Acronym rez (old: rhio)
Name rectified hecatonicosoctaexon
Circumradius 1
Lace city
in approx. ASCII-art
o   t   o	-- x3o3o3o3o4o (gee)
t   r   t	-- o3x3o3o3o4o (rag)
o   t   o	-- x3o3o3o3o4o (gee)

   \   \   \   \   \
     \   \   \   \   +-- o o3o3o3o4o (point)
       \   \   \   +---- x x3o3o3o4o (taccup)
         \   \   +------ compound of:
           \   \         o o3x3o3o4o (rat)
             \   \       u o3o3o3o4o (u-line)
               \   +---- x x3o3o3o4o (taccup)
                 +------ o o3o3o3o4o (point)

o = o3o3o3o4o (point)
t = x3o3o3o4o (tac)
r = o3x3o3o4o (rat)
  h   H  	-- x3o3o3o3o4o (gee)
r   S   R	-- o3x3o3o3o4o (rag)
  h   H  	-- x3o3o3o3o4o (gee)

    \   \   \
     \   \   +- o3x3o3o3o3o (ril)
      \   +---- x3o3o3o3o3x (staf)
       +------- o3o3o3o3x3o (inv. ril)

h = x3o3o3o3o (hix)
H = o3o3o3o3x (dual hix)
r = o3x3o3o3o (rix)
R = o3o3o3x3o (inv. rix)
S = x3o3o3o3x (scad)
Coordinates (1/sqrt(2), 1/sqrt(2), 0, 0, 0, 0, 0)   & all permutations, all changes of sign
related segmentoexa:
garag   rilastaf  

Incidence matrix according to Dynkin symbol


. . . . . . . | 84   20 |  10   80 |  40  160 |  80  160 |  80  64 |  32  2
. x . . . . . |  2 | 840 |   1    8 |   8   24 |  24   32 |  32  16 |  16  1
o3x . . . . . |  3 |   3 | 280    *    8    0 |  24    0 |  32   0 |  16  0
. x3o . . . . |  3 |   3 |   * 2240 |   1    6 |   6   12 |  12   8 |   8  1
o3x3o . . . .   6 |  12 |   4    4 | 560    *    6    0 |  12   0 |   8  0
. x3o3o . . .   4 |   6 |   0    4 |   * 3360 |   1    4 |   4   4 |   4  1
o3x3o3o . . .  10 |  30 |  10   20 |   5    5 | 672    * |   4   0 |   4  0
. x3o3o3o . .   5 |  10 |   0   10 |   0    5 |   * 2688 |   1   2 |   2  1
o3x3o3o3o . .  15 |  60 |  20   60 |  15   30 |   6    6 | 448   * |   2  0
. x3o3o3o3o .   6 |  15 |   0   20 |   0   15 |   0    6 |   * 896 |   1  1
o3x3o3o3o3o .  21 | 105 |  35  140 |  35  105 |  21   42 |   7   7 | 128  *
. x3o3o3o3o4o  12 |  60 |   0  160 |   0  240 |   0  192 |   0  64 |   * 14

o3o3o *b3o3o3x3o

. . .    . . . . | 84   20 |   80  10 |  160  40 |  160  80 |  32  32  80 |  2 16 16
. . .    . . x . |  2 | 840 |    8   1 |   24   8 |   32  24 |   8   8  32 |  1  8  8
. . .    . o3x . |  3 |   3 | 2240   * |    6   1 |   12   6 |   4   4  12 |  1  4  4
. . .    . . x3o |  3 |   3 |    * 280     0   8 |    0  24 |   0   0  32 |  0  8  8
. . .    o3o3x .   4 |   6 |    4   0 | 3360   * |    4   1 |   2   2   4 |  1  2  2
. . .    . o3x3o   6 |  12 |    4   4 |    * 560     0   6 |   0   0  12 |  0  4  4
. o . *b3o3o3x .   5 |  10 |   10   0 |    5   0 | 2688   * |   1   1   1 |  1  1  1
. . .    o3o3x3o  10 |  30 |   20  10 |    5   5 |    * 672 |   0   0   4 |  0  2  2
o3o . *b3o3o3x .   6 |  15 |   20   0 |   15   0 |    6   0 | 448   *   * |  1  1  0
. o3o *b3o3o3x .   6 |  15 |   20   0 |   15   0 |    6   0 |   * 448   * |  1  0  1
. o . *b3o3o3x3o  15 |  60 |   60  20 |   30  15 |    6   6 |   *   * 448 |  0  1  1
o3o3o *b3o3o3x .  12 |  60 |  160   0 |  240   0 |  192   0 |  32  32   0 | 14  *  *
o3o . *b3o3o3x3o  21 | 105 |  140  35 |  105  35 |   42  21 |   7   0   7 |  * 64  *
. o3o *b3o3o3x3o  21 | 105 |  140  35 |  105  35 |   42  21 |   0   7   7 |  *  * 64

xox3oxo3ooo3ooo3ooo4ooo&#xt   → both heights = 1/sqrt(2) = 0.707107
(gee || (pseudo) rag || gee)

o..3o..3o..3o..3o..4o..    & | 24  *   10  10   0 |  40  10  40   0   0 |  80  40   80   0   0 |  80  80   80   0   0 |  32  80  32  0 | 1  32  1
.o.3.o.3.o.3.o.3.o.4.o.      |  * 60    0   4  16 |   0   2  32   8  48 |   0  16   96  24  64 |   0  48  128  32  32 |   0  64  64 16 | 0  32  2
x.. ... ... ... ... ...    & |  2  0 | 120   *   * |   8   1   0   0   0 |  24   8    0   0   0 |  32  24    0   0   0 |  16  32   0  0 | 1  16  0
oo.3oo.3oo.3oo.3oo.4oo.&#x & |  1  1 |   * 240   * |   0   1   8   0   0 |   0   8   24   0   0 |   0  24   32   0   0 |   0  32  16  0 | 0  16  1
... .x. ... ... ... ...      |  0  2 |   *   * 480 |   0   0   2   1   6 |   0   2   12   6  12 |   0  12   24  12   8 |   0  24  16  8 | 0  16  1
x..3o.. ... ... ... ...    & |  3  0 |   3   0   0 | 320   *   *   *   * |   6   1    0   0   0 |  12   6    0   0   0 |   8  12   0  0 | 1   8  0
xo. ... ... ... ... ...&#x & |  2  1 |   1   2   0 |   * 120   *   *   *    0   8    0   0   0 |   0  24    0   0   0 |   0  32   0  0 | 0  16  0
... ox. ... ... ... ...&#x & |  1  2 |   0   2   1 |   *   * 960   *   * |   0   1    6   0   0 |   0   6   12   0   0 |   0  12   8  0 | 0   8  1
.o.3.x. ... ... ... ...      |  0  3 |   0   0   3 |   *   *   * 160   *    0   2    0   6   0 |   0  12    0  12   0 |   0  24   0  8 | 0  16  0
... .x.3.o. ... ... ...      |  0  3 |   0   0   3 |   *   *   *   * 960 |   0   0    2   1   4 |   0   2    8   4   4 |   0   8   8  4 | 0   8  1
x..3o..3o.. ... ... ...    &   4  0 |   6   0   0 |   4   0   0   0   0 | 480   *    *   *   * |   4   1    0   0   0 |   4   4   0  0 | 1   4  0
xo.3ox. ... ... ... ...&#x &   3  3 |   3   6   3 |   1   3   3   1   0 |   * 320    *   *   *    0   6    0   0   0 |   0  12   0  0 | 0   8  0
... ox.3oo. ... ... ...&#x &   1  3 |   0   3   3 |   0   0   3   0   1 |   *   * 1920   *   * |   0   1    4   0   0 |   0   4   4  0 | 0   4  1
.o.3.x.3.o. ... ... ...        0  6 |   0   0  12 |   0   0   0   4   4 |   *   *    * 240   *    0   2    0   4   0 |   0   8   0  4 | 0   8  0
... .x.3.o.3.o. ... ...        0  4 |   0   0   6 |   0   0   0   0   4 |   *   *    *   * 960 |   0   0    2   1   2 |   0   2   4  2 | 0   4  1
x..3o..3o..3o.. ... ...    &   5  0 |  10   0   0 |  10   0   0   0   0 |   5   0    0   0   0 | 384   *    *   *   * |   2   1   0  0 | 1   2  0
xo.3ox.3oo. ... ... ...&#x &   4  6 |   6  12  12 |   4   6  12   4   4 |   1   4    4   1   0 |   * 480    *   *   * |   0   4   0  0 | 0   4  0
... ox.3oo.3oo. ... ...&#x &   1  4 |   0   4   6 |   0   0   6   0   4 |   0   0    4   0   1 |   *   * 1920   *   * |   0   1   2  0 | 0   2  1
.o.3.x.3.o.3.o. ... ...        0 10 |   0   0  30 |   0   0   0  10  20 |   0   0    0   5   5 |   *   *    * 192   * |   0   2   0  2 | 0   4  0
... .x.3.o.3.o.3.o. ...        0  5 |   0   0  10 |   0   0   0   0  10 |   0   0    0   0   5 |   *   *    *   * 384 |   0   0   2  1 | 0   2  1
x..3o..3o..3o..3o.. ...    &   6  0 |  15   0   0 |  20   0   0   0   0 |  15   0    0   0   0 |   6   0    0   0   0 | 128   *   *  * | 1   1  0
xo.3ox.3oo.3oo. ... ...&#x &   5 10 |  10  20  30 |  10  10  30  10  20 |   5  10   20   5   5 |   1   5    5   1   0 |   * 384   *  * | 0   2  0
... ox.3oo.3oo.3oo. ...&#x &   1  5 |   0   5  10 |   0   0  10   0  10 |   0   0   10   0   5 |   0   0    5   0   1 |   *   * 768  * | 0   1  1
.o.3.x.3.o.3.o.3.o. ...        0 15 |   0   0  60 |   0   0   0  20  60 |   0   0    0  15  30 |   0   0    0   6   6 |   *   *   * 64 | 0   2  0
x..3o..3o..3o..3o..4o..    &  12  0 |  60   0   0 | 160   0   0   0   0 | 240   0    0   0   0 | 192   0    0   0   0 |  64   0   0  0 | 2   *  *
xo.3ox.3oo.3oo.3oo. ...&#x &   6 15 |  15  30  60 |  20  15  60  20  60 |  15  20   60  15  30 |   6  15   30   6   6 |   1   6   6  1 | * 128  *
... oxo3ooo3ooo3ooo4ooo&#xt    2 10 |   0  20  40 |   0   0  80   0  80 |   0   0  160   0  80 |   0   0  160   0  32 |   0   0  64  0 | *   * 12

oxo3xoo3ooo3ooo3oox3oxo&#xt   → both heights = sqrt(2/7) = 0.534522
(ril || (pseudo) staf || inv ril)

o..3o..3o..3o..3o..3o..     & | 42  *   10  10   0 |  5  20   5  40  20   0 | 10  20  20  10  60   60  20   0 | 10 10  30  40  40  60  40  10  0 |  5  2 20  35  20 10  20  20  10  2  0 | 1  5 11 15  2
.o.3.o.3.o.3.o.3.o.3.o.       |  * 42    0  10  10 |  0   0  10  20  40  20 |  0   0  20  20  20   60  60  20 |  0  0  20  60  10  40  60  40 10 |  0  0 10  40  30  2  10  20  20 10  2 | 0  2 10 20  2
... x.. ... ... ... ...     & |  2  0 | 210   *   * |  1   4   0   4   0   0 |  4   6   4   0  12    6   0   0 |  6  4  12   6  12  12   4   0  0 |  4  1 12  12   4  4   6   4   1  0  0 | 1  4  6  5  1
oo.3oo.3oo.3oo.3oo.3oo.&#x  & |  1  1 |   * 420   * |  0   0   1   4   4   0 |  0   0   4   4   6   12   6   0 |  0  0   6  18   4  12  12   4  0 |  0  0  4  16  12  1   4   6   4  1  0 | 0  1  5 10  1
.x. ... ... ... ... ...     & |  0  2 |   *   * 210 |  0   0   1   0   4   4 |  0   0   4   4   0    6  12   6 |  0  0   6  18   0   4  12  12  4 |  0  0  4  16  12  0   1   4   6  4  1 | 0  1  5 10  1
o..3x.. ... ... ... ...     & |  3  0 |   3   0   0 | 70   *   *   *   *   *   4   0   4   0   0    0   0   0 |  6  0  12   6   0   0   0   0  0 |  4  0 12  12   4  0   0   0   0  0  0 | 1  4  6  5  0
... x..3o.. ... ... ...     & |  3  0 |   3   0   0 |  * 280   *   *   *   * |  1   3   0   0   3    0   0   0 |  3  3   3   0   6   3   0   0  0 |  3  1  6   3   0  3   3   1   0  0  0 | 1  3  3  1  1
ox. ... ... ... ... ...&#x  & |  1  2 |   0   2   1 |  *   * 210   *   *   *   0   0   4   4   0    0   0   0 |  0  0   6  18   0   0   0   0  0 |  0  0  4  16  12  0   0   0   0  0  0 | 0  1  5 10  0
... xo. ... ... ... ...&#x  & |  2  1 |   1   2   0 |  *   *   * 840   *   * |  0   0   1   0   3    3   0   0 |  0  0   3   3   3   6   3   0  0 |  0  0  3   6   3  1   3   3   1  0  0 | 0  1  3  4  1
... ... ... ... ... ox.&#x  & |  1  2 |   0   2   1 |  *   *   *   * 840   * |  0   0   0   1   0    3   3   0 |  0  0   0   6   0   3   6   3  0 |  0  0  0   6   6  0   1   3   3  1  0 | 0  0  2  6  1
.x.3.o. ... ... ... ...     & |  0  3 |   0   0   3 |  *   *   *   *   * 280 |  0   0   1   0   0    0   3   3 |  0  0   3   3   0   0   3   6  3 |  0  0  3   6   3  0   0   1   3  3  1 | 0  1  3  4  1
o..3x..3o.. ... ... ...     &   6  0 |  12   0   0 |  4   4   0   0   0   0 | 70   *   *   *   *    *   *   *   3  0   3   0   0   0   0   0  0 |  3  0  6   3   0  0   0   0   0  0  0 | 1  3  3  1  0
... x..3o..3o.. ... ...     &   4  0 |   6   0   0 |  0   4   0   0   0   0 |  * 210   *   *   *    *   *   * |  1  2   0   0   2   0   0   0  0 |  2  1  2   0   0  2   1   0   0  0  0 | 1  2  1  0  1
ox.3xo. ... ... ... ...&#x  &   3  3 |   3   6   3 |  1   0   3   3   0   1 |  *   * 280   *   *    *   *   *   0  0   3   3   0   0   0   0  0 |  0  0  3   6   3  0   0   0   0  0  0 | 0  1  3  4  0
oxo ... ... ... ... oxo&#xt     2  4 |   0   8   4 |  0   0   4   0   4   0 |  *   *   * 210   *    *   *   *   0  0   0   6   0   0   0   0  0 |  0  0  0   6   6  0   0   0   0  0  0 | 0  0  2  6  0
... xo.3oo. ... ... ...&#x  &   3  1 |   3   3   0 |  0   1   0   3   0   0 |  *   *   *   * 840    *   *   * |  0  0   1   0   2   2   0   0  0 |  0  0  2   2   0  1   2   1   0  0  0 | 0  1  2  1  1
... xo. ... ... ... ox.&#x  &   2  2 |   1   4   1 |  0   0   0   2   2   0 |  *   *   *   *   * 1260   *   * |  0  0   0   1   0   2   2   0  0 |  0  0  0   2   2  0   1   2   1  0  0 | 0  0  1  3  1
... ... ... ... oo.3ox.&#x  &   1  3 |   0   3   3 |  0   0   0   0   3   1 |  *   *   *   *   *    * 840   * |  0  0   0   1   0   0   2   2  0 |  0  0  0   2   2  0   0   1   2  1  0 | 0  0  1  3  1
.x.3.o.3.o. ... ... ...     &   0  4 |   0   0   6 |  0   0   0   0   0   4 |  *   *   *   *   *    *   * 210 |  0  0   1   0   0   0   0   2  2 |  0  0  2   2   0  0   0   0   1  2  1 | 0  1  2  1  1
o..3x..3o..3o.. ... ...     &  10  0 |  30   0   0 | 10  20   0   0   0   0 |  5   5   0   0   0    0   0   0 | 42  *   *   *   *   *   *   *  * |  2  0  2   0   0  0   0   0   0  0  0 | 1  2  1  0  0
... x..3o..3o..3o.. ...     &   5  0 |  10   0   0 |  0  10   0   0   0   0 |  0   5   0   0   0    0   0   0 |  * 84   *   *   *   *   *   *  * |  1  1  0   0   0  1   0   0   0  0  0 | 1  1  0  0  1
ox.3xo.3oo. ... ... ...&#x  &   6  4 |  12  12   6 |  4   4   6  12   0   4 |  1   0   4   0   4    0   0   1 |  *  * 210   *   *   *   *   *  * |  0  0  2   2   0  0   0   0   0  0  0 | 0  1  2  1  0
oxo3xoo ... ... ... oxo&#xt &   4  6 |   3  18   9 |  1   0   9   6  12   2 |  0   0   2   3   0    3   2   0 |  *  *   * 420   *   *   *   *  * |  0  0  0   2   2  0   0   0   0  0  0 | 0  0  1  3  0
... xo.3oo.3oo. ... ...&#x  &   4  1 |   6   4   0 |  0   4   0   6   0   0 |  0   1   0   0   4    0   0   0 |  *  *   *   * 420   *   *   *  * |  0  0  1   0   0  1   1   0   0  0  0 | 0  1  1  0  1
... xo.3oo. ... ... ox.&#x  &   3  2 |   3   6   1 |  0   1   0   6   3   0 |  0   0   0   0   2    3   0   0 |  *  *   *   *   * 840   *   *  * |  0  0  0   1   0  0   1   1   0  0  0 | 0  0  1  1  1
... xo. ... ... oo.3ox.&#x  &   2  3 |   1   6   3 |  0   0   0   3   6   1 |  0   0   0   0   0    3   2   0 |  *  *   *   *   *   * 840   *  * |  0  0  0   0   1  0   0   1   1  0  0 | 0  0  0  2  1
... ... ... oo.3oo.3ox.&#x  &   1  4 |   0   4   6 |  0   0   0   0   6   4 |  0   0   0   0   0    0   4   1 |  *  *   *   *   *   *   * 420  * |  0  0  0   1   0  0   0   0   1  1  0 | 0  0  1  1  1
.x.3.o.3.o.3.o. ... ...     &   0  5 |   0   0  10 |  0   0   0   0   0  10 |  0   0   0   0   0    0   0   5 |  *  *   *   *   *   *   *   * 84 |  0  0  1   0   0  0   0   0   0  1  1 | 0  1  1  0  1
o..3x..3o..3o..3o.. ...     &  15  0 |  60   0   0 | 20  60   0   0   0   0 | 15  30   0   0   0    0   0   0 |  6  6   0   0   0   0   0   0  0 | 14  *  *   *   *  *   *   *   *  *  * | 1  1  0  0  0
... x..3o..3o..3o..3o..     &   6  0 |  15   0   0 |  0  20   0   0   0   0 |  0  15   0   0   0    0   0   0 |  0  6   0   0   0   0   0   0  0 |  * 14  *   *   *  *   *   *   *  *  * | 1  0  0  0  1
ox.3xo.3oo.3oo. ... ...&#x  &  10  5 |  30  20  10 | 10  20  10  30   0  10 |  5   5  10   0  20    0   0   5 |  1  0   5   0   5   0   0   0  1 |  *  * 84   *   *  *   *   *   *  *  * | 0  1  1  0  0
oxo3xoo3ooo ... ... oxo&#xt &   7  8 |  12  32  16 |  4   4  16  24  24   8 |  1   0   8   6   8   12   8   2 |  0  0   2   4   0   4   0   2  0 |  *  *  * 210   *  *   *   *   *  *  * | 0  0  1  1  0
oxo3xoo ... ... oox3oxo&#xt     6  9 |   6  36  18 |  2   0  18  18  36   6 |  0   0   6   9   0   18  12   0 |  0  0   0   6   0   0   6   0  0 |  *  *  *   * 140  *   *   *   *  *  * | 0  0  0  2  0
... xo.3oo.3oo.3oo. ...&#x  &   5  1 |  10   5   0 |  0  10   0  10   0   0 |  0   5   0   0  10    0   0   0 |  0  1   0   0   5   0   0   0  0 |  *  *  *   *   * 84   *   *   *  *  * | 0  1  0  0  1
... xo.3oo.3oo. ... ox.&#x  &   4  2 |   6   8   1 |  0   4   0  12   4   0 |  0   1   0   0   8    6   0   0 |  0  0   0   0   2   4   0   0  0 |  *  *  *   *   *  * 210   *   *  *  * | 0  0  1  0  1
... xo.3oo. ... oo.3ox.&#x  &   3  3 |   3   9   3 |  0   1   0   9   9   1 |  0   0   0   0   3    9   3   0 |  0  0   0   0   0   3   3   0  0 |  *  *  *   *   *  *   * 280   *  *  * | 0  0  0  1  1
... xo. ... oo.3oo.3ox.&#x  &   2  4 |   1   8   6 |  0   0   0   4  12   4 |  0   0   0   0   0    6   8   1 |  0  0   0   0   0   0   4   2  0 |  *  *  *   *   *  *   *   * 210  *  * | 0  0  0  1  1
... ... oo.3oo.3oo.3ox.&#x  &   1  5 |   0   5  10 |  0   0   0   0  10  10 |  0   0   0   0   0    0  10   5 |  0  0   0   0   0   0   0   5  1 |  *  *  *   *   *  *   *   *   * 84  * | 0  0  1  0  1
.x.3.o.3.o.3.o.3.o. ...     &   0  6 |   0   0  15 |  0   0   0   0   0  20 |  0   0   0   0   0    0   0  15 |  0  0   0   0   0   0   0   0  6 |  *  *  *   *   *  *   *   *   *  * 14 | 0  1  0  0  1
o..3x..3o..3o..3o..3o..     &  21  0 | 105   0   0 | 35 140   0   0   0   0 | 35 105   0   0   0    0   0   0 | 21 42   0   0   0   0   0   0  0 |  7  7  0   0   0  0   0   0   0  0  0 | 2  *  *  *  *
ox.3xo.3oo.3oo.3oo. ...&#x  &  15  6 |  60  30  15 | 20  60  15  60   0  20 | 15  30  20   0  60    0   0  15 |  6  6  15   0  30   0   0   0  6 |  1  0  6   0   0  6   0   0   0  0  1 | * 14  *  *  *
oxo3xoo3ooo3ooo ... oxo&#xt &  11 10 |  30  50  25 | 10  20  25  60  40  20 |  5   5  20  10  40   30  20  10 |  1  0  10  10  10  20   0  10  2 |  0  0  2   5   0  0   5   0   0  2  0 | *  * 42  *  *
oxo3xoo3ooo ... oox3oxo&#xt &   9 12 |  15  60  30 |  5   4  30  48  72  16 |  1   0  16  18  12   54  36   3 |  0  0   3  18   0  12  24   6  0 |  0  0  0   3   4  0   0   4   3  0  0 | *  *  * 70  *
... xo.3oo.3oo.3oo.3ox.&#x  &   6  6 |  15  30  15 |  0  20   0  60  60  20 |  0  15   0   0  60   90  60  15 |  0  6   0   0  30  60  60  30  6 |  0  1  0   0   0  6  15  20  15  6  1 | *  *  *  * 14

ox(xo)ox3xo(xo)xo oo(oo)oo3oo(ox)oo3oo(oo)oo *d3ox(oo)xo&#xt   → all heights = 1/sqrt(6) = 0.408248
({3} || pseudo dual trahex || pseudo compound of {6} and perp ico || pseudo trahex || dual {3})

o.(..)..3o.(..).. o.(..)..3o.(..)..3o.(..).. *d3o.(..)..     & | 6  * *  *  2 16  2  0   0  0   0  0 0  0 | 1  8 16  48 16 1  0   0  0   0  0   0   0   0   0  0  0  0  0 |  8  48  64  48  8  24  0  0   0   0   0  0   0   0   0   0   0   0 0 0 |  64 16 16  64  24 24  32   0  0  0   0   0   0   0  0  0   0   0   0 | 16 16 16 16  32 32  8  8  0  0  0  0  0  0   0   0 | 2  8  8  8  8 0
.o(..)..3.o(..).. .o(..)..3.o(..)..3.o(..).. *d3.o(..)..     & | * 48 *  *  0  2  0  2   6  2   6  2 0  0 | 0  2  1  12  2 0  1  12  1  12  2  12  12  12   6  3  0  0  0 |  1   6  24  12  3  12  4  4   6  24  12  6  24   4   4  12  18  24 0 0 |  12  8  8  24  18  6  24  12  8  8  24  12   8   8  4  4  36   8   8 |  4  4  8  8  36 12  8  8  4  4  8  8  4  4  12  12 | 1  4  4 12 12 1
..(o.)..3..(o.).. ..(o.)..3..(o.)..3..(o.).. *d3..(o.)..       | *  * 6  *  0  0  2  0   0 16   0  0 2  0 | 0  0  0   0 16 2  0   0 16  48  8   0   0   0   0  0  0  0  0 |  0   0   0  48 16   0  0  0  48  64  24  0   0   0   0   0   0   0 0 0 |   0  0  0  64  48  0   0  64 16 16  32   0   0   0  0  0   0   0   0 |  0  0 16 16  64  0  0  0 16 16  8  8  0  0   0   0 | 2  0  0 16 16 0
..(.o)..3..(.o).. ..(.o)..3..(.o)..3..(.o).. *d3..(.o)..       | *  * * 24  0  0  0  0   0  0  12  0 0  8 | 0  0  0   0  0 0  0   0  0   0  0  12  12  48   6  0  4  4  4 |  0   0   0   0  0   6  0  0   0   0   6  4  48  24  24  24  12  48 2 2 |   0  0  0   0   6  2  24   0  0  0  24  16  24  24 12 12  48  24  24 |  0  0  0  0  24  8 12 12  0  0 12 12  8  8  24  24 | 0  4  4 12 12 2
..(..).. x.(..).. ..(..).. ..(..).. ..(..)..    ..(..)..     & | 2  0 0  0 | 6  *  *  *   *  *   *  * *  * | 1  0  8   0  0 0  1   0  0   0  0   0   0   0   0  0  0  0  0 |  8  24   0   0  0   0  0  0   0   0   0  0   0   0   0   0   0   0 0 0 |  32  0  0   0   0 24   0   0  0  0   0   0   0   0  0  0   0   0   0 |  8  8  0  0   0 32  0  0  0  0  0  0  0  0   0   0 | 1  8  8  0  0 0
oo(..)..3oo(..).. oo(..)..3oo(..)..3oo(..).. *d3oo(..)..&#x  & | 1  1 0  0 | * 96  *  *   *  *   *  * *  * | 0  1  1   6  1 0  0   0  0   0  0   0   0   0   0  0  0  0  0 |  1   6  12   6  1   6  0  0   0   0   0  0   0   0   0   0   0   0 0 0 |  12  4  4  12   6  6  12   0  0  0   0   0   0   0  0  0   0   0   0 |  4  4  4  4  12 12  4  4  0  0  0  0  0  0   0   0 | 1  4  4  4  4 0
o.(o.)..3o.(o.).. o.(o.)..3o.(o.)..3o.(o.).. *d3o.(o.)..&#x  & | 1  0 1  0 | *  * 12  *   *  *   *  * *  * | 0  0  0   0  8 1  0   0  0   0  0   0   0   0   0  0  0  0  0 |  0   0   0  24  8   0  0  0   0   0   0  0   0   0   0   0   0   0 0 0 |   0  0  0  32  24  0   0   0  0  0   0   0   0   0  0  0   0   0   0 |  0  0  8  8  32  0  0  0  0  0  0  0  0  0   0   0 | 1  0  0  8  8 0
.x(..).. ..(..).. ..(..).. ..(..).. ..(..)..    ..(..)..     & | 0  2 0  0 | *  *  * 48   *  *   *  * *  * | 0  1  0   0  0 0  1   0  0   0  0   0   6   0   0  1  0  0  0 |  1   0   0   0  1   6  0  0   0   0   0  6  12   0   0   0   6   0 0 0 |   0  0  0   0   6  6  12   0  0  0   0  12   4   4  0  0  12   0   0 |  0  0  0  0  12 12  4  4  0  0  0  0  4  4   4   4 | 0  4  4  4  4 1
..(..).. ..(..).. ..(..).. ..(..).. ..(..)..    .x(..)..     & | 0  2 0  0 | *  *  *  * 144  *   *  * *  * | 0  0  0   2  0 0  0   4  0   2  0   0   0   0   1  0  0  0  0 |  0   1   8   2  0   2  2  2   1   8   2  0   0   0   0   4   0   0 0 0 |   4  4  4   8   3  1   8   4  4  4   8   0   0   0  2  2   0   0   0 |  2  2  4  4  12  4  4  4  2  2  4  4  0  0   0   0 | 1  2  2  6  6 0
.o(o.)..3.o(o.).. .o(o.)..3.o(o.)..3.o(o.).. *d3.o(o.)..&#x  & | 0  1 1  0 | *  *  *  *   * 96   *  * *  * | 0  0  0   0  1 0  0   0  1   6  1   0   0   0   0  0  0  0  0 |  0   0   0   6  2   0  0  0   6  12   6  0   0   0   0   0   0   0 0 0 |   0  0  0  12  12  0   0  12  4  4  12   0   0   0  0  0   0   0   0 |  0  0  4  4  24  0  0  0  4  4  4  4  0  0   0   0 | 1  0  0  8  8 0
.o(.o)..3.o(.o).. .o(.o)..3.o(.o)..3.o(.o).. *d3.o(.o)..&#x  & | 0  1 0  1 | *  *  *  *   *  * 288  * *  * | 0  0  0   0  0 0  0   0  0   0  0   2   2   4   1  0  0  0  0 |  0   0   0   0  0   1  0  0   0   0   2  1   8   2   2   4   3   8 0 0 |   0  0  0   0   3  1   8   0  0  0   8   4   4   4  2  2  12   4   4 |  0  0  0  0  12  4  4  4  0  0  4  4  2  2   6   6 | 0  2  2  6  6 1
.o(..)o.3.o(..)o. .o(..)o.3.o(..)o.3.o(..)o. *d3.o(..)o.&#x    | 0  2 0  0 | *  *  *  *   *  *   * 48 *  * | 0  0  0   0  0 0  0   0  0   0  1   6   0   0   0  2  0  0  0 |  0   0   0   0  2   0  0  0   0   0   6  0   0   0   0   0  12  12 0 0 |   0  0  0   0  12  0   0   0  0  0  12   0   0   0  0  0  24   4   4 |  0  0  0  0  24  0  0  0  0  0  4  4  0  0   8   8 | 0  0  0  8  8 1
..(x.).. ..(..).. ..(..).. ..(..).. ..(..)..    ..(..)..     & | 0  0 2  0 | *  *  *  *   *  *   *  * 6  * | 0  0  0   0  0 1  0   0  8   0  0   0   0   0   0  0  0  0  0 |  0   0   0   0  8   0  0  0  24   0   0  0   0   0   0   0   0   0 0 0 |   0  0  0   0  24  0   0  32  0  0   0   0   0   0  0  0   0   0   0 |  0  0  0  0  32  0  0  0  8  8  0  0  0  0   0   0 | 1  0  0  8  8 0
..(..).. ..(..).. ..(..).. ..(.x).. ..(..)..    ..(..)..       | 0  0 0  2 | *  *  *  *   *  *   *  * * 96 | 0  0  0   0  0 0  0   0  0   0  0   0   0   6   0  0  1  1  1 |  0   0   0   0  0   0  0  0   0   0   0  0   6   6   6   6   0   6 1 1 |   0  0  0   0   0  0   6   0  0  0   6   2   6   6  6  6   6   6   6 |  0  0  0  0   6  2  6  6  0  0  6  6  2  2   6   6 | 0  2  2  6  6 1
o.(..)..3x.(..).. ..(..).. ..(..).. ..(..)..    ..(..)..     & | 3  0 0  0 | 3  0  0  0   0  0   0  0 0  0 | 2  *  *   *  * *  *   *  *   *  *   *   *   *   *  *  *  *  *   8   0   0   0  0   0  0  0   0   0   0  0   0   0   0   0   0   0 0 0 |   0  0  0   0   0 24   0   0  0  0   0   0   0   0  0  0   0   0   0 |  0  0  0  0   0 32  0  0  0  0  0  0  0  0   0   0 | 0  8  8  0  0 0
ox(..).. ..(..).. ..(..).. ..(..).. ..(..)..    ..(..)..&#x  & | 1  2 0  0 | 0  2  0  1   0  0   0  0 0  0 | * 48  *   *  * *  *   *  *   *  *   *   *   *   *  *  *  *  *   1   0   0   0  1   6  0  0   0   0   0  0   0   0   0   0   0   0 0 0 |   0  0  0   0   6  6  12   0  0  0   0   0   0   0  0  0   0   0   0 |  0  0  0  0  12 12  4  4  0  0  0  0  0  0   0   0 | 0  4  4  4  4 0
..(..).. xo(..).. ..(..).. ..(..).. ..(..)..    ..(..)..&#x  & | 2  1 0  0 | 1  2  0  0   0  0   0  0 0  0 | *  * 48   *  * *  *   *  *   *  *   *   *   *   *  *  *  *  * |  1   6   0   0  0   0  0  0   0   0   0  0   0   0   0   0   0   0 0 0 |  12  0  0   0   0  6   0   0  0  0   0   0   0   0  0  0   0   0   0 |  4  4  0  0   0 12  0  0  0  0  0  0  0  0   0   0 | 1  4  4  0  0 0
..(..).. ..(..).. ..(..).. ..(..).. ..(..)..    ox(..)..&#x  & | 1  2 0  0 | 0  2  0  0   1  0   0  0 0  0 | *  *  * 288  * *  *   *  *   *  *   *   *   *   *  *  *  *  * |  0   1   4   1  0   1  0  0   0   0   0  0   0   0   0   0   0   0 0 0 |   4  2  2   4   1  1   4   0  0  0   0   0   0   0  0  0   0   0   0 |  2  2  2  2   4  4  2  2  0  0  0  0  0  0   0   0 | 1  2  2  2  2 0
oo(o.)..3oo(o.).. oo(o.)..3oo(o.)..3oo(o.).. *d3oo(o.)..&#x  & | 1  1 1  0 | 0  1  1  0   0  1   0  0 0  0 | *  *  *   * 96 *  *   *  *   *  *   *   *   *   *  *  *  *  * |  0   0   0   6  1   0  0  0   0   0   0  0   0   0   0   0   0   0 0 0 |   0  0  0  12   6  0   0   0  0  0   0   0   0   0  0  0   0   0   0 |  0  0  4  4  12  0  0  0  0  0  0  0  0  0   0   0 | 1  0  0  4  4 0
o.(x.).. ..(..).. ..(..).. ..(..).. ..(..)..    ..(..)..&#x  & | 1  0 2  0 | 0  0  2  0   0  0   0  0 1  0 | *  *  *   *  * 6  *   *  *   *  *   *   *   *   *  *  *  *  *   0   0   0   0  8   0  0  0   0   0   0  0   0   0   0   0   0   0 0 0 |   0  0  0   0  24  0   0   0  0  0   0   0   0   0  0  0   0   0   0 |  0  0  0  0  32  0  0  0  0  0  0  0  0  0   0   0 | 0  0  0  8  8 0
.x(..)..3.o(..).. ..(..).. ..(..).. ..(..)..    ..(..)..     & | 0  3 0  0 | 0  0  0  3   0  0   0  0 0  0 | *  *  *   *  * * 16   *  *   *  *   *   *   *   *  *  *  *  * |  1   0   0   0  0   0  0  0   0   0   0  6   0   0   0   0   0   0 0 0 |   0  0  0   0   0  6   0   0  0  0   0  12   0   0  0  0   0   0   0 |  0  0  0  0   0 12  0  0  0  0  0  0  4  4   0   0 | 0  4  4  0  0 1
..(..).. ..(..).. ..(..).. .o(..).. ..(..).. *d3.x(..)..     & | 0  3 0  0 | 0  0  0  0   3  0   0  0 0  0 | *  *  *   *  * *  * 192  *   *  *   *   *   *   *  *  *  *  * |  0   0   2   0  0   0  1  1   0   2   0  0   0   0   0   1   0   0 0 0 |   1  2  2   2   0  0   2   1  2  2   2   0   0   0  1  1   0   0   0 |  1  1  2  2   3  1  2  2  1  1  2  2  0  0   0   0 | 1  1  1  3  3 0
..(..).. .o(x.).. ..(..).. ..(..).. ..(..)..    ..(..)..&#x  & | 0  1 2  0 | 0  0  0  0   0  2   0  0 1  0 | *  *  *   *  * *  *   * 48   *  *   *   *   *   *  *  *  *  * |  0   0   0   0  1   0  0  0   6   0   0  0   0   0   0   0   0   0 0 0 |   0  0  0   0   6  0   0  12  0  0   0   0   0   0  0  0   0   0   0 |  0  0  0  0  12  0  0  0  4  4  0  0  0  0   0   0 | 1  0  0  4  4 0
..(..).. ..(..).. ..(..).. ..(..).. ..(..)..    .x(o.)..&#x  & | 0  2 1  0 | 0  0  0  0   1  2   0  0 0  0 | *  *  *   *  * *  *   *  * 288  *   *   *   *   *  *  *  *  * |  0   0   0   1  0   0  0  0   1   4   1  0   0   0   0   0   0   0 0 0 |   0  0  0   4   2  0   0   4  2  2   4   0   0   0  0  0   0   0   0 |  0  0  2  2   8  0  0  0  2  2  2  2  0  0   0   0 | 1  0  0  4  4 0
.o(o.)o.3.o(o.)o. .o(o.)o.3.o(o.)o.3.o(o.)o. *d3.o(o.)o.&#x    | 0  2 1  0 | 0  0  0  0   0  2   0  1 0  0 | *  *  *   *  * *  *   *  *   * 48   *   *   *   *  *  *  *  *   0   0   0   0  2   0  0  0   0   0   6  0   0   0   0   0   0   0 0 0 |   0  0  0   0  12  0   0   0  0  0  12   0   0   0  0  0   0   0   0 |  0  0  0  0  24  0  0  0  0  0  4  4  0  0   0   0 | 0  0  0  8  8 0
.o(.o)o.3.o(.o)o. .o(.o)o.3.o(.o)o.3.o(.o)o. *d3.o(.o)o.&#x    | 0  2 0  1 | 0  0  0  0   0  0   2  1 0  0 | *  *  *   *  * *  *   *  *   *  * 288   *   *   *  *  *  *  * |  0   0   0   0  0   0  0  0   0   0   1  0   0   0   0   0   2   4 0 0 |   0  0  0   0   2  0   0   0  0  0   4   0   0   0  0  0   8   2   2 |  0  0  0  0   8  0  0  0  0  0  2  2  0  0   4   4 | 0  0  0  4  4 1
.x(.o).. ..(..).. ..(..).. ..(..).. ..(..)..    ..(..)..&#x  & | 0  2 0  1 | 0  0  0  1   0  0   2  0 0  0 | *  *  *   *  * *  *   *  *   *  *   * 288   *   *  *  *  *  * |  0   0   0   0  0   1  0  0   0   0   0  1   4   0   0   0   1   0 0 0 |   0  0  0   0   1  1   4   0  0  0   0   4   2   2  0  0   4   0   0 |  0  0  0  0   4  4  2  2  0  0  0  0  2  2   2   2 | 0  2  2  2  2 1
..(..).. ..(..).. ..(..).. .o(.x).. ..(..)..    ..(..)..&#x  & | 0  1 0  2 | 0  0  0  0   0  0   2  0 0  1 | *  *  *   *  * *  *   *  *   *  *   *   * 576   *  *  *  *  * |  0   0   0   0  0   0  0  0   0   0   0  0   2   1   1   1   0   2 0 0 |   0  0  0   0   0  0   2   0  0  0   2   1   2   2  1  1   3   2   2 |  0  0  0  0   3  1  2  2  0  0  2  2  1  1   3   3 | 0  1  1  3  3 1
..(..).. ..(..).. ..(..).. ..(..).. ..(..)..    .x(.o)..&#x  & | 0  2 0  1 | 0  0  0  0   1  0   2  0 0  0 | *  *  *   *  * *  *   *  *   *  *   *   *   * 144  *  *  *  *   0   0   0   0  0   2  0  0   0   0   2  0   0   0   0   4   0   0 0 0 |   0  0  0   0   3  1   8   0  0  0   8   0   0   0  2  2   0   0   0 |  0  0  0  0  12  4  4  4  0  0  4  4  0  0   0   0 | 0  2  2  6  6 0
.x(..)o. ..(..).. ..(..).. ..(..).. ..(..)..    ..(..)..&#x  & | 0  3 0  0 | 0  0  0  1   0  0   0  2 0  0 | *  *  *   *  * *  *   *  *   *  *   *   *   *   * 48  *  *  * |  0   0   0   0  1   0  0  0   0   0   0  0   0   0   0   0   6   0 0 0 |   0  0  0   0   6  0   0   0  0  0   0   0   0   0  0  0  12   0   0 |  0  0  0  0  12  0  0  0  0  0  0  0  0  0   4   4 | 0  0  0  4  4 1
..(..).. ..(..).. ..(.o)..3..(.x).. ..(..)..    ..(..)..       | 0  0 0  3 | 0  0  0  0   0  0   0  0 0  3 | *  *  *   *  * *  *   *  *   *  *   *   *   *   *  * 32  *  * |  0   0   0   0  0   0  0  0   0   0   0  0   0   6   0   0   0   0 1 0 |   0  0  0   0   0  0   0   0  0  0   0   0   6   0  6  0   0   6   0 |  0  0  0  0   0  0  6  0  0  0  6  0  2  0   6   0 | 0  2  0  6  0 1
..(..).. ..(..).. ..(..).. ..(.x)..3..(.o)..    ..(..)..       | 0  0 0  3 | 0  0  0  0   0  0   0  0 0  3 | *  *  *   *  * *  *   *  *   *  *   *   *   *   *  *  * 32  * |  0   0   0   0  0   0  0  0   0   0   0  0   0   0   6   0   0   0 0 1 |   0  0  0   0   0  0   0   0  0  0   0   0   0   6  0  6   0   0   6 |  0  0  0  0   0  0  0  6  0  0  0  6  0  2   0   6 | 0  0  2  0  6 1
..(..).. ..(..).. ..(..).. ..(.x).. ..(..).. *d3..(.o)..       | 0  0 0  3 | 0  0  0  0   0  0   0  0 0  3 | *  *  *   *  * *  *   *  *   *  *   *   *   *   *  *  *  * 32   0   0   0   0  0   0  0  0   0   0   0  0   0   0   0   6   0   0 1 1 |   0  0  0   0   0  0   6   0  0  0   6   0   0   0  6  6   0   0   0 |  0  0  0  0   6  2  6  6  0  0  6  6  0  0   0   0 | 0  2  2  6  6 0
ox(..)..3xo(..).. ..(..).. ..(..).. ..(..)..    ..(..)..&#x  &  3  3 0  0 | 3  6  0  3   0  0   0  0 0  0 | 1  3  3   0  0 0  1   0  0   0  0   0   0   0   0  0  0  0  0 | 16   *   *   *  *   *  *  *   *   *   *  *   *   *   *   *   *   * * *    0  0  0   0   0  6   0   0  0  0   0   0   0   0  0  0   0   0   0 |  0  0  0  0   0 12  0  0  0  0  0  0  0  0   0   0 | 0  4  4  0  0 0
..(..).. xo(..).. ..(..).. ..(..).. ..(..)..    ox(..)..&#x  &  2  2 0  0 | 1  4  0  0   1  0   0  0 0  0 | 0  0  2   2  0 0  0   0  0   0  0   0   0   0   0  0  0  0  0 |  * 144   *   *  *   *  *  *   *   *   *  *   *   *   *   *   *   * * * |   4  0  0   0   0  1   0   0  0  0   0   0   0   0  0  0   0   0   0 |  2  2  0  0   0  4  0  0  0  0  0  0  0  0   0   0 | 1  2  2  0  0 0
..(..).. ..(..).. ..(..).. oo(..).. ..(..).. *d3ox(..)..&#x  &  1  3 0  0 | 0  3  0  0   3  0   0  0 0  0 | 0  0  0   3  0 0  0   1  0   0  0   0   0   0   0  0  0  0  0 |  *   * 384   *  *   *  *  *   *   *   *  *   *   *   *   *   *   * * * |   1  1  1   1   0  0   1   0  0  0   0   0   0   0  0  0   0   0   0 |  1  1  1  1   1  1  1  1  0  0  0  0  0  0   0   0 | 1  1  1  1  1 0
..(..).. ..(..).. ..(..).. ..(..).. ..(..)..    ox(o.)..&#x  &  1  2 1  0 | 0  2  1  0   1  2   0  0 0  0 | 0  0  0   1  2 0  0   0  0   1  0   0   0   0   0  0  0  0  0 |  *   *   * 288  *   *  *  *   *   *   *  *   *   *   *   *   *   * * * |   0  0  0   4   1  0   0   0  0  0   0   0   0   0  0  0   0   0   0 |  0  0  2  2   4  0  0  0  0  0  0  0  0  0   0   0 | 1  0  0  2  2 0
ox(x.)o. ..(..).. ..(..).. ..(..).. ..(..)..    ..(..)..&#xr &  1  3 2  0 | 0  2  2  1   0  4   0  2 1  0 | 0  1  0   0  2 1  0   0  1   0  2   0   0   0   0  1  0  0  0 |  *   *   *   * 48   *  *  *   *   *   *  *   *   *   *   *   *   * * *    0  0  0   0   6  0   0   0  0  0   0   0   0   0  0  0   0   0   0 |  0  0  0  0  12  0  0  0  0  0  0  0  0  0   0   0 | 0  0  0  4  4 0  cycle (ABEC)
ox(.o).. ..(..).. ..(..).. ..(..).. ..(..)..    ox(.o)..&#xt &  1  4 0  1 | 0  4  0  2   2  0   4  0 0  0 | 0  2  0   2  0 0  0   0  0   0  0   0   2   0   2  0  0  0  0 |  *   *   *   *  * 144  *  *   *   *   *  *   *   *   *   *   *   * * *    0  0  0   0   1  1   4   0  0  0   0   0   0   0  0  0   0   0   0 |  0  0  0  0   4  4  2  2  0  0  0  0  0  0   0   0 | 0  2  2  2  2 0
..(..).. ..(..).. .o(..)..3.o(..).. ..(..).. *d3.x(..)..     &  0  4 0  0 | 0  0  0  0   6  0   0  0 0  0 | 0  0  0   0  0 0  0   4  0   0  0   0   0   0   0  0  0  0  0 |  *   *   *   *  *   * 48  *   *   *   *  *   *   *   *   *   *   * * * |   0  2  0   0   0  0   0   0  2  0   0   0   0   0  1  0   0   0   0 |  1  0  2  0   0  0  2  0  1  0  2  0  0  0   0   0 | 1  1  0  3  0 0
..(..).. ..(..).. ..(..).. .o(..)..3.o(..).. *d3.x(..)..     &  0  4 0  0 | 0  0  0  0   6  0   0  0 0  0 | 0  0  0   0  0 0  0   4  0   0  0   0   0   0   0  0  0  0  0 |  *   *   *   *  *   *  * 48   *   *   *  *   *   *   *   *   *   * * * |   0  0  2   0   0  0   0   0  0  2   0   0   0   0  0  1   0   0   0 |  0  1  0  2   0  0  0  2  0  1  0  2  0  0   0   0 | 1  0  1  0  3 0
..(..).. .o(x.).. ..(..).. ..(..).. ..(..)..    .x(o.)..&#x  &  0  2 2  0 | 0  0  0  0   1  4   0  0 1  0 | 0  0  0   0  0 0  0   0  2   2  0   0   0   0   0  0  0  0  0 |  *   *   *   *  *   *  *  * 144   *   *  *   *   *   *   *   *   * * * |   0  0  0   0   1  0   0   4  0  0   0   0   0   0  0  0   0   0   0 |  0  0  0  0   4  0  0  0  2  2  0  0  0  0   0   0 | 1  0  0  2  2 0
..(..).. ..(..).. ..(..).. .o(o.).. ..(..).. *d3.x(o.)..&#x  &  0  3 1  0 | 0  0  0  0   3  3   0  0 0  0 | 0  0  0   0  0 0  0   1  0   3  0   0   0   0   0  0  0  0  0 |  *   *   *   *  *   *  *  *   * 384   *  *   *   *   *   *   *   * * * |   0  0  0   1   0  0   0   1  1  1   1   0   0   0  0  0   0   0   0 |  0  0  1  1   2  0  0  0  1  1  1  1  0  0   0   0 | 1  0  0  2  2 0
..(..).. ..(..).. ..(..).. ..(..).. ..(..)..    .x(oo)x.&#zx    0  4 1  1 | 0  0  0  0   2  4   4  2 0  0 | 0  0  0   0  0 0  0   0  0   2  2   2   0   0   2  0  0  0  0 |  *   *   *   *  *   *  *  *   *   * 144  *   *   *   *   *   *   * * *    0  0  0   0   2  0   0   0  0  0   4   0   0   0  0  0   0   0   0 |  0  0  0  0   8  0  0  0  0  0  2  2  0  0   0   0 | 0  0  0  4  4 0
.x(.o)..3.o(.o).. ..(..).. ..(..).. ..(..)..    ..(..)..&#x  &  0  3 0  1 | 0  0  0  3   0  0   3  0 0  0 | 0  0  0   0  0 0  1   0  0   0  0   0   3   0   0  0  0  0  0 |  *   *   *   *  *   *  *  *   *   *   * 96   *   *   *   *   *   * * * |   0  0  0   0   0  1   0   0  0  0   0   4   0   0  0  0   0   0   0 |  0  0  0  0   0  4  0  0  0  0  0  0  2  2   0   0 | 0  2  2  0  0 1
.x(.o).. ..(..).. ..(..).. .o(.x).. ..(..)..    ..(..)..&#x  &  0  2 0  2 | 0  0  0  1   0  0   4  0 0  1 | 0  0  0   0  0 0  0   0  0   0  0   0   2   2   0  0  0  0  0 |  *   *   *   *  *   *  *  *   *   *   *  * 576   *   *   *   *   * * * |   0  0  0   0   0  0   1   0  0  0   0   1   1   1  0  0   1   0   0 |  0  0  0  0   1  1  1  1  0  0  0  0  1  1   1   1 | 0  1  1  1  1 1
..(..).. ..(..).. .o(.o)..3.o(.x).. ..(..)..    ..(..)..&#x  &  0  1 0  3 | 0  0  0  0   0  0   3  0 0  3 | 0  0  0   0  0 0  0   0  0   0  0   0   0   3   0  0  1  0  0 |  *   *   *   *  *   *  *  *   *   *   *  *   * 192   *   *   *   * * * |   0  0  0   0   0  0   0   0  0  0   0   0   2   0  1  0   0   2   0 |  0  0  0  0   0  0  2  0  0  0  2  0  1  0   3   0 | 0  1  0  3  0 1
..(..).. ..(..).. ..(..).. .o(.x)..3.o(.o)..    ..(..)..&#x  &  0  1 0  3 | 0  0  0  0   0  0   3  0 0  3 | 0  0  0   0  0 0  0   0  0   0  0   0   0   3   0  0  0  1  0 |  *   *   *   *  *   *  *  *   *   *   *  *   *   * 192   *   *   * * * |   0  0  0   0   0  0   0   0  0  0   0   0   0   2  0  1   0   0   2 |  0  0  0  0   0  0  0  2  0  0  0  2  0  1   0   3 | 0  0  1  0  3 1
..(..).. ..(..).. ..(..).. .o(.x).. ..(..).. *d3.x(.o)..&#x  &  0  3 0  3 | 0  0  0  0   3  0   6  0 0  3 | 0  0  0   0  0 0  0   1  0   0  0   0   0   3   3  0  0  0  1 |  *   *   *   *  *   *  *  *   *   *   *  *   *   *   * 192   *   * * *    0  0  0   0   0  0   2   0  0  0   2   0   0   0  1  1   0   0   0 |  0  0  0  0   3  1  2  2  0  0  2  2  0  0   0   0 | 0  1  1  3  3 0
.x(.o)o. ..(..).. ..(..).. ..(..).. ..(..)..    ..(..)..&#x  &  0  3 0  1 | 0  0  0  1   0  0   3  2 0  0 | 0  0  0   0  0 0  0   0  0   0  0   2   1   0   0  1  0  0  0 |  *   *   *   *  *   *  *  *   *   *   *  *   *   *   *   * 288   * * * |   0  0  0   0   1  0   0   0  0  0   0   0   0   0  0  0   4   0   0 |  0  0  0  0   4  0  0  0  0  0  0  0  0  0   2   2 | 0  0  0  2  2 1
..(..).. ..(..).. ..(..).. .o(.x)o. ..(..)..    ..(..)..&#x     0  2 0  2 | 0  0  0  0   0  0   4  1 0  1 | 0  0  0   0  0 0  0   0  0   0  0   2   0   2   0  0  0  0  0 |  *   *   *   *  *   *  *  *   *   *   *  *   *   *   *   *   * 576 * * |   0  0  0   0   0  0   0   0  0  0   1   0   0   0  0  0   2   1   1 |  0  0  0  0   2  0  0  0  0  0  1  1  0  0   2   2 | 0  0  0  2  2 1
..(..).. ..(..).. ..(.o)..3..(.x).. ..(..).. *d3..(.o)..        0  0 0  6 | 0  0  0  0   0  0   0  0 0 12 | 0  0  0   0  0 0  0   0  0   0  0   0   0   0   0  0  4  0  4 |  *   *   *   *  *   *  *  *   *   *   *  *   *   *   *   *   *   * 8 *    0  0  0   0   0  0   0   0  0  0   0   0   0   0  6  0   0   0   0 |  0  0  0  0   0  0  6  0  0  0  6  0  0  0   0   0 | 0  2  0  6  0 0
..(..).. ..(..).. ..(..).. ..(.x)..3..(.o).. *d3..(.o)..        0  0 0  6 | 0  0  0  0   0  0   0  0 0 12 | 0  0  0   0  0 0  0   0  0   0  0   0   0   0   0  0  0  4  4 |  *   *   *   *  *   *  *  *   *   *   *  *   *   *   *   *   *   * * 8    0  0  0   0   0  0   0   0  0  0   0   0   0   0  0  6   0   0   0 |  0  0  0  0   0  0  0  6  0  0  0  6  0  0   0   0 | 0  0  2  0  6 0
..(..).. xo(..).. ..(..).. oo(..).. ..(..).. *d3ox(..)..&#x  &  2  3 0  0 | 1  6  0  0   3  0   0  0 0  0 | 0  0  3   6  0 0  0   1  0   0  0   0   0   0   0  0  0  0  0 |  0   3   2   0  0   0  0  0   0   0   0  0   0   0   0   0   0   0 0 0 | 192  *  *   *   *  *   *   *  *  *   *   *   *   *  *  *   *   *   * |  1  1  0  0   0  1  0  0  0  0  0  0  0  0   0   0 | 1  1  1  0  0 0
..(..).. ..(..).. oo(..)..3oo(..).. ..(..).. *d3ox(..)..&#x  &  1  4 0  0 | 0  4  0  0   6  0   0  0 0  0 | 0  0  0   6  0 0  0   4  0   0  0   0   0   0   0  0  0  0  0 |  0   0   4   0  0   0  1  0   0   0   0  0   0   0   0   0   0   0 0 0 |   * 96  *   *   *  *   *   *  *  *   *   *   *   *  *  *   *   *   * |  1  0  1  0   0  0  1  0  0  0  0  0  0  0   0   0 | 1  1  0  1  0 0
..(..).. ..(..).. ..(..).. oo(..)..3oo(..).. *d3ox(..)..&#x  &  1  4 0  0 | 0  4  0  0   6  0   0  0 0  0 | 0  0  0   6  0 0  0   4  0   0  0   0   0   0   0  0  0  0  0 |  0   0   4   0  0   0  0  1   0   0   0  0   0   0   0   0   0   0 0 0 |   *  * 96   *   *  *   *   *  *  *   *   *   *   *  *  *   *   *   * |  0  1  0  1   0  0  0  1  0  0  0  0  0  0   0   0 | 1  0  1  0  1 0
..(..).. ..(..).. ..(..).. oo(o.).. ..(..).. *d3ox(o.)..&#x  &  1  3 1  0 | 0  3  1  0   3  3   0  0 0  0 | 0  0  0   3  3 0  0   1  0   3  0   0   0   0   0  0  0  0  0 |  0   0   1   3  0   0  0  0   0   1   0  0   0   0   0   0   0   0 0 0 |   *  *  * 384   *  *   *   *  *  *   *   *   *   *  *  *   *   *   * |  0  0  1  1   1  0  0  0  0  0  0  0  0  0   0   0 | 1  0  0  1  1 0
ox(xo)o. ..(..).. ..(..).. ..(..).. ..(..)..    ox(oo)x.&#xr &  1  6 2  1 | 0  4  2  2   3  8   6  4 1  0 | 0  2  0   2  4 1  0   0  2   4  4   4   2   0   3  2  0  0  0 |  0   0   0   2  2   1  0  0   1   0   2  0   0   0   0   0   2   0 0 0 |   *  *  *   * 144  *   *   *  *  *   *   *   *   *  *  *   *   *   * |  0  0  0  0   4  0  0  0  0  0  0  0  0  0   0   0 | 0  0  0  2  2 0  cycle(ABDEC)
ox(.o)..3xo(.o).. ..(..).. ..(..).. ..(..)..    ox(.o)..&#x  &  3  6 0  1 | 3 12  0  6   3  0   6  0 0  0 | 1  6  6   6  0 0  2   0  0   0  0   0   6   0   3  0  0  0  0 |  2   3   0   0  0   3  0  0   0   0   0  2   0   0   0   0   0   0 0 0 |   *  *  *   *   * 48   *   *  *  *   *   *   *   *  *  *   *   *   * |  0  0  0  0   0  4  0  0  0  0  0  0  0  0   0   0 | 0  2  2  0  0 0
ox(.o).. ..(..).. ..(..).. oo(.x).. ..(..).. *d3ox(.o)..&#x  &  1  6 0  3 | 0  6  0  3   6  0  12  0 0  3 | 0  3  0   6  0 0  0   2  0   0  0   0   6   6   6  0  0  0  1 |  0   0   2   0  0   3  0  0   0   0   0  0   3   0   0   2   0   0 0 0 |   *  *  *   *   *  * 192   *  *  *   *   *   *   *  *  *   *   *   * |  0  0  0  0   1  1  1  1  0  0  0  0  0  0   0   0 | 0  1  1  1  1 0
..(..).. .o(x.).. ..(..).. .o(o.).. ..(..).. *d3.x(o.)..&#x  &  0  3 2  0 | 0  0  0  0   3  6   0  0 1  0 | 0  0  0   0  0 0  0   1  3   6  0   0   0   0   0  0  0  0  0 |  0   0   0   0  0   0  0  0   3   2   0  0   0   0   0   0   0   0 0 0 |   *  *  *   *   *  *   * 192  *  *   *   *   *   *  *  *   *   *   * |  0  0  0  0   1  0  0  0  1  1  0  0  0  0   0   0 | 1  0  0  1  1 0
..(..).. ..(..).. .o(o.)..3.o(o.).. ..(..).. *d3.x(o.)..&#x  &  0  4 1  0 | 0  0  0  0   6  4   0  0 0  0 | 0  0  0   0  0 0  0   4  0   6  0   0   0   0   0  0  0  0  0 |  0   0   0   0  0   0  1  0   0   4   0  0   0   0   0   0   0   0 0 0 |   *  *  *   *   *  *   *   * 96  *   *   *   *   *  *  *   *   *   * |  0  0  1  0   0  0  0  0  1  0  1  0  0  0   0   0 | 1  0  0  2  0 0
..(..).. ..(..).. ..(..).. .o(o.)..3.o(o.).. *d3.x(o.)..&#x  &  0  4 1  0 | 0  0  0  0   6  4   0  0 0  0 | 0  0  0   0  0 0  0   4  0   6  0   0   0   0   0  0  0  0  0 |  0   0   0   0  0   0  0  1   0   4   0  0   0   0   0   0   0   0 0 0 |   *  *  *   *   *  *   *   *  * 96   *   *   *   *  *  *   *   *   * |  0  0  0  1   0  0  0  0  0  1  0  1  0  0   0   0 | 1  0  0  0  2 0
..(..).. ..(..).. ..(..).. .o(ox)o. ..(..).. *d3.x(oo)x.&#xr    0  6 1  3 | 0  0  0  0   6  6  12  3 0  3 | 0  0  0   0  0 0  0   2  0   6  3   6   0   6   6  0  0  0  1 |  0   0   0   0  0   0  0  0   0   2   3  0   0   0   0   2   0   3 0 0 |   *  *  *   *   *  *   *   *  *  * 192   *   *   *  *  *   *   *   * |  0  0  0  0   2  0  0  0  0  0  1  1  0  0   0   0 | 0  0  0  2  2 0  cycle (BDEC)
.x(.o)..3.o(.o).. ..(..).. .o(.x).. ..(..)..    ..(..)..&#x  &  0  3 0  2 | 0  0  0  3   0  0   6  0 0  1 | 0  0  0   0  0 0  1   0  0   0  0   0   6   3   0  0  0  0  0 |  0   0   0   0  0   0  0  0   0   0   0  2   3   0   0   0   0   0 0 0 |   *  *  *   *   *  *   *   *  *  *   * 192   *   *  *  *   *   *   * |  0  0  0  0   0  1  0  0  0  0  0  0  1  1   0   0 | 0  1  1  0  0 1
.x(.o).. ..(..).. .o(.o)..3.o(.x).. ..(..)..    ..(..)..&#x  &  0  2 0  3 | 0  0  0  1   0  0   6  0 0  3 | 0  0  0   0  0 0  0   0  0   0  0   0   3   6   0  0  1  0  0 |  0   0   0   0  0   0  0  0   0   0   0  0   3   2   0   0   0   0 0 0 |   *  *  *   *   *  *   *   *  *  *   *   * 192   *  *  *   *   *   * |  0  0  0  0   0  0  1  0  0  0  0  0  1  0   1   0 | 0  1  0  1  0 1
.x(.o).. ..(..).. ..(..).. .o(.x)..3.o(.o)..    ..(..)..&#x  &  0  2 0  3 | 0  0  0  1   0  0   6  0 0  3 | 0  0  0   0  0 0  0   0  0   0  0   0   3   6   0  0  0  1  0 |  0   0   0   0  0   0  0  0   0   0   0  0   3   0   2   0   0   0 0 0 |   *  *  *   *   *  *   *   *  *  *   *   *   * 192  *  *   *   *   * |  0  0  0  0   0  0  0  1  0  0  0  0  0  1   0   1 | 0  0  1  0  1 1
..(..).. ..(..).. .o(.o)..3.o(.x).. ..(..).. *d3.x(.o)..&#x  &  0  4 0  6 | 0  0  0  0   6  0  12  0 0 12 | 0  0  0   0  0 0  0   4  0   0  0   0   0  12   6  0  4  0  4 |  0   0   0   0  0   0  1  0   0   0   0  0   0   4   0   4   0   0 1 0 |   *  *  *   *   *  *   *   *  *  *   *   *   *   * 48  *   *   *   * |  0  0  0  0   0  0  2  0  0  0  2  0  0  0   0   0 | 0  1  0  3  0 0
..(..).. ..(..).. ..(..).. .o(.x)..3.o(.o).. *d3.x(.o)..&#x  &  0  4 0  6 | 0  0  0  0   6  0  12  0 0 12 | 0  0  0   0  0 0  0   4  0   0  0   0   0  12   6  0  0  4  4 |  0   0   0   0  0   0  0  1   0   0   0  0   0   0   4   4   0   0 0 1 |   *  *  *   *   *  *   *   *  *  *   *   *   *   *  * 48   *   *   * |  0  0  0  0   0  0  0  2  0  0  0  2  0  0   0   0 | 0  0  1  0  3 0
.x(.o)o. ..(..).. ..(..).. .o(.x)o. ..(..)..    ..(..)..&#x  &  0  3 0  2 | 0  0  0  1   0  0   6  2 0  1 | 0  0  0   0  0 0  0   0  0   0  0   4   2   3   0  1  0  0  0 |  0   0   0   0  0   0  0  0   0   0   0  0   1   0   0   0   2   2 0 0 |   *  *  *   *   *  *   *   *  *  *   *   *   *   *  *  * 576   *   * |  0  0  0  0   1  0  0  0  0  0  0  0  0  0   1   1 | 0  0  0  1  1 1
..(..).. ..(..).. .o(.o)o.3.o(.x)o. ..(..)..    ..(..)..&#x     0  2 0  3 | 0  0  0  0   0  0   6  1 0  3 | 0  0  0   0  0 0  0   0  0   0  0   3   0   6   0  0  1  0  0 |  0   0   0   0  0   0  0  0   0   0   0  0   0   2   0   0   0   3 0 0 |   *  *  *   *   *  *   *   *  *  *   *   *   *   *  *  *   * 192   * |  0  0  0  0   0  0  0  0  0  0  1  0  0  0   2   0 | 0  0  0  2  0 1
..(..).. ..(..).. ..(..).. .o(.x)o.3.o(.o)o.    ..(..)..&#x     0  2 0  3 | 0  0  0  0   0  0   6  1 0  3 | 0  0  0   0  0 0  0   0  0   0  0   3   0   6   0  0  0  1  0 |  0   0   0   0  0   0  0  0   0   0   0  0   0   0   2   0   0   3 0 0 |   *  *  *   *   *  *   *   *  *  *   *   *   *   *  *  *   *   * 192 |  0  0  0  0   0  0  0  0  0  0  0  1  0  0   0   2 | 0  0  0  0  2 1
..(..).. xo(..).. oo(..)..3oo(..).. ..(..).. *d3ox(..)..&#x  &  2  4 0  0 | 1  8  0  0   6  0   0  0 0  0 | 0  0  4  12  0 0  0   4  0   0  0   0   0   0   0  0  0  0  0 |  0   6   8   0  0   0  1  0   0   0   0  0   0   0   0   0   0   0 0 0 |   4  2  0   0   0  0   0   0  0  0   0   0   0   0  0  0   0   0   0 | 48  *  *  *   *  *  *  *  *  *  *  *  *  *   *   * | 1  1  0  0  0 0
..(..).. xo(..).. ..(..).. oo(..)..3oo(..).. *d3ox(..)..&#x  &  2  4 0  0 | 1  8  0  0   6  0   0  0 0  0 | 0  0  4  12  0 0  0   4  0   0  0   0   0   0   0  0  0  0  0 |  0   6   8   0  0   0  0  1   0   0   0  0   0   0   0   0   0   0 0 0 |   4  0  2   0   0  0   0   0  0  0   0   0   0   0  0  0   0   0   0 |  * 48  *  *   *  *  *  *  *  *  *  *  *  *   *   * | 1  0  1  0  0 0
..(..).. ..(..).. oo(o.)..3oo(o.).. ..(..).. *d3ox(o.)..&#x  &  1  4 1  0 | 0  4  1  0   6  4   0  0 0  0 | 0  0  0   6  4 0  0   4  0   6  0   0   0   0   0  0  0  0  0 |  0   0   4   6  0   0  1  0   0   4   0  0   0   0   0   0   0   0 0 0 |   0  1  0   4   0  0   0   0  1  0   0   0   0   0  0  0   0   0   0 |  *  * 96  *   *  *  *  *  *  *  *  *  *  *   *   * | 1  0  0  1  0 0
..(..).. ..(..).. ..(..).. oo(o.)..3oo(o.).. *d3ox(o.)..&#x  &  1  4 1  0 | 0  4  1  0   6  4   0  0 0  0 | 0  0  0   6  4 0  0   4  0   6  0   0   0   0   0  0  0  0  0 |  0   0   4   6  0   0  0  1   0   4   0  0   0   0   0   0   0   0 0 0 |   0  0  1   4   0  0   0   0  0  1   0   0   0   0  0  0   0   0   0 |  *  *  * 96   *  *  *  *  *  *  *  *  *  *   *   * | 1  0  0  0  1 0
ox(xo)o. ..(..).. ..(..).. oo(ox)o. ..(..).. *d3ox(oo)x.&#xr &  1  9 2  3 | 0  6  2  3   9 12  18  6 1  3 | 0  3  0   6  6 1  0   3  3  12  6  12   6   9   9  3  0  0  1 |  0   0   2   6  3   3  0  0   3   4   6  0   3   0   0   3   6   6 0 0 |   0  0  0   2   3  0   1   1  0  0   2   0   0   0  0  0   3   0   0 |  *  *  *  * 192  *  *  *  *  *  *  *  *  *   *   * | 0  0  0  1  1 0  cycle(ABDEC)
ox(.o)..3xo(.o).. ..(..).. oo(.x).. ..(..).. *d3ox(.o)..&#xt &  3  9 0  3 | 3 18  0  9   9  0  18  0 0  3 | 1  9  9  18  0 0  3   3  0   0  0   0  18   9   9  0  0  0  1 |  3   9   6   0  0   9  0  0   0   0   0  6   9   0   0   3   0   0 0 0 |   3  0  0   0   0  3   3   0  0  0   0   3   0   0  0  0   0   0   0 |  *  *  *  *   * 64  *  *  *  *  *  *  *  *   *   * | 0  1  1  0  0 0
ox(.o).. ..(..).. oo(.o)..3oo(.x).. ..(..).. *d3ox(.o)..&#xt &  1  8 0  6 | 0  8  0  4  12  0  24  0 0 12 | 0  4  0  12  0 0  0   8  0   0  0   0  12  24  12  0  4  0  4 |  0   0   8   0  0   6  2  0   0   0   0  0  12   8   0   8   0   0 1 0 |   0  2  0   0   0  0   4   0  0  0   0   0   4   0  2  0   0   0   0 |  *  *  *  *   *  * 48  *  *  *  *  *  *  *   *   * | 0  1  0  1  0 0
ox(.o).. ..(..).. ..(..).. oo(.x)..3oo(.o).. *d3ox(.o)..&#xt &  1  8 0  6 | 0  8  0  4  12  0  24  0 0 12 | 0  4  0  12  0 0  0   8  0   0  0   0  12  24  12  0  0  4  4 |  0   0   8   0  0   6  0  2   0   0   0  0  12   0   8   8   0   0 0 1 |   0  0  2   0   0  0   4   0  0  0   0   0   0   4  0  2   0   0   0 |  *  *  *  *   *  *  * 48  *  *  *  *  *  *   *   * | 0  0  1  0  1 0
..(..).. .o(x.).. .o(o.)..3.o(o.).. ..(..).. *d3.x(o.)..&#x  &  0  4 2  0 | 0  0  0  0   6  8   0  0 1  0 | 0  0  0   0  0 0  0   4  4  12  0   0   0   0   0  0  0  0  0 |  0   0   0   0  0   0  1  0   6   8   0  0   0   0   0   0   0   0 0 0 |   0  0  0   0   0  0   0   4  2  0   0   0   0   0  0  0   0   0   0 |  *  *  *  *   *  *  *  * 48  *  *  *  *  *   *   * | 1  0  0  1  0 0
..(..).. .o(x.).. ..(..).. .o(o.)..3.o(o.).. *d3.x(o.)..&#x  &  0  4 2  0 | 0  0  0  0   6  8   0  0 1  0 | 0  0  0   0  0 0  0   4  4  12  0   0   0   0   0  0  0  0  0 |  0   0   0   0  0   0  0  1   6   8   0  0   0   0   0   0   0   0 0 0 |   0  0  0   0   0  0   0   4  0  2   0   0   0   0  0  0   0   0   0 |  *  *  *  *   *  *  *  *  * 48  *  *  *  *   *   * | 1  0  0  0  1 0
..(..).. ..(..).. .o(oo)o.3.o(ox)o. ..(..).. *d3.x(oo)x.&#xt    0  8 1  6 | 0  0  0  0  12  8  24  4 0 12 | 0  0  0   0  0 0  0   8  0  12  4  12   0  24  12  0  4  0  4 |  0   0   0   0  0   0  2  0   0   8   6  0   0   8   0   8   0  12 1 0 |   0  0  0   0   0  0   0   0  2  0   4   0   0   0  2  0   0   4   0 |  *  *  *  *   *  *  *  *  *  * 48  *  *  *   *   * | 0  0  0  2  0 0
..(..).. ..(..).. ..(..).. .o(ox)o.3.o(oo)o. *d3.x(oo)x.&#xt    0  8 1  6 | 0  0  0  0  12  8  24  4 0 12 | 0  0  0   0  0 0  0   8  0  12  4  12   0  24  12  0  0  4  4 |  0   0   0   0  0   0  0  2   0   8   6  0   0   0   8   8   0  12 0 1 |   0  0  0   0   0  0   0   0  0  2   4   0   0   0  0  2   0   0   4 |  *  *  *  *   *  *  *  *  *  *  * 48  *  *   *   * | 0  0  0  0  2 0
.x(.o)..3.o(.o).. .o(.o)..3.o(.x).. ..(..)..    ..(..)..&#x  &  0  3 0  3 | 0  0  0  3   0  0   9  0 0  3 | 0  0  0   0  0 0  1   0  0   0  0   0   9   9   0  0  1  0  0 |  0   0   0   0  0   0  0  0   0   0   0  3   9   3   0   0   0   0 0 0 |   0  0  0   0   0  0   0   0  0  0   0   3   3   0  0  0   0   0   0 |  *  *  *  *   *  *  *  *  *  *  *  * 64  *   *   * | 0  1  0  0  0 1
.x(.o)..3.o(.o).. ..(..).. .o(.x)..3.o(.o)..    ..(..)..&#x  &  0  3 0  3 | 0  0  0  3   0  0   9  0 0  3 | 0  0  0   0  0 0  1   0  0   0  0   0   9   9   0  0  0  1  0 |  0   0   0   0  0   0  0  0   0   0   0  3   9   0   3   0   0   0 0 0 |   0  0  0   0   0  0   0   0  0  0   0   3   0   3  0  0   0   0   0 |  *  *  *  *   *  *  *  *  *  *  *  *  * 64   *   * | 0  0  1  0  0 1
.x(.o)o. ..(..).. .o(.o)o.3.o(.x)o. ..(..)..    ..(..)..&#x  &  0  3 0  3 | 0  0  0  1   0  0   9  2 0  3 | 0  0  0   0  0 0  0   0  0   0  0   6   3   9   0  1  1  0  0 |  0   0   0   0  0   0  0  0   0   0   0  0   3   3   0   0   3   6 0 0 |   0  0  0   0   0  0   0   0  0  0   0   0   1   0  0  0   3   2   0 |  *  *  *  *   *  *  *  *  *  *  *  *  *  * 192   * | 0  0  0  1  0 1
.x(.o)o. ..(..).. ..(..).. .o(.x)o.3.o(.o)o.    ..(..)..&#x  &  0  3 0  3 | 0  0  0  1   0  0   9  2 0  3 | 0  0  0   0  0 0  0   0  0   0  0   6   3   9   0  1  0  1  0 |  0   0   0   0  0   0  0  0   0   0   0  0   3   0   3   0   3   6 0 0 |   0  0  0   0   0  0   0   0  0  0   0   0   0   1  0  0   3   0   2 |  *  *  *  *   *  *  *  *  *  *  *  *  *  *   * 192 | 0  0  0  0  1 1
..(..).. xo(x.).. oo(o.)..3oo(o.)..3oo(o.).. *d3ox(o.)..&#xt &  2  8 2  0 | 1 16  2  0  24 16   0  0 1  0 | 0  0  8  48 16 0  0  32  8  48  0   0   0   0   0  0  0  0  0 |  0  24  64  48  0   0  8  8  24  64   0  0   0   0   0   0   0   0 0 0 |  32 16 16  64   0  0   0  32 16 16   0   0   0   0  0  0   0   0   0 |  8  8 16 16   0  0  0  0  8  8  0  0  0  0   0   0 | 6  *  *  *  * *
ox(.o)..3xo(.o).. oo(.o)..3oo(.x).. ..(..).. *d3ox(.o)..&#xt &  3 12 0  6 | 3 24  0 12  18  0  36  0 0 12 | 1 12 12  36  0 0  4  12  0   0  0   0  36  36  18  0  4  0  4 |  4  18  24   0  0  18  3  0   0   0   0 12  36  12   0  12   0   0 1 0 |  12  6  0   0   0  6  12   0  0  0   0  12  12   0  3  0   0   0   0 |  3  0  0  0   0  4  3  0  0  0  0  0  4  0   0   0 | * 16  *  *  * *
ox(.o)..3xo(.o).. ..(..).. oo(.x)..3oo(.o).. *d3ox(.o)..&#xt &  3 12 0  6 | 3 24  0 12  18  0  36  0 0 12 | 1 12 12  36  0 0  4  12  0   0  0   0  36  36  18  0  0  4  4 |  4  18  24   0  0  18  0  3   0   0   0 12  36   0  12  12   0   0 0 1 |  12  0  6   0   0  6  12   0  0  0   0  12   0  12  0  3   0   0   0 |  0  3  0  0   0  4  0  3  0  0  0  0  0  4   0   0 | *  * 16  *  * *
ox(xo)o. ..(..).. oo(oo)o.3oo(ox)o. ..(..).. *d3ox(oo)x.&#xr &  1 12 2  6 | 0  8  2  4  18 16  36  8 1 12 | 0  4  0  12  8 1  0  12  4  24  8  24  12  36  18  4  4  0  4 |  0   0   8  12  4   6  3  0   6  16  12  0  12  12   0  12  12  24 1 0 |   0  2  0   8   6  0   4   4  4  0   8   0   4   0  3  0  12   8   0 |  0  0  2  0   4  0  1  0  1  0  2  0  0  0   4   0 | *  *  * 48  * *  cycle(ABDEC)
ox(xo)o. ..(..).. ..(..).. oo(ox)o.3oo(oo)o. *d3ox(oo)x.&#xr &  1 12 2  6 | 0  8  2  4  18 16  36  8 1 12 | 0  4  0  12  8 1  0  12  4  24  8  24  12  36  18  4  0  4  4 |  0   0   8  12  4   6  0  3   6  16  12  0  12   0  12  12  12  24 0 1 |   0  0  2   8   6  0   4   4  0  4   8   0   0   4  0  3  12   0   8 |  0  0  0  2   4  0  0  1  0  1  0  2  0  0   0   4 | *  *  *  * 48 *  cycle(ABDEC)
.x(.o)o.3.o(.o)x. .o(.o)o.3.o(.x)o.3.o(.o)o.    ..(..)..&#xt    0  6 0  6 | 0  0  0  6   0  0  36  6 0 12 | 0  0  0   0  0 0  2   0  0   0  0  36  36  72   0  6  4  4  0 |  0   0   0   0  0   0  0  0   0   0   0 12  72  24  24   0  36  72 0 0 |   0  0  0   0   0  0   0   0  0  0   0  24  24  24  0  0  72  24  24 |  0  0  0  0   0  0  0  0  0  0  0  0  8  8  24  24 | *  *  *  *  * 8

© 2004-2019
top of page