &   5   0  0 |   0  10   0  0   0   0   0   0 |   0   0  10   0   0   0   0   0  0   0   0   0   0   0   0 |  0   0   0  5   0   0   0   0   0   0   0   0   0   0   0  0   0   0   0   0   0   0 |  *  *  *  * 12   *   *   *   *   *  *   *   *   *   *  *  *  *   *   *  *  * | 1  0  0  0   0  0  1  0  0
x(x.)(..).3o(o.)(..). .(..)(..). .(..)(..). x(o.)(..).&#x  &   6   3  0 |   6   3   6  0   3   0   0   0 |   2   3   0   6   0   3   0   0  1   0   0   0   0   0   0 |  0   1   0  0   2   0   3   0   0   0   0   0   0   0   0  0   0   0   0   0   0   0 |  *  *  *  *  * 120   *   *   *   *  *   *   *   *   *  *  *  *   *   *  *  * | 0  1  0  1   0  0  0  0  0
x(x.)(..). .(..)(..). o(x.)(..).3o(o.)(..). .(..)(..).&#x  &   2   6  0 |   1   0   6  0   3   6   0   0 |   0   0   0   3   6   0   0   0  0   3   0   2   0   0   0 |  0   0   0  0   0   3   0   0   2   0   0   0   0   0   1  0   0   0   0   0   0   0 |  *  *  *  *  *   * 120   *   *   *  *   *   *   *   *  *  *  *   *   *  *  * | 0  0  1  0   1  0  0  0  0
x(x.)(..). .(..)(..). o(x.)(..). .(..)(..). x(o.)(..).&#x  &   4   4  0 |   2   2   8  0   2   2   0   0 |   0   1   0   4   4   4   0   0  0   1   0   0   0   0   0 |  0   0   0  0   0   2   2   0   0   2   0   0   0   0   0  0   0   0   0   0   0   0 |  *  *  *  *  *   *   * 180   *   *  *   *   *   *   *  *  *  *   *   *  *  * | 0  0  1  1   0  0  0  0  0
x(x.)(..). .(..)(..). .(..)(..). o(o.)(..).3x(o.)(..).&#x  &   6   2  0 |   3   6   6  0   1   0   0   0 |   0   3   2   3   0   6   0   0  0   0   0   0   0   0   0 |  0   0   1  0   0   0   3   0   0   0   2   0   0   0   0  0   0   0   0   0   0   0 |  *  *  *  *  *   *   *   * 120   *  *   *   *   *   *  *  *  *   *   *  *  * | 0  1  1  0   0  0  0  0  0
.(..)(..). o(o.)(..).3o(x.)(..). .(..)(..). x(o.)(..).&#x  &   2   3  0 |   0   1   6  0   0   3   0   0 |   0   0   0   0   6   3   0   0  0   0   1   0   0   0   0 |  0   0   0  0   0   0   0   2   0   3   0   0   0   0   0  0   0   0   0   0   0   0 |  *  *  *  *  *   *   *   *   * 120  *   *   *   *   *  *  *  *   *   *  *  * | 0  0  0  1   0  0  1  0  0
.(..)(..). .(..)(..). o(x.)(..).3o(o.)(..).3x(o.)(..).&#x  &   4   4  0 |   0   6  12  0   0   6   0   0 |   0   0   4   0  12  12   0   0  0   0   0   4   0   0   0 |  0   0   0  1   0   0   0   0   4   6   4   0   0   0   0  1   0   0   0   0   0   0 |  *  *  *  *  *   *   *   *   *   * 60   *   *   *   *  *  *  *   *   *  *  * | 0  0  1  0   0  0  1  0  0
x(xo)(o.).3o(oo)(o.). .(..)(..). .(..)(..). .(..)(..).&#xt &   3   4  1 |   3   0   3  3   3   0   3   1 |   1   0   0   3   0   0   3   3  1   0   0   0   3   0   0 |  0   0   0  0   1   0   0   0   0   0   0   3   0   1   0  0   1   0   0   0   0   0 |  *  *  *  *  *   *   *   *   *   *  * 120   *   *   *  *  *  *   *   *  *  * | 0  0  0  2   0  0  0  0  0
x(xo)(o.). .(..)(..). o(xo)(x.). .(..)(..). .(..)(..).&#xt &   2   6  1 |   1   0   4  2   2   3   4   2 |   0   0   0   2   2   0   4   1  0   1   0   0   2   2   1 |  0   0   0  0   0   1   0   0   0   0   0   2   2   0   0  0   0   1   0   0   0   0 |  *  *  *  *  *   *   *   *   *   *  *   * 360   *   *  *  *  *   *   *  *  * | 0  0  0  1   1  0  0  0  0
.(..)(..). o(oo)(o.).3o(xo)(x.). .(..)(..). .(..)(..).&#xt &   1   6  1 |   0   0   3  1   0   6   3   3 |   0   0   0   0   3   0   3   0  0   0   1   1   0   3   3 |  0   0   0  0   0   0   0   1   0   0   0   0   3   0   0  0   0   0   0   1   0   1 |  *  *  *  *  *   *   *   *   *   *  *   *   * 240   *  *  *  *   *   *  *  * | 0  0  0  1   0  1  0  0  0
.(..)(..). .(..)(..). o(xo)(x.).3o(oo)(o.). .(..)(..).&#xt &   1   6  1 |   0   0   3  1   0   6   3   3 |   0   0   0   0   3   0   3   0  0   0   1   1   0   3   3 |  0   0   0  0   0   0   0   0   1   0   0   0   3   0   0  0   0   0   0   1   1   0 |  *  *  *  *  *   *   *   *   *   *  *   *   *   * 240  *  *  *   *   *  *  * | 0  0  0  0   1  1  0  0  0
.(..)(..). o(o.)(.o).3o(x.)(.o).3o(o.)(.o). .(..)(..).&#xt &   1   6  1 |   0   0   6  0   0  12   0   6 |   0   0   0   0  12   0   0   0  0   0   4   4   0   0  12 |  0   0   0  0   0   0   0   4   4   0   0   0   0   0   0  0   0   0   0   0   4   4 |  *  *  *  *  *   *   *   *   *   *  *   *   *   *   * 60  *  *   *   *  *  * | 0  0  0  0   0  1  1  0  0
x(.o)(..).3o(.o)(..).3o(.o)(..). .(..)(..). .(..)(..).&#x  &   4   0  1 |   6   0   0  4   0   0   0   0 |   4   0   0   0   0   0   0   6  0   0   0   0   0   0   0 |  1   0   0  0   0   0   0   0   0   0   0   0   0   4   0  0   0   0   0   0   0   0 |  *  *  *  *  *   *   *   *   *   *  *   *   *   *   *  * 60  *   *   *  *  * | 0  0  0  1   0  0  0  1  0
.(x.)(..). .(..)(..). .(x.)(..).3.(o.)(..).3.(o.)(..).     &   0   8  0 |   0   0   0  0   4  12   0   0 |   0   0   0   0   0   0   0   0  0   6   0   8   0   0   0 |  0   0   0  0   0   0   0   0   0   0   0   0   0   0   4  2   0   0   0   0   0   0 |  *  *  *  *  *   *   *   *   *   *  *   *   *   *   *  *  * 30   *   *  *  * | 0  0  1  1   0  0  0  0  0
.(x.)(o.).3.(o.)(o.). .(..)(..). .(..)(..). .(o.)(x.).&#x  &   0   5  0 |   0   0   0  0   4   0   6   0 |   0   0   0   0   0   0   0   0  1   0   0   0   9   0   0 |  0   0   0  0   0   0   0   0   0   0   0   0   0   0   0  0   2   0   3   0   0   0 |  *  *  *  *  *   *   *   *   *   *  *   *   *   *   *  *  *  * 120   *  *  * | 0  0  0  1   0  0  0  0  1
.(x.)(o.). .(..)(..). .(x.)(x.).3.(o.)(o.). .(..)(..).&#x  &   0   9  0 |   0   0   0  0   3   9   6   0 |   0   0   0   0   0   0   0   0  0   3   1   2   3   6   0 |  0   0   0  0   0   0   0   0   0   0   0   0   0   0   1  0   0   3   0   2   0   0 |  *  *  *  *  *   *   *   *   *   *  *   *   *   *   *  *  *  *   * 120  *  * | 0  0  0  1   1  0  0  0  0
.(x.)(o.). .(..)(..). .(x.)(x.). .(..)(..). .(o.)(x.).&#x      0   8  0 |   0   0   0  0   4   4   8   0 |   0   0   0   0   0   0   0   0  0   2   0   0   8   4   0 |  0   0   0  0   0   0   0   0   0   0   0   0   0   0   0  0   0   4   2   0   0   0 |  *  *  *  *  *   *   *   *   *   *  *   *   *   *   *  *  *  *   *   * 90  * | 0  0  0  2   0  0  0  0  0
.(..)(..). .(..)(..). .(x.)(.o).3.(o.)(.o).3.(o.)(.o).&#x  &   0   4  1 |   0   0   0  0   0   6   0   4 |   0   0   0   0   0   0   0   0  0   0   0   4   0   0   6 |  0   0   0  0   0   0   0   0   0   0   0   0   0   0   0  1   0   0   0   0   0   4 |  *  *  *  *  *   *   *   *   *   *  *   *   *   *   *  *  *  *   *   *  * 60 | 0  0  0  1   0  0  1  0  0
-------------------------------------------------------------+-----------+--------------------------------+------------------------------------------------------------+--------------------------------------------------------------------------------------+------------------------------------------------------------------------------+---------------------------
x(..)(..).3o(..)(..).3o(..)(..).3o(..)(..).3x(..)(..).     &  30   0  0 |  60  60   0  0   0   0   0   0 |  60  90  60   0   0   0   0   0  0   0   0   0   0   0   0 | 30  60  60 30   0   0   0   0   0   0   0   0   0   0   0  0   0   0   0   0   0   0 |  6 15 20 15  6   0   0   0   0   0  0   0   0   0   0  0  0  0   0   0  0  0 | 2  *  *  *   *  *  *  *  *
x(x.)(..).3o(o.)(..). .(..)(..). o(o.)(..).3x(o.)(..).&#x  &   9   3  0 |   9   9   9  0   3   0   0   0 |   3   9   3   9   0   9   0   0  1   0   0   0   0   0   0 |  0   3   3  0   3   0   9   0   0   0   3   0   0   0   0  0   0   0   0   0   0   0 |  0  0  1  0  0   3   0   0   3   0  0   0   0   0   0  0  0  0   0   0  0  0 | * 40  *  *   *  *  *  *  *
x(x.)(..). .(..)(..). o(x.)(..).3o(o.)(..).3x(o.)(..).&#x  &   8   8  0 |   4  12  24  0   4  12   0   0 |   0   6   8  12  24  24   0   0  0   6   0   8   0   0   0 |  0   0   4  2   0  12  12   0   8  12   8   0   0   0   4  2   0   0   0   0   0   0 |  0  0  0  1  0   0   4   6   4   0  2   0   0   0   0  0  0  1   0   0  0  0 | *  * 30  *   *  *  *  *  *
x(xo)(o.).3o(oo)(o.).3o(xo)(x.). .(..)(..). x(ou)(x.).&#xt &   8  20  2 |  12   4  24  8  12  24  24   8 |   8   6   0  24  24  12  24  12  4  12   4   8  36  24  12 |  2   4   0  0   8  12  12   8   0  12   0  24  24   8   4  2   8  24  12   8   0   8 |  0  1  0  0  0   4   0   6   0   4  0   8  12   8   0  0  2  1   4   4  6  2 | *  *  * 30   *  *  *  *  *
x(xo)(o.). .(..)(..). o(xo)(x.).3o(oo)(o.). .(..)(..).&#xr &   2   9  1 |   1   0   6  6   3   9   6   3 |   0   0   0   3   6   0   6   1  0   3   1   2   3   6   3 |  0   0   0  0   0   3   0   0   2   0   0   3   6   0   1  0   0   3   0   2   1   0 |  0  0  0  0  0   0   1   0   0   0  0   0   3   0   2  0  0  0   0   1  0  0 | *  *  *  * 120  *  *  *  *
.(..)(..). o(oo)(oo)o3o(xo)(xo)o3o(oo)(oo)o .(..)(..).&#xt     2  12  2 |   0   0  12  2   0  24   6  12 |   0   0   0   0  24   0  12   0  0   0   8   8   0  12  24 |  0   0   0  0   0   0   0   8   8   0   0   0  24   0   0  0   0   0   0   8   8   8 |  0  0  0  0  0   0   0   0   0   0  0   0   0   8   8  2  0  0   0   0  0  0 | *  *  *  *   * 30  *  *  *  cycle (ABEFDC)
.(..)(..). o(o.)(.o).3o(x.)(.o).3o(o.)(.o).3x(o.)(.o).&#xt &   5  10  1 |   0  10  30  0   0  30   0  10 |   0   0  10   0  60  30   0   0  0   0  10  20   0   0  30 |  0   0   0  5   0   0   0  20  20  30  10   0   0   0   0  5   0   0   0   0  10  20 |  0  0  0  0  1   0   0   0   0  10  5   0   0   0   0  5  0  0   0   0  0  5 | *  *  *  *   *  * 12  *  *
x(.o)(..).3o(.o)(..).3o(.o)(..).3o(.o)(..). .(..)(..).&#x  &   5   0  1 |  10   0   0  5   0   0   0   0 |  10   0   0   0   0   0   0  10  0   0   0   0   0   0   0 |  5   0   0  0   0   0   0   0   0   0   0   0   0  10   0  0   0   0   0   0   0   0 |  1  0  0  0  0   0   0   0   0   0  0   0   0   0   0  0  5  0   0   0  0  0 | *  *  *  *   *  *  * 12  *
.(x.)(o.).3.(o.)(o.). .(..)(..). .(o.)(o.).3.(o.)(x.).&#x      0   6  0 |   0   0   0  0   6   0   9   0 |   0   0   0   0   0   0   0   0  2   0   0   0  18   0   0 |  0   0   0  0   0   0   0   0   0   0   0   0   0   0   0  0   6   0   9   0   0   0 |  0  0  0  0  0   0   0   0   0   0  0   0   0   0   0  0  0  0   6   0  0  0 | *  *  *  *   *  *  *  * 20

© 2004-2021
top of page